Index of /mirror/parabola.nu/pool/packages

[ICO]NameLast modifiedSize

[PARENTDIR]Parent Directory  -
[PGP]python-django-1.10.1-1-any.pkg.tar.xz.sig2016-09-18 21:03 72
[PGP]python2-django-1.10.1-1-any.pkg.tar.xz.sig2016-09-18 21:03 72
[PGP]gmetadom-0.2.6-10-x86_64.pkg.tar.zst.sig2020-08-30 02:13 95
[PGP]iana-etc-20160513-1-any.pkg.tar.xz.sig2016-05-17 21:13 96
[PGP]budgie-desktop-10.9.1-1-x86_64.pkg.tar.zst.sig2024-02-03 01:15 118
[PGP]eq10q-2.2-5-x86_64.pkg.tar.zst.sig2023-05-24 02:31 118
[PGP]gvfs-goa-1.53.90-1-x86_64.pkg.tar.zst.sig2024-02-19 01:17 118
[PGP]irqbalance-1.9.3-2-x86_64.pkg.tar.zst.sig2024-01-18 01:14 118
[PGP]libavtp-0.2.0-2-x86_64.pkg.tar.zst.sig2023-03-19 01:13 118
[PGP]libblockdev-nvdimm-3.1.0-1-x86_64.pkg.tar.zst.sig2024-02-24 01:15 118
[PGP]libutempter-1.2.1-4-x86_64.pkg.tar.zst.sig2023-10-08 02:14 118
[PGP]lv2-1.18.10-1-x86_64.pkg.tar.zst.sig2023-05-24 03:06 118
[PGP]neovim-lspconfig-0.1.6-1-any.pkg.tar.zst.sig2023-05-24 03:11 118
[PGP]openssh-9.6p1-3-x86_64.pkg.tar.zst.sig2024-02-21 01:13 118
[PGP]ot-cryptid-standalone-1.0.1-3-x86_64.pkg.tar.zst.sig2023-12-02 01:16 118
[PGP]php-snmp-8.3.3-1-x86_64.pkg.tar.zst.sig2024-02-17 01:17 118
[PGP]python-autobahn-23.6.2-1-x86_64.pkg.tar.zst.sig2023-06-25 02:13 118
[PGP]qemu-hw-display-virtio-gpu-gl-8.0.2-1-x86_64.pkg.tar.zst.sig2023-06-04 02:14 118
[PGP]qemu-system-alpha-firmware-8.0.2-1-x86_64.pkg.tar.zst.sig2023-06-04 02:14 118
[PGP]qemu-system-alpha-firmware-8.2.1-2-x86_64.pkg.tar.zst.sig2024-02-06 01:15 118
[PGP]sdl_mixer-1.2.12-12-x86_64.pkg.tar.zst.sig2023-05-24 03:28 118
[PGP]a2jmidid-9-4-x86_64.pkg.tar.zst.sig2023-05-24 02:18 119
[PGP]aardvark-dns-1.10.0-1-x86_64.pkg.tar.zst.sig2024-01-26 01:13 119
[PGP]abduco-0.6-6-x86_64.pkg.tar.zst.sig2023-05-24 02:18 119
[PGP]abletonlink-3.1.1-1-any.pkg.tar.zst.sig2024-02-20 01:13 119
[PGP]abseil-cpp-20230802.1-1-x86_64.pkg.tar.zst.sig2023-09-21 02:14 119
[PGP]acl-2.3.2-1-x86_64.pkg.tar.zst.sig2024-01-25 01:13 119
[PGP]acpica-20230628-1-x86_64.pkg.tar.zst.sig2023-08-30 02:14 119
[PGP]adios2-2.9.2-2-x86_64.pkg.tar.zst.sig2024-01-26 01:16 119
[PGP]adljack-1.3.1-1-x86_64.pkg.tar.zst.sig2024-02-19 01:15 119
[PGP]adljack-1.3.1-2-x86_64.pkg.tar.zst.sig2024-02-21 01:16 119
[PGP]adrdox-2.5.4-1-x86_64.pkg.tar.zst.sig2023-08-02 02:14 119
[PGP]adriconf-2.7.1-1-x86_64.pkg.tar.zst.sig2023-08-27 02:13 119
[PGP]adwaita-cursors-46alpha-1-any.pkg.tar.zst.sig2024-02-25 01:14 119
[PGP]adwaita-icon-theme-46alpha-1-any.pkg.tar.zst.sig2024-02-25 01:14 119
[PGP]aeolus-0.10.4-2-x86_64.pkg.tar.zst.sig2023-05-24 02:19 119
[PGP]agordejo-0.4.2-1-any.pkg.tar.zst.sig2023-05-24 02:19 119
[PGP]aida-x-1.1.0-1-x86_64.pkg.tar.zst.sig2024-02-02 01:14 119
[PGP]aida-x-clap-1.1.0-1-x86_64.pkg.tar.zst.sig2024-02-02 01:14 119
[PGP]aida-x-lv2-1.1.0-1-x86_64.pkg.tar.zst.sig2024-02-02 01:14 119
[PGP]aida-x-standalone-1.1.0-1-x86_64.pkg.tar.zst.sig2024-02-02 01:14 119
[PGP]aida-x-vst-1.1.0-1-x86_64.pkg.tar.zst.sig2024-02-02 01:14 119
[PGP]aida-x-vst3-1.1.0-1-x86_64.pkg.tar.zst.sig2024-02-02 01:14 119
[PGP]aisleriot-3.22.30-1-x86_64.pkg.tar.zst.sig2023-12-07 16:42 119
[PGP]alacritty-0.13.1-1-x86_64.pkg.tar.zst.sig2024-01-09 01:13 119
[PGP]alsa-card-profiles-1:1.0.3-1-x86_64.pkg.tar.zst.sig2024-02-03 01:15 119
[PGP]alsa-lib-1.2.11-1-x86_64.pkg.tar.zst.sig2024-02-02 01:16 119
[PGP]alsa-oss-1.1.8-5-x86_64.pkg.tar.zst.sig2023-03-19 01:13 119
[PGP]alsa-plugins-1:1.2.7.1-2-x86_64.pkg.tar.zst.sig2023-03-04 01:13 119
[PGP]alsa-scarlett-gui-0.3.3-1-x86_64.pkg.tar.zst.sig2024-01-03 01:14 119
[PGP]alsa-tools-1.2.11-1-x86_64.pkg.tar.zst.sig2024-02-02 01:16 119
[PGP]alsa-topology-conf-1.2.5.1-3-any.pkg.tar.zst.sig2023-03-19 01:13 119
[PGP]alsa-ucm-conf-1.2.11-1-any.pkg.tar.zst.sig2024-02-02 01:16 119
[PGP]alsa-utils-1.2.11-1-x86_64.pkg.tar.zst.sig2024-02-02 01:16 119
[PGP]ambix-0.2.10-4-x86_64.pkg.tar.zst.sig2023-05-24 02:19 119
[PGP]ambix-lv2-0.2.10-4-x86_64.pkg.tar.zst.sig2023-05-24 02:19 119
[PGP]ambix-standalone-0.2.10-4-x86_64.pkg.tar.zst.sig2023-05-24 02:19 119
[PGP]ambix-vst-0.2.10-4-x86_64.pkg.tar.zst.sig2023-05-24 02:19 119
[PGP]ams-2.2.1-1-x86_64.pkg.tar.zst.sig2023-05-24 02:19 119
[PGP]ams-lv2-1.2.2-4-x86_64.pkg.tar.zst.sig2023-05-24 02:19 119
[PGP]amsynth-1.13.2-1-x86_64.pkg.tar.zst.sig2023-05-24 02:19 119
[PGP]angle-grinder-0.19.2-1-x86_64.pkg.tar.zst.sig2023-06-21 02:17 119
[PGP]ansible-bender-0.10.1-2-any.pkg.tar.zst.sig2023-05-24 02:19 119
[PGP]ansible-language-server-1.2.1-1-any.pkg.tar.zst.sig2023-07-28 02:13 119
[PGP]antlr4-4.13.1-1-any.pkg.tar.zst.sig2023-10-10 02:13 119
[PGP]antlr4-runtime-4.13.1-1-x86_64.pkg.tar.zst.sig2023-10-10 02:13 119
[PGP]anything-sync-daemon-6.0.0-2-any.pkg.tar.zst.sig2023-05-24 02:19 119
[PGP]aom-3.8.1-1-x86_64.pkg.tar.zst.sig2024-01-22 22:51 119
[PGP]aom-docs-3.8.1-1-x86_64.pkg.tar.zst.sig2024-01-22 22:51 119
[PGP]apitrace-11.1-2-x86_64.pkg.tar.zst.sig2023-06-27 02:13 119
[PGP]apparmor-3.1.7-1-x86_64.pkg.tar.zst.sig2024-02-08 01:17 119
[PGP]appstream-generator-0.9.1-2-x86_64.pkg.tar.zst.sig2024-01-07 17:00 119
[PGP]apptainer-1.2.5-1-x86_64.pkg.tar.zst.sig2024-01-18 01:14 119
[PGP]arch-release-promotion-0.3.0-1-any.pkg.tar.zst.sig2023-09-17 02:14 119
[PGP]archiso-75-1-any.pkg.tar.zst.sig2024-02-23 01:13 119
[PGP]ardour-8.4-1-x86_64.pkg.tar.zst.sig2024-02-21 01:15 119
[PGP]arduino-avr-core-1.8.3-2-any.pkg.tar.zst.sig2023-05-24 02:20 119
[PGP]arduino-docs-1.6.6-8-any.pkg.tar.zst.sig2023-05-24 02:20 119
[PGP]argon2-20190702-5-x86_64.pkg.tar.zst.sig2023-04-28 02:13 119
[PGP]arp-scan-1.10.0-4-x86_64.pkg.tar.zst.sig2023-12-16 01:13 119
[PGP]arpack-3.9.1-2-x86_64.pkg.tar.zst.sig2024-01-26 01:16 119
[PGP]arrow-15.0.0-3-x86_64.pkg.tar.zst.sig2024-02-22 01:14 119
[PGP]artyfx-1.3.1-2-x86_64.pkg.tar.zst.sig2023-05-24 02:20 119
[PGP]aspell-da-4.2.1-1-any.pkg.tar.zst.sig2023-05-24 02:20 119
[PGP]aspell-de-20161207.7.0-1-x86_64.pkg.tar.zst.sig2022-12-17 20:48 119
[PGP]asplib-20160310.da66f51-4-x86_64.pkg.tar.zst.sig2023-05-24 02:20 119
[PGP]astyle-3.4.10-1-x86_64.pkg.tar.zst.sig2023-10-30 01:19 119
[PGP]asunder-3.0.1-1-x86_64.pkg.tar.zst.sig2023-08-02 02:14 119
[PGP]at-3.2.5-2-x86_64.pkg.tar.zst.sig2023-05-24 02:21 119
[PGP]at-spi2-core-2.50.1-1-x86_64.pkg.tar.zst.sig2024-01-07 01:13 119
[PGP]at-spi2-core-2.51.90-1-x86_64.pkg.tar.zst.sig2024-02-15 01:15 119
[PGP]at-spi2-core-docs-2.50.1-1-x86_64.pkg.tar.zst.sig2024-01-07 01:13 119
[PGP]at-spi2-core-docs-2.51.90-1-x86_64.pkg.tar.zst.sig2024-02-15 01:15 119
[PGP]at51-1.0.0-4-x86_64.pkg.tar.zst.sig2023-05-24 02:21 119
[PGP]atftp-0.8.0-3-x86_64.pkg.tar.zst.sig2023-05-24 02:21 119
[PGP]atkmm-2.28.4-1-x86_64.pkg.tar.zst.sig2024-01-28 01:14 119
[PGP]atkmm-2.36-2.36.3-1-x86_64.pkg.tar.zst.sig2024-01-28 01:14 119
[PGP]atkmm-2.36-docs-2.36.3-1-x86_64.pkg.tar.zst.sig2024-01-28 01:14 119
[PGP]atkmm-docs-2.28.4-1-x86_64.pkg.tar.zst.sig2024-01-28 01:14 119
[PGP]atop-2.10.0-1-x86_64.pkg.tar.zst.sig2024-01-06 01:13 119
[PGP]attr-2.5.2-1-x86_64.pkg.tar.zst.sig2024-01-15 01:15 119
[PGP]audaspace-1.4.0-2-x86_64.pkg.tar.zst.sig2023-05-24 02:21 119
[PGP]audit-4.0-1-x86_64.pkg.tar.zst.sig2024-01-18 01:14 119
[PGP]automake-1.16.5-2-any.pkg.tar.zst.sig2023-03-18 01:14 119
[PGP]autopep8-1:2.0.4-1-any.pkg.tar.zst.sig2023-09-17 02:14 119
[PGP]autorandr-1.14-1-any.pkg.tar.zst.sig2023-06-26 02:13 119
[PGP]avahi-1:0.8+r194+g3f79789-1-x86_64.pkg.tar.zst.sig2024-01-09 01:13 119
[PGP]avisynthplus-3.7.3-1-x86_64.pkg.tar.zst.sig2023-07-19 02:14 119
[PGP]avldrums.lv2-0.7.2-1-x86_64.pkg.tar.zst.sig2023-09-19 02:13 119
[PGP]aws-cli-1.32.34-1-any.pkg.tar.zst.sig2024-02-07 01:14 119
[PGP]aws-cli-v2-2.15.19-1-any.pkg.tar.zst.sig2024-02-11 01:14 119
[PGP]awxkit-23.8.0-1-any.pkg.tar.zst.sig2024-02-15 01:14 119
[PGP]backuppc-4.4.0-7-x86_64.pkg.tar.zst.sig2023-08-08 02:14 119
[PGP]bacon-2.14.1-1-x86_64.pkg.tar.zst.sig2023-12-29 01:13 119
[PGP]bat-extras-2023.09.19-1-any.pkg.tar.zst.sig2023-09-23 02:13 119
[PGP]bchoppr-1.12.6-1-x86_64.pkg.tar.zst.sig2023-05-24 02:21 119
[PGP]bear-3.1.3-9-x86_64.pkg.tar.zst.sig2024-02-22 01:14 119
[PGP]bearssl-0.6-5-x86_64.pkg.tar.zst.sig2023-05-24 02:21 119
[PGP]benchmark-1.8.3-1-x86_64.pkg.tar.zst.sig2023-09-08 02:13 119
[PGP]bespokesynth-1.2.1-1-x86_64.pkg.tar.zst.sig2023-09-17 02:14 119
[PGP]bettercap-caplets-v20210412.r372.2d58298-3-any.pkg.tar.zst.sig2023-05-24 02:21 119
[PGP]bfs-3.0.4-1-x86_64.pkg.tar.zst.sig2023-10-16 19:00 119
[PGP]bftpd-6.1-3-x86_64.pkg.tar.zst.sig2023-09-23 18:05 119
[PGP]biblesync-2.1.0-3-x86_64.pkg.tar.zst.sig2023-05-24 02:21 119
[PGP]bibutils-7.2-2-x86_64.pkg.tar.zst.sig2023-05-24 02:21 119
[PGP]bigloo-4.5a_1-4-x86_64.pkg.tar.zst.sig2023-06-11 02:14 119
[PGP]bin86-0.16.21-4-x86_64.pkg.tar.zst.sig2023-05-24 02:21 119
[PGP]bind-9.18.24-1-x86_64.pkg.tar.zst.sig2024-02-14 01:14 119
[PGP]binwalk-2.3.4-3-any.pkg.tar.zst.sig2024-02-27 01:14 119
[PGP]bird-2.14-1-x86_64.pkg.tar.zst.sig2023-10-09 02:14 119
[PGP]bitsery-5.2.3-1-any.pkg.tar.zst.sig2023-05-24 02:21 119
[PGP]blaze-3.8.2-2-any.pkg.tar.zst.sig2023-12-30 01:15 119
[PGP]blop-0.2.8-5-x86_64.pkg.tar.zst.sig2023-05-24 02:21 119
[PGP]blop.lv2-1.0.4-2-x86_64.pkg.tar.zst.sig2023-05-24 02:21 119
[PGP]blosc-1.21.5-1-x86_64.pkg.tar.zst.sig2023-09-05 02:13 119
[PGP]bmake-20240108-1-x86_64.pkg.tar.zst.sig2024-01-15 01:16 119
[PGP]boost-1.83.0-5-x86_64.pkg.tar.zst.sig2024-01-26 01:16 119
[PGP]boost-libs-1.83.0-5-x86_64.pkg.tar.zst.sig2024-01-26 01:16 119
[PGP]bootconfig-6.7-1-x86_64.pkg.tar.zst.sig2024-01-09 01:13 119
[PGP]bottom-0.9.6-1-x86_64.pkg.tar.zst.sig2023-08-29 02:13 119
[PGP]bpf-6.7-1-x86_64.pkg.tar.zst.sig2024-01-09 01:13 119
[PGP]bridge-utils-1.7.1-1-x86_64.pkg.tar.zst.sig2021-03-24 01:13 119
[PGP]brltty-6.6-5-x86_64.pkg.tar.zst.sig2024-02-12 01:14 119
[PGP]brltty-udev-generic-6.6-5-x86_64.pkg.tar.zst.sig2024-02-12 01:14 119
[PGP]bsd-games-3.3-1-x86_64.pkg.tar.zst.sig2023-05-24 02:21 119
[PGP]bsequencer-1.8.10-2-x86_64.pkg.tar.zst.sig2023-05-24 02:21 119
[PGP]bshapr-0.13-2-x86_64.pkg.tar.zst.sig2023-05-24 02:21 119
[PGP]bslizr-1.2.16-2-x86_64.pkg.tar.zst.sig2023-05-24 02:21 119
[PGP]btrbk-0.32.6-1-any.pkg.tar.zst.sig2023-05-24 02:22 119
[PGP]budgie-backgrounds-3.0-1-any.pkg.tar.zst.sig2024-02-12 01:14 119
[PGP]budgie-control-center-1.4.0-1-x86_64.pkg.tar.zst.sig2024-02-20 01:13 119
[PGP]budgie-desktop-10.8.1-1-x86_64.pkg.tar.zst.sig2023-10-02 02:14 119
[PGP]budgie-desktop-view-1.3-2-x86_64.pkg.tar.zst.sig2024-01-21 01:14 119
[PGP]budgie-extras-1.7.0-2-x86_64.pkg.tar.zst.sig2023-09-14 02:13 119
[PGP]budgie-screensaver-5.1.0-2-x86_64.pkg.tar.zst.sig2023-05-24 02:22 119
[PGP]budgie-session-0.9.1-1-x86_64.pkg.tar.zst.sig2024-01-29 01:17 119
[PGP]buf-1.28.1-1-x86_64.pkg.tar.zst.sig2024-01-03 01:14 119
[PGP]buildbot-3.11.0-1-any.pkg.tar.zst.sig2024-02-03 01:15 119
[PGP]buildbot-common-3.11.0-1-any.pkg.tar.zst.sig2024-02-03 01:15 119
[PGP]buildbot-docs-3.11.0-1-any.pkg.tar.zst.sig2024-02-03 01:15 119
[PGP]buildbot-worker-3.11.0-1-any.pkg.tar.zst.sig2024-02-03 01:15 119
[PGP]buildkit-0.12.2-1-x86_64.pkg.tar.zst.sig2023-09-12 02:14 119
[PGP]byacc-20230521-1-x86_64.pkg.tar.zst.sig2023-06-11 02:14 119
[PGP]c-ares-1.27.0-1-x86_64.pkg.tar.zst.sig2024-02-24 01:14 119
[PGP]ca-certificates-mozilla-3.98-1-x86_64.pkg.tar.zst.sig2024-02-18 01:13 119
[PGP]cacti-1.2.26-1-any.pkg.tar.zst.sig2023-12-25 01:26 119
[PGP]cadence-0.9.2-3-x86_64.pkg.tar.zst.sig2023-10-06 02:14 119
[PGP]cairo-1.18.0-1-x86_64.pkg.tar.zst.sig2023-09-27 02:13 119
[PGP]cairo-docs-1.18.0-1-x86_64.pkg.tar.zst.sig2023-09-27 02:13 119
[PGP]calf-0.90.3-6-x86_64.pkg.tar.zst.sig2023-05-24 02:22 119
[PGP]camlp-streams-5.0.1-4-x86_64.pkg.tar.zst.sig2023-12-09 19:26 119
[PGP]camlp5-8.02.01-2-x86_64.pkg.tar.zst.sig2023-12-09 19:26 119
[PGP]capitaine-cursors-4-2-any.pkg.tar.zst.sig2023-05-24 02:22 119
[PGP]capnproto-1.0.2-1-x86_64.pkg.tar.zst.sig2024-02-21 01:15 119
[PGP]cardinal-23.10-1-x86_64.pkg.tar.zst.sig2023-10-26 02:13 119
[PGP]cardinal-clap-23.10-1-x86_64.pkg.tar.zst.sig2023-10-26 02:13 119
[PGP]cardinal-data-23.10-1-x86_64.pkg.tar.zst.sig2023-10-26 02:13 119
[PGP]cardinal-lv2-23.10-1-x86_64.pkg.tar.zst.sig2023-10-26 02:13 119
[PGP]cardinal-standalone-23.10-1-x86_64.pkg.tar.zst.sig2023-10-26 02:14 119
[PGP]cardinal-vst-23.10-1-x86_64.pkg.tar.zst.sig2023-10-26 02:14 119
[PGP]cardinal-vst3-23.10-1-x86_64.pkg.tar.zst.sig2023-10-26 02:14 119
[PGP]cargo-c-0.9.30-1-x86_64.pkg.tar.zst.sig2024-02-11 01:14 119
[PGP]cargo-cyclonedx-0.4.1-1-x86_64.pkg.tar.zst.sig2024-01-07 01:13 119
[PGP]cargo-license-0.6.1-1-x86_64.pkg.tar.zst.sig2024-01-25 01:14 119
[PGP]cargo-pgrx-0.11.2-1-x86_64.pkg.tar.zst.sig2024-01-10 01:13 119
[PGP]cargo-release-0.25.5-1-x86_64.pkg.tar.zst.sig2024-02-17 16:20 119
[PGP]cargo-supply-chain-0.3.2-1-x86_64.pkg.tar.zst.sig2023-05-24 02:23 119
[PGP]carla-2.5.8-1-x86_64.pkg.tar.zst.sig2024-01-19 01:14 119
[PGP]catatonit-0.2.0-3-x86_64.pkg.tar.zst.sig2023-10-09 02:14 119
[PGP]catdoc-0.95-5-x86_64.pkg.tar.zst.sig2023-05-24 02:23 119
[PGP]ccfits-2.6-2-x86_64.pkg.tar.zst.sig2023-05-24 02:23 119
[PGP]ccid-1.5.5-1-x86_64.pkg.tar.zst.sig2024-01-15 01:20 119
[PGP]cern-vdt-0.4.4-1-x86_64.pkg.tar.zst.sig2023-05-24 02:23 119
[PGP]certbot-2.8.0-1-any.pkg.tar.zst.sig2024-01-10 01:13 119
[PGP]certbot-apache-2.8.0-1-any.pkg.tar.zst.sig2024-01-10 01:13 119
[PGP]certbot-dns-cloudflare-2.8.0-1-any.pkg.tar.zst.sig2024-01-10 01:13 119
[PGP]certbot-dns-digitalocean-2.8.0-1-any.pkg.tar.zst.sig2024-01-10 01:13 119
[PGP]certbot-dns-dnsimple-2.8.0-1-any.pkg.tar.zst.sig2024-01-10 01:13 119
[PGP]certbot-dns-dnsmadeeasy-2.8.0-1-any.pkg.tar.zst.sig2024-01-10 01:13 119
[PGP]certbot-dns-gehirn-2.8.0-1-any.pkg.tar.zst.sig2024-01-10 01:13 119
[PGP]certbot-dns-google-2.8.0-1-any.pkg.tar.zst.sig2024-01-10 01:13 119
[PGP]certbot-dns-linode-2.8.0-1-any.pkg.tar.zst.sig2024-01-10 01:13 119
[PGP]certbot-dns-luadns-2.8.0-1-any.pkg.tar.zst.sig2024-01-10 01:13 119
[PGP]certbot-dns-nsone-2.8.0-1-any.pkg.tar.zst.sig2024-01-10 01:13 119
[PGP]certbot-dns-ovh-2.8.0-1-any.pkg.tar.zst.sig2024-01-10 01:13 119
[PGP]certbot-dns-rfc2136-2.8.0-1-any.pkg.tar.zst.sig2024-01-10 01:13 119
[PGP]certbot-dns-route53-2.8.0-1-any.pkg.tar.zst.sig2024-01-10 01:13 119
[PGP]certbot-dns-sakuracloud-2.8.0-1-any.pkg.tar.zst.sig2024-01-10 01:13 119
[PGP]certbot-nginx-2.8.0-1-any.pkg.tar.zst.sig2024-01-10 01:13 119
[PGP]cfr-0.152-2-any.pkg.tar.zst.sig2023-05-24 02:23 119
[PGP]cgit-1.2.3-3-x86_64.pkg.tar.zst.sig2023-05-24 02:23 119
[PGP]cgit-aurweb-1.2.3-3-x86_64.pkg.tar.zst.sig2023-05-24 02:23 119
[PGP]charm-0.12.6-1-x86_64.pkg.tar.zst.sig2023-08-11 02:13 119
[PGP]check-jsonschema-0.28.0-1-any.pkg.tar.zst.sig2024-02-07 01:14 119
[PGP]check-sieve-0.9-1-x86_64.pkg.tar.zst.sig2023-09-10 02:14 119
[PGP]checkbashisms-2.23.6-1-any.pkg.tar.zst.sig2023-10-01 02:13 119
[PGP]chewing-editor-0.1.1-10-x86_64.pkg.tar.zst.sig2023-05-24 02:23 119
[PGP]choose-1.3.4-1-x86_64.pkg.tar.zst.sig2023-05-24 02:23 119
[PGP]chrono-date-3.0.1-3-x86_64.pkg.tar.zst.sig2023-05-24 02:23 119
[PGP]cinnamon-settings-daemon-6.0.0-2-x86_64.pkg.tar.zst.sig2023-12-05 01:14 119
[PGP]ckermit-9.0.302-11-x86_64.pkg.tar.zst.sig2023-05-24 02:23 119
[PGP]cl-alexandria-1.4.r17.g2f39fbf-2-any.pkg.tar.zst.sig2023-06-21 02:17 119
[PGP]cl-asdf-flv-2.1-2-any.pkg.tar.zst.sig2023-05-24 02:23 119
[PGP]cl-babel-0.5.0.r20.gf892d05-2-any.pkg.tar.zst.sig2023-05-24 02:23 119
[PGP]cl-bordeaux-threads-0.9.3-1-any.pkg.tar.zst.sig2024-02-01 01:15 119
[PGP]cl-cffi-0.24.1.r23.gac07d76-1-any.pkg.tar.zst.sig2023-05-24 02:23 119
[PGP]cl-clx-0.7.5.r71.gf5bc0ab-1-any.pkg.tar.zst.sig2023-05-24 02:23 119
[PGP]cl-fiveam-1.4.2.r12.ge11dee7-2-any.pkg.tar.zst.sig2023-05-24 02:23 119
[PGP]cl-flexi-streams-1.0.19.r4.g74a1027-1-any.pkg.tar.zst.sig2023-05-24 02:23 119
[PGP]cl-global-vars-1.0.0.r2.gc749f32-2-any.pkg.tar.zst.sig2023-05-24 02:23 119
[PGP]cl-hu-dwim-stefil-r257.g7a17248-2-any.pkg.tar.zst.sig2023-05-24 02:23 119
[PGP]cl-json-0.6.0-2-any.pkg.tar.zst.sig2023-05-24 02:23 119
[PGP]cl-lift-1.7.1.r47.ge08e84e-3-any.pkg.tar.zst.sig2023-05-24 02:23 119
[PGP]cl-ppcre-2.1.1.r3.gb4056c5-1-any.pkg.tar.zst.sig2023-05-24 02:23 119
[PGP]cl-rt-1990.12.19.r19.ga6a7503-2-any.pkg.tar.zst.sig2023-05-24 02:23 119
[PGP]cl-swank-2.28-2-any.pkg.tar.zst.sig2023-06-21 02:17 119
[PGP]cl-trivial-backtrace-1.1.0.r20.g6eb65bd-1-any.pkg.tar.zst.sig2023-05-24 02:23 119
[PGP]cl-trivial-features-1.0.r3.g35c5eeb-2-any.pkg.tar.zst.sig2023-05-24 02:23 119
[PGP]cl-trivial-garbage-0.21.r8.gb3af9c0-2-any.pkg.tar.zst.sig2023-05-24 02:23 119
[PGP]cl-trivial-gray-streams-2.0.0.r47.g2b3823e-1-any.pkg.tar.zst.sig2023-05-24 02:23 119
[PGP]cl-unicode-0.1.6.r11.g2790a6b-1-any.pkg.tar.zst.sig2023-05-24 02:23 119
[PGP]clap-1.2.0-1-any.pkg.tar.zst.sig2024-01-22 22:53 119
[PGP]cloud-init-23.4.2-1-any.pkg.tar.zst.sig2024-01-25 01:14 119
[PGP]cloudflared-2024.1.5-1-x86_64.pkg.tar.zst.sig2024-02-01 01:15 119
[PGP]cm256cc-1.1.0-3-x86_64.pkg.tar.zst.sig2023-05-24 02:23 119
[PGP]cmt-1.18-3-x86_64.pkg.tar.zst.sig2023-05-24 02:23 119
[PGP]cni-plugins-1.4.0-1-x86_64.pkg.tar.zst.sig2023-12-07 16:42 119
[PGP]cockpit-311.1-1-x86_64.pkg.tar.zst.sig2024-02-22 01:14 119
[PGP]cockpit-machines-308.1-1-x86_64.pkg.tar.zst.sig2024-02-22 01:14 119
[PGP]cockpit-packagekit-311.1-1-x86_64.pkg.tar.zst.sig2024-02-22 01:14 119
[PGP]cockpit-pcp-311.1-1-x86_64.pkg.tar.zst.sig2024-02-22 01:14 119
[PGP]cockpit-podman-84.1-1-any.pkg.tar.zst.sig2024-02-22 01:14 119
[PGP]cockpit-storaged-311.1-1-x86_64.pkg.tar.zst.sig2024-02-22 01:14 119
[PGP]codec2-1:1.2.0-1-x86_64.pkg.tar.zst.sig2023-11-15 01:14 119
[PGP]coeurl-0.3.0-6-x86_64.pkg.tar.zst.sig2024-01-28 01:14 119
[PGP]colord-1.4.7-2-x86_64.pkg.tar.zst.sig2024-02-08 01:14 119
[PGP]colord-sane-1.4.7-2-x86_64.pkg.tar.zst.sig2024-02-08 01:14 119
[PGP]colordiff-1.0.21-1-any.pkg.tar.zst.sig2023-05-24 02:23 119
[PGP]comgr-6.0.0-1-x86_64.pkg.tar.zst.sig2023-12-21 01:15 119
[PGP]comgr-6.0.2-1-x86_64.pkg.tar.zst.sig2024-02-24 01:16 119
[PGP]composable-kernel-6.0.0-1-x86_64.pkg.tar.zst.sig2023-12-29 01:14 119
[PGP]composer-2.7.1-1-any.pkg.tar.zst.sig2024-02-11 01:14 119
[PGP]confuse-3.3-3-x86_64.pkg.tar.zst.sig2023-05-24 02:24 119
[PGP]conntrack-tools-1.4.8-1-x86_64.pkg.tar.zst.sig2023-10-01 02:13 119
[PGP]container-diff-0.17.0-3-x86_64.pkg.tar.zst.sig2023-10-11 02:13 119
[PGP]containers-common-1:0.57.4-1-any.pkg.tar.zst.sig2024-02-08 01:14 119
[PGP]corectrl-1.3.10-1-x86_64.pkg.tar.zst.sig2024-02-05 01:14 119
[PGP]cowsql-1.15.3-1-x86_64.pkg.tar.zst.sig2023-10-23 02:14 119
[PGP]cppcheck-2.12.0-2-x86_64.pkg.tar.zst.sig2024-01-23 01:13 119
[PGP]cpputest-4.0-4-x86_64.pkg.tar.zst.sig2023-05-24 02:25 119
[PGP]cppzmq-4.9.0-1-any.pkg.tar.zst.sig2023-06-03 02:13 119
[PGP]cri-o-1.29.2-1-x86_64.pkg.tar.zst.sig2024-02-23 01:13 119
[PGP]criu-3.18-2-x86_64.pkg.tar.zst.sig2023-11-05 01:13 119
[PGP]cronie-1.7.1-1-x86_64.pkg.tar.zst.sig2024-01-15 01:15 119
[PGP]cryptsetup-2.7.0-1-x86_64.pkg.tar.zst.sig2024-01-25 01:13 119
[PGP]csound-plugins-1.0.2-8-x86_64.pkg.tar.zst.sig2024-02-25 01:14 119
[PGP]csoundqt-1:1.1.1-1-x86_64.pkg.tar.zst.sig2023-05-24 02:25 119
[PGP]csoundqt-1:1.1.1-2-x86_64.pkg.tar.zst.sig2024-02-21 01:16 119
[PGP]curl-8.6.0-3-x86_64.pkg.tar.zst.sig2024-02-07 01:13 119
[PGP]curlie-1.7.2-1-x86_64.pkg.tar.zst.sig2023-10-24 02:28 119
[PGP]cxxopts-3.2.1-1-any.pkg.tar.zst.sig2024-02-21 01:15 119
[PGP]cycfx2prog-0.47-4-x86_64.pkg.tar.zst.sig2023-05-24 02:25 119
[PGP]cyrus-sasl-2.1.28-3-x86_64.pkg.tar.zst.sig2023-07-26 02:13 119
[PGP]cyrus-sasl-gssapi-2.1.28-3-x86_64.pkg.tar.zst.sig2023-07-26 02:13 119
[PGP]cyrus-sasl-ldap-2.1.28-3-x86_64.pkg.tar.zst.sig2023-07-26 02:13 119
[PGP]cyrus-sasl-sql-2.1.28-3-x86_64.pkg.tar.zst.sig2023-07-26 02:13 119
[PGP]d-containers-0.8.0-9-x86_64.pkg.tar.zst.sig2023-05-24 02:25 119
[PGP]d-mir-core-1.1.14-11-x86_64.pkg.tar.zst.sig2023-05-24 02:25 119
[PGP]d-spy-1.9.0-1-x86_64.pkg.tar.zst.sig2024-02-17 16:20 119
[PGP]d-stdx-allocator-3.0.2-21-x86_64.pkg.tar.zst.sig2023-05-24 02:25 119
[PGP]d2-0.6.3-1-x86_64.pkg.tar.zst.sig2023-12-29 01:13 119
[PGP]dagger-0.9.7-1-x86_64.pkg.tar.zst.sig2024-02-01 01:15 119
[PGP]darkhttpd-1.15-1-x86_64.pkg.tar.zst.sig2024-01-19 01:14 119
[PGP]darkstat-3.0.721-2-x86_64.pkg.tar.zst.sig2023-05-24 02:25 119
[PGP]dart-sass-1.70.0-1-x86_64.pkg.tar.zst.sig2024-02-01 01:15 119
[PGP]datamash-1.8-1-x86_64.pkg.tar.zst.sig2023-05-24 02:26 119
[PGP]dateutils-0.4.11-1-x86_64.pkg.tar.zst.sig2024-01-26 01:13 119
[PGP]davix-0.8.4-2-x86_64.pkg.tar.zst.sig2023-05-24 02:26 119
[PGP]dblatex-0.3.12-8-any.pkg.tar.zst.sig2024-02-27 01:14 119
[PGP]dbmate-2.11.0-1-x86_64.pkg.tar.zst.sig2024-02-01 01:15 119
[PGP]dbus-1.14.10-2-x86_64.pkg.tar.zst.sig2024-01-06 01:13 119
[PGP]dbus-broker-35-2-x86_64.pkg.tar.zst.sig2024-01-06 01:13 119
[PGP]dbus-broker-units-35-2-x86_64.pkg.tar.zst.sig2024-01-06 01:13 119
[PGP]dbus-c++-0.9.0-11-x86_64.pkg.tar.zst.sig2023-09-03 02:13 119
[PGP]dbus-daemon-units-1.14.10-2-x86_64.pkg.tar.zst.sig2024-01-06 01:13 119
[PGP]dbus-docs-1.14.10-2-x86_64.pkg.tar.zst.sig2024-01-06 01:13 119
[PGP]dcd-1:0.15.2-1-x86_64.pkg.tar.zst.sig2023-05-24 02:26 119
[PGP]dd_rescue-1.99.13-2-x86_64.pkg.tar.zst.sig2023-05-24 02:26 119
[PGP]ddclient-3.11.2-4-any.pkg.tar.zst.sig2024-02-21 01:13 119
[PGP]ddrescue-1.28-1-x86_64.pkg.tar.zst.sig2024-01-24 01:14 119
[PGP]debugedit-5.0-5-x86_64.pkg.tar.zst.sig2023-03-19 01:13 119
[PGP]deepin-camera-1.4.16.20230919-2-x86_64.pkg.tar.zst.sig2023-12-05 01:14 119
[PGP]desync-0.9.5-1-x86_64.pkg.tar.zst.sig2023-07-05 02:13 119
[PGP]deteriorate-lv2-1.0.7-4-x86_64.pkg.tar.zst.sig2023-05-24 02:27 119
[PGP]dev86-0.16.21-7-x86_64.pkg.tar.zst.sig2023-05-24 02:27 119
[PGP]device-mapper-2.03.23-1-x86_64.pkg.tar.zst.sig2024-01-11 01:13 119
[PGP]devilspie-0.23-4-x86_64.pkg.tar.zst.sig2023-05-24 02:27 119
[PGP]dexed-0.9.6.r90.g9e01c0c-1-x86_64.pkg.tar.zst.sig2023-05-24 02:27 119
[PGP]dexed-clap-0.9.6.r90.g9e01c0c-1-x86_64.pkg.tar.zst.sig2023-05-24 02:27 119
[PGP]dexed-docs-0.9.6.r90.g9e01c0c-1-x86_64.pkg.tar.zst.sig2023-05-24 02:27 119
[PGP]dexed-standalone-0.9.6.r90.g9e01c0c-1-x86_64.pkg.tar.zst.sig2023-05-24 02:27 119
[PGP]dexed-vst3-0.9.6.r90.g9e01c0c-1-x86_64.pkg.tar.zst.sig2023-05-24 02:27 119
[PGP]dfmt-0.15.1-1-x86_64.pkg.tar.zst.sig2023-07-20 02:13 119
[PGP]dhclient-4.4.3.P1-2-x86_64.pkg.tar.zst.sig2023-05-16 02:13 119
[PGP]dhcp-4.4.3.P1-2-x86_64.pkg.tar.zst.sig2023-05-16 02:13 119
[PGP]dhcpcd-10.0.6-1-x86_64.pkg.tar.zst.sig2023-12-23 01:14 119
[PGP]dhex-0.69-3-x86_64.pkg.tar.zst.sig2023-05-24 02:27 119
[PGP]dht-0.27-4-x86_64.pkg.tar.zst.sig2023-05-24 02:27 119
[PGP]dictd-1.13.1-5-x86_64.pkg.tar.zst.sig2023-09-23 18:24 119
[PGP]diffstat-1.65-1-x86_64.pkg.tar.zst.sig2023-05-24 02:27 119
[PGP]diffutils-3.10-1-x86_64.pkg.tar.zst.sig2023-05-26 02:14 119
[PGP]din-58.1-1-x86_64.pkg.tar.zst.sig2024-02-19 01:15 119
[PGP]din-58.1-2-x86_64.pkg.tar.zst.sig2024-02-21 01:16 119
[PGP]direnv-2.33.0-1-x86_64.pkg.tar.zst.sig2023-12-29 01:13 119
[PGP]distrho-ports-2021.03.15-3-x86_64.pkg.tar.zst.sig2023-05-24 02:27 119
[PGP]distrho-ports-lv2-2021.03.15-3-x86_64.pkg.tar.zst.sig2023-05-24 02:27 119
[PGP]distrho-ports-vst-2021.03.15-3-x86_64.pkg.tar.zst.sig2023-05-24 02:27 119
[PGP]distrho-ports-vst3-2021.03.15-3-x86_64.pkg.tar.zst.sig2023-05-24 02:27 119
[PGP]distrobuilder-2.1-2-x86_64.pkg.tar.zst.sig2023-05-24 02:27 119
[PGP]distrobuilder-3.0-1-x86_64.pkg.tar.zst.sig2023-11-13 01:15 119
[PGP]dkms-3.0.12-1-any.pkg.tar.zst.sig2024-01-02 01:14 119
[PGP]dma-0.13-2-x86_64.pkg.tar.zst.sig2023-07-18 02:13 119
[PGP]dmd-1:2.107.0-1-x86_64.pkg.tar.zst.sig2024-02-07 01:14 119
[PGP]dmd-docs-1:2.107.0-1-x86_64.pkg.tar.zst.sig2024-02-07 01:14 119
[PGP]dmenu-5.2-1-x86_64.pkg.tar.zst.sig2023-05-24 02:27 119
[PGP]dmtcp-2.6.1rc1-3-x86_64.pkg.tar.zst.sig2024-01-26 01:16 119
[PGP]dnscrypt-proxy-2.1.5-4-x86_64.pkg.tar.zst.sig2023-11-03 01:14 119
[PGP]dnsmasq-2.90-1-x86_64.pkg.tar.zst.sig2024-02-14 01:16 119
[PGP]dnsperf-2.11.2-1-x86_64.pkg.tar.zst.sig2023-05-24 02:27 119
[PGP]docbook-utils-0.6.14-13-any.pkg.tar.zst.sig2024-01-02 01:14 119
[PGP]doctest-2.4.9-2-any.pkg.tar.zst.sig2023-10-11 02:13 119
[PGP]doomretro-5.2.1-1-x86_64.pkg.tar.zst.sig2024-02-01 01:15 119
[PGP]dopewars-1.6.2-2-x86_64.pkg.tar.zst.sig2023-05-24 02:27 119
[PGP]dos2unix-7.5.2-1-x86_64.pkg.tar.zst.sig2024-01-26 01:13 119
[PGP]dot-language-server-1.2.1-1-any.pkg.tar.zst.sig2023-06-02 02:13 119
[PGP]doublecmd-qt6-1.1.10-1-x86_64.pkg.tar.zst.sig2024-02-22 01:14 119
[PGP]dovecot-fts-xapian-1.5.8-1-x86_64.pkg.tar.zst.sig2024-02-01 01:15 119
[PGP]doxygen-1.10.0-2-x86_64.pkg.tar.zst.sig2024-02-19 01:17 119
[PGP]doxygen-docs-1.10.0-2-x86_64.pkg.tar.zst.sig2024-02-19 01:17 119
[PGP]dpf-plugins-1.7-1-x86_64.pkg.tar.zst.sig2023-05-24 02:28 119
[PGP]dpf-plugins-clap-1.7-1-x86_64.pkg.tar.zst.sig2023-05-24 02:28 119
[PGP]dpf-plugins-dssi-1.7-1-x86_64.pkg.tar.zst.sig2023-05-24 02:28 119
[PGP]dpf-plugins-ladspa-1.7-1-x86_64.pkg.tar.zst.sig2023-05-24 02:28 119
[PGP]dpf-plugins-lv2-1.7-1-x86_64.pkg.tar.zst.sig2023-05-24 02:28 119
[PGP]dpf-plugins-standalone-1.7-1-x86_64.pkg.tar.zst.sig2023-05-24 02:28 119
[PGP]dpf-plugins-vst-1.7-1-x86_64.pkg.tar.zst.sig2023-05-24 02:28 119
[PGP]dpf-plugins-vst3-1.7-1-x86_64.pkg.tar.zst.sig2023-05-24 02:28 119
[PGP]dragonfly-reverb-3.2.10-2-x86_64.pkg.tar.zst.sig2023-05-24 02:28 119
[PGP]dragonfly-reverb-clap-3.2.10-2-x86_64.pkg.tar.zst.sig2023-05-24 02:28 119
[PGP]dragonfly-reverb-lv2-3.2.10-2-x86_64.pkg.tar.zst.sig2023-05-24 02:28 119
[PGP]dragonfly-reverb-standalone-3.2.10-2-x86_64.pkg.tar.zst.sig2023-05-24 02:28 119
[PGP]dragonfly-reverb-vst-3.2.10-2-x86_64.pkg.tar.zst.sig2023-05-24 02:28 119
[PGP]dragonfly-reverb-vst3-3.2.10-2-x86_64.pkg.tar.zst.sig2023-05-24 02:28 119
[PGP]drone-cli-1.7.0-1-x86_64.pkg.tar.zst.sig2023-05-24 02:28 119
[PGP]drone-oss-2.18.0-1-x86_64.pkg.tar.zst.sig2023-07-08 02:13 119
[PGP]drumgizmo-0.9.20-2-x86_64.pkg.tar.zst.sig2023-05-24 02:28 119
[PGP]drumgizmo-lv2-0.9.20-2-x86_64.pkg.tar.zst.sig2023-05-24 02:28 119
[PGP]drumgizmo-standalone-0.9.20-2-x86_64.pkg.tar.zst.sig2023-05-24 02:28 119
[PGP]drumkv1-0.9.34-1-x86_64.pkg.tar.zst.sig2024-02-02 01:14 119
[PGP]drumkv1-lv2-0.9.34-1-x86_64.pkg.tar.zst.sig2024-02-02 01:14 119
[PGP]drumkv1-standalone-0.9.34-1-x86_64.pkg.tar.zst.sig2024-02-02 01:14 119
[PGP]drumstick-2.9.0-1-x86_64.pkg.tar.zst.sig2023-12-26 01:14 119
[PGP]dscanner-0.15.2-1-x86_64.pkg.tar.zst.sig2023-07-14 02:13 119
[PGP]dsq-0.23.0-2-x86_64.pkg.tar.zst.sig2023-05-24 02:28 119
[PGP]dssi-1.1.1-12-x86_64.pkg.tar.zst.sig2023-09-25 02:15 119
[PGP]dtc-1.7.0-4-x86_64.pkg.tar.zst.sig2023-05-24 02:28 119
[PGP]dtk6core-6.0.4-3-x86_64.pkg.tar.zst.sig2024-01-28 01:14 119
[PGP]dtkcore-1:5.6.22-2-x86_64.pkg.tar.zst.sig2024-01-28 01:14 119
[PGP]dtools-2.107.0-1-x86_64.pkg.tar.zst.sig2024-02-07 01:14 119
[PGP]dub-1.36.0-1-x86_64.pkg.tar.zst.sig2024-02-07 01:14 119
[PGP]dune-3.11.1-1-x86_64.pkg.tar.zst.sig2023-12-09 19:26 119
[PGP]duperemove-0.11.3-2-x86_64.pkg.tar.zst.sig2023-05-24 02:28 119
[PGP]duplicity-2.1.4-1-x86_64.pkg.tar.zst.sig2023-10-22 02:13 119
[PGP]dvgrab-3.5-13-x86_64.pkg.tar.zst.sig2023-05-24 02:28 119
[PGP]e2fsprogs-1.47.0-1-x86_64.pkg.tar.zst.sig2023-02-08 01:13 119
[PGP]earlyoom-1.7-1-x86_64.pkg.tar.zst.sig2023-05-24 02:28 119
[PGP]easy-pdk-1.3-3-x86_64.pkg.tar.zst.sig2023-05-24 02:28 119
[PGP]easy-rsa-3.1.7-1-any.pkg.tar.zst.sig2023-10-16 19:00 119
[PGP]easyloggingpp-9.97.1-1-any.pkg.tar.zst.sig2024-02-12 21:10 119
[PGP]ebumeter-0.5.1-1-x86_64.pkg.tar.zst.sig2023-05-24 02:28 119
[PGP]ebumeter-docs-0.5.1-1-x86_64.pkg.tar.zst.sig2023-05-24 02:28 119
[PGP]ecryptfs-utils-111-8-x86_64.pkg.tar.zst.sig2023-09-05 02:13 119
[PGP]edk2-aarch64-202311-1-any.pkg.tar.zst.sig2023-11-29 01:15 119
[PGP]edk2-arm-202311-1-any.pkg.tar.zst.sig2023-11-29 01:15 119
[PGP]edk2-ovmf-202311-1-any.pkg.tar.zst.sig2023-11-29 01:16 119
[PGP]edk2-shell-202311-1-any.pkg.tar.zst.sig2023-11-29 01:16 119
[PGP]efibootmgr-18-2-x86_64.pkg.tar.zst.sig2023-03-19 01:13 119
[PGP]efifs-1.9-1-any.pkg.tar.zst.sig2023-05-24 02:28 119
[PGP]efivar-39-1-x86_64.pkg.tar.zst.sig2024-02-02 01:13 119
[PGP]eigen-3.4.0-2-any.pkg.tar.zst.sig2024-01-19 01:14 119
[PGP]element-0.46.6-1-x86_64.pkg.tar.zst.sig2023-05-24 02:28 119
[PGP]elephantdsp-roomreverb-clap-1.1.0-1-x86_64.pkg.tar.zst.sig2023-12-03 01:14 119
[PGP]elephantdsp-roomreverb-lv2-1.1.0-1-x86_64.pkg.tar.zst.sig2023-12-03 01:14 119
[PGP]elephantdsp-roomreverb-vst3-1.1.0-1-x86_64.pkg.tar.zst.sig2023-12-03 01:14 119
[PGP]elinks-0.17.0-1-x86_64.pkg.tar.zst.sig2023-12-31 01:13 119
[PGP]emacs-slime-2.28-2-any.pkg.tar.zst.sig2023-06-21 02:23 119
[PGP]encfs-1.9.5-7-x86_64.pkg.tar.zst.sig2024-01-03 01:14 119
[PGP]eog-45.2-1-x86_64.pkg.tar.zst.sig2024-01-07 01:13 119
[PGP]eog-docs-45.2-1-x86_64.pkg.tar.zst.sig2024-01-07 01:13 119
[PGP]epubcheck-5.1.0-3-any.pkg.tar.zst.sig2023-11-25 01:14 119
[PGP]erdtree-3.1.2-1-x86_64.pkg.tar.zst.sig2023-07-04 02:13 119
[PGP]erofs-utils-1.7.1-1-x86_64.pkg.tar.zst.sig2023-10-23 02:14 119
[PGP]espeakup-0.90-2-x86_64.pkg.tar.zst.sig2023-05-24 02:31 119
[PGP]esptool-4.7.0-2-any.pkg.tar.zst.sig2024-02-14 01:16 119
[PGP]etckeeper-1.18.21-1-any.pkg.tar.zst.sig2023-12-02 01:15 119
[PGP]eteroj.lv2-0.10.0-2-x86_64.pkg.tar.zst.sig2023-05-24 02:31 119
[PGP]evolution-3.50.4-1-x86_64.pkg.tar.zst.sig2024-02-10 01:14 119
[PGP]evolution-3.51.2-1-x86_64.pkg.tar.zst.sig2024-02-15 01:15 119
[PGP]evolution-bogofilter-3.50.4-1-x86_64.pkg.tar.zst.sig2024-02-10 01:14 119
[PGP]evolution-bogofilter-3.51.2-1-x86_64.pkg.tar.zst.sig2024-02-15 01:15 119
[PGP]evolution-data-server-3.50.4-1-x86_64.pkg.tar.zst.sig2024-02-10 01:14 119
[PGP]evolution-data-server-3.51.2-1-x86_64.pkg.tar.zst.sig2024-02-14 01:19 119
[PGP]evolution-data-server-docs-3.50.4-1-x86_64.pkg.tar.zst.sig2024-02-10 01:14 119
[PGP]evolution-data-server-docs-3.51.2-1-x86_64.pkg.tar.zst.sig2024-02-14 01:19 119
[PGP]evolution-ews-3.50.3-1-x86_64.pkg.tar.zst.sig2024-01-06 01:13 119
[PGP]evolution-ews-3.51.2-1-x86_64.pkg.tar.zst.sig2024-02-15 01:15 119
[PGP]evolution-spamassassin-3.50.4-1-x86_64.pkg.tar.zst.sig2024-02-10 01:14 119
[PGP]evolution-spamassassin-3.51.2-1-x86_64.pkg.tar.zst.sig2024-02-15 01:15 119
[PGP]exim-4.97.1-1-x86_64.pkg.tar.zst.sig2023-12-30 01:14 119
[PGP]expat-2.6.0-1-x86_64.pkg.tar.zst.sig2024-02-07 01:13 119
[PGP]exploitdb-20240207-1-any.pkg.tar.zst.sig2024-02-09 01:14 119
[PGP]f2fs-tools-1.16.0-2-x86_64.pkg.tar.zst.sig2023-05-26 02:14 119
[PGP]faad2-2.11.1-1-x86_64.pkg.tar.zst.sig2023-11-23 01:14 119
[PGP]fabla-1.4-1-x86_64.pkg.tar.zst.sig2023-05-24 02:31 119
[PGP]fabric-3.2.2-1-any.pkg.tar.zst.sig2023-09-08 02:13 119
[PGP]facile-1.1.4-5-x86_64.pkg.tar.zst.sig2023-11-21 01:21 119
[PGP]facile-1.1.4-6-x86_64.pkg.tar.zst.sig2023-12-09 19:26 119
[PGP]faust-2.70.3-1-x86_64.pkg.tar.zst.sig2024-01-07 01:13 119
[PGP]fcitx-chewing-0.2.3-5-x86_64.pkg.tar.zst.sig2023-05-24 02:31 119
[PGP]fdm-2.2-2-x86_64.pkg.tar.zst.sig2023-05-24 02:31 119
[PGP]fdupes-1:2.2.1-2-x86_64.pkg.tar.zst.sig2023-05-24 02:31 119
[PGP]feh-3.10.2-1-x86_64.pkg.tar.zst.sig2023-12-06 01:18 119
[PGP]fennel-1.4.0-1-any.pkg.tar.zst.sig2023-12-05 01:20 119
[PGP]ffmpeg-2:6.1.1-6-x86_64.pkg.tar.zst.sig2024-02-24 01:16 119
[PGP]fftw-3.3.10-6-x86_64.pkg.tar.zst.sig2024-02-19 01:17 119
[PGP]fftw-openmpi-3.3.10-6-x86_64.pkg.tar.zst.sig2024-02-19 01:17 119
[PGP]fig2dev-3.2.8.b-1-x86_64.pkg.tar.zst.sig2023-05-24 02:31 119
[PGP]file-5.45-1-x86_64.pkg.tar.zst.sig2023-08-14 02:13 119
[PGP]fillets-ng-1.0.1-11-x86_64.pkg.tar.zst.sig2023-05-24 02:31 119
[PGP]firecracker-1.5.0-1-x86_64.pkg.tar.zst.sig2023-10-29 02:13 119
[PGP]firecracker-docs-1.5.0-1-x86_64.pkg.tar.zst.sig2023-10-29 02:13 119
[PGP]firefox-i18n-fur-123.0-1-any.pkg.tar.zst.sig2024-02-20 01:14 119
[PGP]firefox-i18n-sat-123.0-1-any.pkg.tar.zst.sig2024-02-20 01:14 119
[PGP]firefox-i18n-sc-123.0-1-any.pkg.tar.zst.sig2024-02-20 01:14 119
[PGP]firefox-i18n-sco-123.0-1-any.pkg.tar.zst.sig2024-02-20 01:14 119
[PGP]firefox-i18n-szl-123.0-1-any.pkg.tar.zst.sig2024-02-20 01:14 119
[PGP]firefox-i18n-tg-123.0-1-any.pkg.tar.zst.sig2024-02-20 01:14 119
[PGP]firejail-0.9.72-1-x86_64.pkg.tar.zst.sig2023-05-24 02:32 119
[PGP]firetools-0.9.72-1-x86_64.pkg.tar.zst.sig2023-05-24 02:32 119
[PGP]fish-3.7.0-1-x86_64.pkg.tar.zst.sig2024-01-03 01:14 119
[PGP]fisher-4.4.4-1-any.pkg.tar.zst.sig2023-08-23 02:13 119
[PGP]flatpak-1:1.15.6-2-x86_64.pkg.tar.zst.sig2024-01-18 01:16 119
[PGP]flatpak-builder-1.4.0-1-x86_64.pkg.tar.zst.sig2023-12-17 01:14 119
[PGP]flatpak-docs-1:1.15.6-2-x86_64.pkg.tar.zst.sig2024-01-18 01:16 119
[PGP]flex-2.6.4-5-x86_64.pkg.tar.zst.sig2023-03-18 01:14 119
[PGP]flterm-2.4-4-x86_64.pkg.tar.zst.sig2023-05-24 02:32 119
[PGP]fltk-1.3.9-1-x86_64.pkg.tar.zst.sig2023-12-12 01:14 119
[PGP]fltk-docs-1.3.9-1-x86_64.pkg.tar.zst.sig2023-12-12 01:14 119
[PGP]fluidsynth-2.3.4-1-x86_64.pkg.tar.zst.sig2023-10-07 02:13 119
[PGP]fluxbox-1.3.7+211+g9d8202f3-1-x86_64.pkg.tar.zst.sig2022-10-26 02:13 119
[PGP]fluxcd-2.2.2-1-x86_64.pkg.tar.zst.sig2023-12-29 01:13 119
[PGP]fnlfmt-0.3.1-1-any.pkg.tar.zst.sig2023-08-11 02:13 119
[PGP]folks-0.15.7-1-x86_64.pkg.tar.zst.sig2024-01-09 22:51 119
[PGP]fomp.lv2-1.2.4-2-x86_64.pkg.tar.zst.sig2023-05-24 02:32 119
[PGP]fontconfig-2:2.15.0-2-x86_64.pkg.tar.zst.sig2024-01-02 01:14 119
[PGP]fontobene-qt5-0.2.0-3-any.pkg.tar.zst.sig2023-05-24 02:32 119
[PGP]foot-1.16.2-2-x86_64.pkg.tar.zst.sig2023-10-26 02:24 119
[PGP]foot-terminfo-1.16.2-2-x86_64.pkg.tar.zst.sig2023-10-26 02:24 119
[PGP]forgejo-1.20.5.0-1-x86_64.pkg.tar.zst.sig2023-10-10 02:13 119
[PGP]forgejo-1.21.4.0-1-x86_64.pkg.tar.zst.sig2024-02-01 01:15 119
[PGP]fortune-mod-3.20.0-1-x86_64.pkg.tar.zst.sig2023-06-21 02:23 119
[PGP]foxdot-0.8.12-3-any.pkg.tar.zst.sig2023-05-24 02:32 119
[PGP]fpc-3.2.2-9-x86_64.pkg.tar.zst.sig2023-10-18 02:15 119
[PGP]fping-5.1-2-x86_64.pkg.tar.zst.sig2022-03-23 01:13 119
[PGP]fractal-6-2-x86_64.pkg.tar.zst.sig2024-01-25 01:14 119
[PGP]freeimage-3.18.0-21-x86_64.pkg.tar.zst.sig2023-09-02 02:14 119
[PGP]freeipmi-1.6.14-1-x86_64.pkg.tar.zst.sig2024-02-01 01:15 119
[PGP]freepats-general-midi-20221026-1-any.pkg.tar.zst.sig2023-05-24 02:34 119
[PGP]freeplane-1.11.10-1-any.pkg.tar.zst.sig2024-01-24 01:14 119
[PGP]freeradius-3.2.3-5-x86_64.pkg.tar.zst.sig2023-12-18 01:17 119
[PGP]freewheeling-0.6.6-4-x86_64.pkg.tar.zst.sig2023-05-24 02:34 119
[PGP]frugally-deep-0.15.20-1-x86_64.pkg.tar.zst.sig2023-07-18 02:13 119
[PGP]fs-uae-3.1.66-2-x86_64.pkg.tar.zst.sig2023-05-24 02:34 119
[PGP]fst-0.123.0-1-any.pkg.tar.zst.sig2023-07-28 02:13 119
[PGP]ft2-clone-1.75-1-x86_64.pkg.tar.zst.sig2024-01-10 01:13 119
[PGP]function2-4.2.4-1-any.pkg.tar.zst.sig2023-11-08 01:13 119
[PGP]functional-plus-0.2.18-1-any.pkg.tar.zst.sig2023-07-18 02:13 119
[PGP]furnace-0.6-1-x86_64.pkg.tar.zst.sig2023-10-04 02:14 119
[PGP]furnace-0.6.1-2-x86_64.pkg.tar.zst.sig2024-02-22 01:15 119
[PGP]fuse2fs-1.47.0-1-x86_64.pkg.tar.zst.sig2023-02-08 01:13 119
[PGP]galculator-2.1.4-8-x86_64.pkg.tar.zst.sig2023-05-24 02:34 119
[PGP]galera-26.4.16-1-x86_64.pkg.tar.zst.sig2023-11-17 01:15 119
[PGP]gamemode-1.8.1-2-x86_64.pkg.tar.zst.sig2024-01-18 01:16 119
[PGP]ganv-1.8.2-1-x86_64.pkg.tar.zst.sig2023-05-24 02:34 119
[PGP]gcin-2.9.0-5-x86_64.pkg.tar.zst.sig2023-05-24 02:35 119
[PGP]gcr-3.41.2-1-x86_64.pkg.tar.zst.sig2024-01-15 01:18 119
[PGP]gcr-4-4.2.0-1-x86_64.pkg.tar.zst.sig2024-02-12 21:10 119
[PGP]gcr-4-docs-4.2.0-1-x86_64.pkg.tar.zst.sig2024-02-12 21:10 119
[PGP]gcr-docs-3.41.2-1-x86_64.pkg.tar.zst.sig2024-01-15 01:18 119
[PGP]gdal-3.8.4-1-x86_64.pkg.tar.zst.sig2024-02-25 01:14 119
[PGP]gdbm-1.23-2-x86_64.pkg.tar.zst.sig2023-03-19 01:13 119
[PGP]gdu-5.27.0-1-x86_64.pkg.tar.zst.sig2024-02-19 01:15 119
[PGP]gearmand-1.1.21-1-x86_64.pkg.tar.zst.sig2023-11-13 01:15 119
[PGP]gedit-46.1-1-x86_64.pkg.tar.zst.sig2023-10-04 02:14 119
[PGP]gedit-46.2-1-x86_64.pkg.tar.zst.sig2024-02-20 01:13 119
[PGP]gedit-plugins-46.0-1-x86_64.pkg.tar.zst.sig2023-10-04 02:14 119
[PGP]geoclue-2.7.1-2-x86_64.pkg.tar.zst.sig2024-01-18 01:16 119
[PGP]geoipupdate-6.1.0-1-x86_64.pkg.tar.zst.sig2024-01-14 01:14 119
[PGP]geonkick-3.3.2-2-x86_64.pkg.tar.zst.sig2024-02-22 01:15 119
[PGP]geonkick-common-3.3.2-2-x86_64.pkg.tar.zst.sig2024-02-22 01:15 119
[PGP]geonkick-lv2-3.3.2-2-x86_64.pkg.tar.zst.sig2024-02-22 01:15 119
[PGP]geonkick-standalone-3.3.2-2-x86_64.pkg.tar.zst.sig2024-02-22 01:15 119
[PGP]geonkick-vst3-3.3.2-2-x86_64.pkg.tar.zst.sig2024-02-22 01:15 119
[PGP]gephi-0.10.1-2-x86_64.pkg.tar.zst.sig2023-11-05 01:13 119
[PGP]gerbera-2.0.0-3-x86_64.pkg.tar.zst.sig2024-01-28 01:14 119
[PGP]gflags-2.2.2-4-x86_64.pkg.tar.zst.sig2023-05-24 02:36 119
[PGP]ghc-filesystem-1.5.14-1-any.pkg.tar.zst.sig2023-05-24 02:36 119
[PGP]gi-docgen-2023.3-1-any.pkg.tar.zst.sig2023-11-29 01:16 119
[PGP]gifsicle-1.94-1-x86_64.pkg.tar.zst.sig2023-07-04 02:13 119
[PGP]gimp-nufraw-0.43.3-9-x86_64.pkg.tar.zst.sig2023-06-22 02:13 119
[PGP]gir-to-d-0.23.1-6-x86_64.pkg.tar.zst.sig2024-01-07 17:00 119
[PGP]git-2.44.0-1-x86_64.pkg.tar.zst.sig2024-02-24 01:14 119
[PGP]git-bug-0.8.0-1-x86_64.pkg.tar.zst.sig2023-05-24 02:38 119
[PGP]git-filter-repo-2.38.0-1-any.pkg.tar.zst.sig2023-05-24 02:38 119
[PGP]gitolite-3.6.13-1-any.pkg.tar.zst.sig2023-07-20 02:13 119
[PGP]gjs-2:1.78.4-1-x86_64.pkg.tar.zst.sig2024-02-12 21:10 119
[PGP]gjs-2:1.79.3-1-x86_64.pkg.tar.zst.sig2024-02-15 01:15 119
[PGP]glava-1.6.3-3-x86_64.pkg.tar.zst.sig2023-12-05 01:20 119
[PGP]glhack-1.2-10-x86_64.pkg.tar.zst.sig2023-08-10 02:13 119
[PGP]glib-networking-1:2.80alpha-1-x86_64.pkg.tar.zst.sig2024-01-16 01:14 119
[PGP]glib2-2.78.4-1-x86_64.pkg.tar.zst.sig2024-01-22 22:51 119
[PGP]glib2-2.79.2-1-x86_64.pkg.tar.zst.sig2024-02-17 01:17 119
[PGP]glib2-docs-2.78.4-1-x86_64.pkg.tar.zst.sig2024-01-22 22:51 119
[PGP]glib2-docs-2.79.2-1-x86_64.pkg.tar.zst.sig2024-02-17 01:17 119
[PGP]glibd-2.4.2-5-x86_64.pkg.tar.zst.sig2023-10-26 21:15 119
[PGP]glibd-2.4.2-6-x86_64.pkg.tar.zst.sig2024-01-07 17:00 119
[PGP]glibmm-2.68-2.78.1-1-x86_64.pkg.tar.zst.sig2024-02-03 01:15 119
[PGP]glibmm-2.68-docs-2.78.1-1-x86_64.pkg.tar.zst.sig2024-02-03 01:15 119
[PGP]glycin-0.1.2-2-x86_64.pkg.tar.zst.sig2023-12-20 01:15 119
[PGP]glycin-1.0beta1-1-x86_64.pkg.tar.zst.sig2024-02-20 01:14 119
[PGP]gmime3-3.2.14-1-x86_64.pkg.tar.zst.sig2024-02-13 01:14 119
[PGP]gmm-5.4.2-2-any.pkg.tar.zst.sig2023-05-24 02:40 119
[PGP]gmsynth.lv2-0.6.0-1-x86_64.pkg.tar.zst.sig2023-10-01 02:13 119
[PGP]gnome-backgrounds-46beta-1-any.pkg.tar.zst.sig2024-02-25 01:14 119
[PGP]gnome-bluetooth-3.0-42.8-1-x86_64.pkg.tar.zst.sig2024-02-07 01:14 119
[PGP]gnome-bluetooth-3.0-46beta-1-x86_64.pkg.tar.zst.sig2024-02-15 01:15 119
[PGP]gnome-bluetooth-3.34.5+r16+g61cfff1c-2-x86_64.pkg.tar.zst.sig2023-12-05 01:20 119
[PGP]gnome-builder-46beta-1-x86_64.pkg.tar.zst.sig2024-02-19 01:17 119
[PGP]gnome-calculator-46beta-1-x86_64.pkg.tar.zst.sig2024-02-17 01:17 119
[PGP]gnome-calendar-46beta1-1-x86_64.pkg.tar.zst.sig2024-02-25 01:14 119
[PGP]gnome-connections-46beta-1-x86_64.pkg.tar.zst.sig2024-02-16 01:16 119
[PGP]gnome-contacts-46alpha-1-x86_64.pkg.tar.zst.sig2024-02-16 01:16 119
[PGP]gnome-control-center-45.3-1-x86_64.pkg.tar.zst.sig2024-02-12 21:10 119
[PGP]gnome-control-center-46beta2-1-x86_64.pkg.tar.zst.sig2024-02-25 01:14 119
[PGP]gnome-disk-utility-45.1-1-x86_64.pkg.tar.zst.sig2023-12-02 01:15 119
[PGP]gnome-initial-setup-46beta-1-x86_64.pkg.tar.zst.sig2024-02-26 01:16 119
[PGP]gnome-keyring-1:46.1-1-x86_64.pkg.tar.zst.sig2024-02-15 01:14 119
[PGP]gnome-maps-45.4-1-x86_64.pkg.tar.zst.sig2024-02-11 01:14 119
[PGP]gnome-maps-46beta-1-x86_64.pkg.tar.zst.sig2024-02-15 01:15 119
[PGP]gnome-music-1:45.1-1-any.pkg.tar.zst.sig2024-02-12 21:10 119
[PGP]gnome-music-1:46beta-1-any.pkg.tar.zst.sig2024-02-17 16:20 119
[PGP]gnome-nibbles-4.0.2-1-x86_64.pkg.tar.zst.sig2024-02-10 01:14 119
[PGP]gnome-online-accounts-3.49.2-1-x86_64.pkg.tar.zst.sig2024-02-20 01:14 119
[PGP]gnome-packagekit-43.0-1-x86_64.pkg.tar.zst.sig2023-05-24 02:40 119
[PGP]gnome-session-46alpha-1-x86_64.pkg.tar.zst.sig2024-01-22 22:54 119
[PGP]gnome-settings-daemon-45.1-1-x86_64.pkg.tar.zst.sig2023-12-26 01:15 119
[PGP]gnome-settings-daemon-46beta-1-x86_64.pkg.tar.zst.sig2024-02-17 01:17 119
[PGP]gnome-shell-1:45.4-1-x86_64.pkg.tar.zst.sig2024-02-12 21:10 119
[PGP]gnome-shell-1:46beta-1-x86_64.pkg.tar.zst.sig2024-02-24 01:18 119
[PGP]gnome-shell-extensions-45.2-1-any.pkg.tar.zst.sig2023-12-03 01:15 119
[PGP]gnome-shell-extensions-46beta-1-any.pkg.tar.zst.sig2024-02-24 01:18 119
[PGP]gnome-sudoku-45.5-1-x86_64.pkg.tar.zst.sig2024-02-10 01:14 119
[PGP]gnome-system-monitor-46beta-1-x86_64.pkg.tar.zst.sig2024-02-17 01:17 119
[PGP]gnome-terminal-3.97.0-1-x86_64.pkg.tar.zst.sig2024-01-29 01:17 119
[PGP]gnome-text-editor-45.3-1-x86_64.pkg.tar.zst.sig2024-01-25 01:14 119
[PGP]gnome-text-editor-46beta-1-x86_64.pkg.tar.zst.sig2024-02-17 01:17 119
[PGP]gnome-tweaks-45.1-1-any.pkg.tar.zst.sig2024-02-12 21:10 119
[PGP]gnome-tweaks-46beta-1-any.pkg.tar.zst.sig2024-02-26 01:16 119
[PGP]gnote-45.1-1-x86_64.pkg.tar.zst.sig2024-01-02 01:14 119
[PGP]gnu-efi-3.0.17-3-x86_64.pkg.tar.zst.sig2023-06-04 02:14 119
[PGP]gnupg-2.4.4-1-x86_64.pkg.tar.zst.sig2024-01-26 01:13 119
[PGP]go-swagger-0.30.5-1-x86_64.pkg.tar.zst.sig2023-06-21 02:24 119
[PGP]go-task-3.31.0-3-x86_64.pkg.tar.zst.sig2023-12-01 01:14 119
[PGP]goattracker-2.76-3-x86_64.pkg.tar.zst.sig2023-05-24 02:41 119
[PGP]gobby-1:0.6.0-1-x86_64.pkg.tar.zst.sig2023-05-24 02:41 119
[PGP]gobject-introspection-1.79.1-1-x86_64.pkg.tar.zst.sig2024-01-11 01:16 119
[PGP]gobject-introspection-runtime-1.79.1-1-x86_64.pkg.tar.zst.sig2024-01-11 01:16 119
[PGP]gocryptfs-2.4.0-1-x86_64.pkg.tar.zst.sig2023-06-17 15:35 119
[PGP]goimapnotify-2.3.10-1-x86_64.pkg.tar.zst.sig2024-01-05 01:14 119
[PGP]gomuks-0.3.0-2-x86_64.pkg.tar.zst.sig2023-05-24 02:41 119
[PGP]gparted-1.5.0-1-x86_64.pkg.tar.zst.sig2023-02-22 01:14 119
[PGP]gparted-1.6.0-1-x86_64.pkg.tar.zst.sig2024-02-27 01:14 119
[PGP]gperf-3.1-5-x86_64.pkg.tar.zst.sig2023-09-05 02:14 119
[PGP]gpgit-1:1.5.0-2-any.pkg.tar.zst.sig2023-05-24 02:41 119
[PGP]gpgme-1.23.2-1-x86_64.pkg.tar.zst.sig2023-11-29 01:15 119
[PGP]gpm-1.20.7.r38.ge82d1a6-5-x86_64.pkg.tar.zst.sig2023-04-28 02:13 119
[PGP]gpodder-3.11.4-1-any.pkg.tar.zst.sig2023-10-16 19:00 119
[PGP]gprename-20230429-1-any.pkg.tar.zst.sig2023-05-24 02:41 119
[PGP]grep-3.11-1-x86_64.pkg.tar.zst.sig2023-05-16 02:14 119
[PGP]grml-zsh-config-0.19.7-1-any.pkg.tar.zst.sig2024-02-03 01:16 119
[PGP]gron-0.7.1-2-x86_64.pkg.tar.zst.sig2023-05-24 02:42 119
[PGP]grpc-1.62.0-1-x86_64.pkg.tar.zst.sig2024-02-22 01:14 119
[PGP]grpc-cli-1.62.0-1-x86_64.pkg.tar.zst.sig2024-02-22 01:14 119
[PGP]grub-btrfs-4.13-1-any.pkg.tar.zst.sig2023-06-17 15:35 119
[PGP]grub-customizer-5.2.4-1-x86_64.pkg.tar.zst.sig2023-11-01 01:14 119
[PGP]gsettings-desktop-schemas-46beta-1-any.pkg.tar.zst.sig2024-02-17 01:17 119
[PGP]gsfonts-20200910-3-any.pkg.tar.zst.sig2023-03-19 01:13 119
[PGP]gst-editing-services-1.22.10-1-x86_64.pkg.tar.zst.sig2024-02-15 01:14 119
[PGP]gst-libav-1.22.10-1-x86_64.pkg.tar.zst.sig2024-02-15 01:14 119
[PGP]gst-plugin-gtk-1.22.10-1-x86_64.pkg.tar.zst.sig2024-02-15 01:14 119
[PGP]gst-plugin-libcamera-0.2.0-1-x86_64.pkg.tar.zst.sig2024-01-25 01:15 119
[PGP]gst-plugin-msdk-1.22.10-1-x86_64.pkg.tar.zst.sig2024-02-15 01:14 119
[PGP]gst-plugin-pipewire-1:1.0.3-1-x86_64.pkg.tar.zst.sig2024-02-03 01:16 119
[PGP]gst-plugin-qml6-1.22.10-1-x86_64.pkg.tar.zst.sig2024-02-15 01:14 119
[PGP]gst-plugin-qmlgl-1.22.10-1-x86_64.pkg.tar.zst.sig2024-02-15 01:14 119
[PGP]gst-plugin-qsv-1.22.10-1-x86_64.pkg.tar.zst.sig2024-02-15 01:14 119
[PGP]gst-plugin-va-1.22.10-1-x86_64.pkg.tar.zst.sig2024-02-15 01:14 119
[PGP]gst-plugins-base-1.22.10-1-x86_64.pkg.tar.zst.sig2024-02-15 01:14 119
[PGP]gst-plugins-base-libs-1.22.10-1-x86_64.pkg.tar.zst.sig2024-02-15 01:14 119
[PGP]gst-plugins-good-1.22.10-1-x86_64.pkg.tar.zst.sig2024-02-15 01:14 119
[PGP]gst-plugins-ugly-1.22.10-1-x86_64.pkg.tar.zst.sig2024-02-15 01:14 119
[PGP]gst-python-1.22.10-1-x86_64.pkg.tar.zst.sig2024-02-15 01:14 119
[PGP]gst-rtsp-server-1.22.10-1-x86_64.pkg.tar.zst.sig2024-02-15 01:14 119
[PGP]gstreamer-1.22.10-1-x86_64.pkg.tar.zst.sig2024-02-15 01:14 119
[PGP]gstreamer-docs-1.22.10-1-x86_64.pkg.tar.zst.sig2024-02-15 01:14 119
[PGP]gstreamer-vaapi-1.22.10-1-x86_64.pkg.tar.zst.sig2024-02-15 01:14 119
[PGP]gthumb-3.12.5-1-x86_64.pkg.tar.zst.sig2024-02-19 01:15 119
[PGP]gthumb-3.12.5-2-x86_64.pkg.tar.zst.sig2024-02-25 01:14 119
[PGP]gtk-layer-shell-0.8.2-1-x86_64.pkg.tar.zst.sig2024-01-06 01:15 119
[PGP]gtk-update-icon-cache-1:4.12.5-1-x86_64.pkg.tar.zst.sig2024-01-19 01:14 119
[PGP]gtk-update-icon-cache-1:4.13.8.1-1-x86_64.pkg.tar.zst.sig2024-02-23 01:19 119
[PGP]gtk3-1:3.24.41-1-x86_64.pkg.tar.zst.sig2024-01-25 01:14 119
[PGP]gtk3-demos-1:3.24.41-1-x86_64.pkg.tar.zst.sig2024-01-25 01:14 119
[PGP]gtk3-docs-1:3.24.41-1-x86_64.pkg.tar.zst.sig2024-01-25 01:14 119
[PGP]gtk4-1:4.12.5-1-x86_64.pkg.tar.zst.sig2024-01-19 01:14 119
[PGP]gtk4-1:4.13.8.1-1-x86_64.pkg.tar.zst.sig2024-02-23 01:19 119
[PGP]gtk4-demos-1:4.12.5-1-x86_64.pkg.tar.zst.sig2024-01-19 01:14 119
[PGP]gtk4-demos-1:4.13.8.1-1-x86_64.pkg.tar.zst.sig2024-02-23 01:19 119
[PGP]gtk4-docs-1:4.12.5-1-x86_64.pkg.tar.zst.sig2024-01-19 01:14 119
[PGP]gtk4-docs-1:4.13.8.1-1-x86_64.pkg.tar.zst.sig2024-02-23 01:19 119
[PGP]gtkd-3.10.0-11-x86_64.pkg.tar.zst.sig2024-01-07 17:00 119
[PGP]gtkglext-1.2.0-13-x86_64.pkg.tar.zst.sig2021-05-13 02:13 119
[PGP]gtkimageview-1.6.4-7-x86_64.pkg.tar.zst.sig2023-05-24 02:42 119
[PGP]gtkmathview-0.8.0-9-x86_64.pkg.tar.zst.sig2021-05-13 02:13 119
[PGP]gtksourceview5-5.11.1-1-x86_64.pkg.tar.zst.sig2024-02-17 01:17 119
[PGP]gtksourceview5-docs-5.11.1-1-x86_64.pkg.tar.zst.sig2024-02-17 01:17 119
[PGP]guestfs-tools-1.52.0-1-x86_64.pkg.tar.zst.sig2024-01-17 01:20 119
[PGP]gufw-24.04-1-any.pkg.tar.zst.sig2023-11-02 01:13 119
[PGP]guitarix-0.44.1-6-x86_64.pkg.tar.zst.sig2023-11-29 01:16 119
[PGP]gvfs-1.52.2-2-x86_64.pkg.tar.zst.sig2024-01-18 01:16 119
[PGP]gvfs-1.53.90-1-x86_64.pkg.tar.zst.sig2024-02-19 01:17 119
[PGP]gvfs-afc-1.52.2-2-x86_64.pkg.tar.zst.sig2024-01-18 01:16 119
[PGP]gvfs-afc-1.53.90-1-x86_64.pkg.tar.zst.sig2024-02-19 01:17 119
[PGP]gvfs-goa-1.52.2-2-x86_64.pkg.tar.zst.sig2024-01-18 01:16 119
[PGP]gvfs-google-1.52.2-2-x86_64.pkg.tar.zst.sig2024-01-18 01:16 119
[PGP]gvfs-google-1.53.90-1-x86_64.pkg.tar.zst.sig2024-02-19 01:17 119
[PGP]gvfs-gphoto2-1.52.2-2-x86_64.pkg.tar.zst.sig2024-01-18 01:16 119
[PGP]gvfs-gphoto2-1.53.90-1-x86_64.pkg.tar.zst.sig2024-02-19 01:17 119
[PGP]gvfs-mtp-1.52.2-2-x86_64.pkg.tar.zst.sig2024-01-18 01:16 119
[PGP]gvfs-mtp-1.53.90-1-x86_64.pkg.tar.zst.sig2024-02-19 01:17 119
[PGP]gvfs-nfs-1.52.2-2-x86_64.pkg.tar.zst.sig2024-01-18 01:16 119
[PGP]gvfs-nfs-1.53.90-1-x86_64.pkg.tar.zst.sig2024-02-19 01:17 119
[PGP]gvfs-onedrive-1.53.90-1-x86_64.pkg.tar.zst.sig2024-02-19 01:17 119
[PGP]gvfs-smb-1.52.2-2-x86_64.pkg.tar.zst.sig2024-01-18 01:16 119
[PGP]gvfs-smb-1.53.90-1-x86_64.pkg.tar.zst.sig2024-02-19 01:17 119
[PGP]gvim-9.1.0080-1-x86_64.pkg.tar.zst.sig2024-02-07 01:14 119
[PGP]gxplugins.lv2-1.0-1-x86_64.pkg.tar.zst.sig2023-05-24 02:42 119
[PGP]gzip-1.13-2-x86_64.pkg.tar.zst.sig2023-09-05 02:13 119
[PGP]half-2.2.0-2-x86_64.pkg.tar.zst.sig2023-05-24 02:42 119
[PGP]hamlib-4.5.5-3-x86_64.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]haproxy-2.9.5-1-x86_64.pkg.tar.zst.sig2024-02-16 01:15 119
[PGP]haproxy-2.9.6-1-x86_64.pkg.tar.zst.sig2024-02-27 01:14 119
[PGP]harvid-0.9.1-2-x86_64.pkg.tar.zst.sig2023-05-24 02:42 119
[PGP]hashdeep-4.4-7-x86_64.pkg.tar.zst.sig2023-10-08 02:14 119
[PGP]hatari-2.4.1-2-x86_64.pkg.tar.zst.sig2023-05-24 02:43 119
[PGP]haveged-1.9.18-1-x86_64.pkg.tar.zst.sig2022-04-12 02:13 119
[PGP]hblock-3.4.4-1-any.pkg.tar.zst.sig2024-02-01 01:16 119
[PGP]hck-0.9.2-1-x86_64.pkg.tar.zst.sig2023-05-24 02:43 119
[PGP]hdf5-openmpi-1.14.3-2-x86_64.pkg.tar.zst.sig2024-01-26 01:16 119
[PGP]heimdall-1.4.2-7-x86_64.pkg.tar.zst.sig2023-08-22 02:14 119
[PGP]helix-23.10-1-x86_64.pkg.tar.zst.sig2023-10-26 21:15 119
[PGP]helm-synth-0.9.0-10-x86_64.pkg.tar.zst.sig2023-05-24 02:43 119
[PGP]helm-synth-common-0.9.0-10-x86_64.pkg.tar.zst.sig2023-05-24 02:43 119
[PGP]helm-synth-lv2-0.9.0-10-x86_64.pkg.tar.zst.sig2023-05-24 02:43 119
[PGP]helm-synth-standalone-0.9.0-10-x86_64.pkg.tar.zst.sig2023-05-24 02:43 119
[PGP]helm-synth-vst-0.9.0-10-x86_64.pkg.tar.zst.sig2023-05-24 02:43 119
[PGP]helvum-0.4.0-1-x86_64.pkg.tar.zst.sig2023-07-25 02:13 119
[PGP]helvum-0.5.1-1-x86_64.pkg.tar.zst.sig2023-10-01 02:13 119
[PGP]hepmc2-2.06.11-3-x86_64.pkg.tar.zst.sig2023-05-27 02:13 119
[PGP]hevea-2.36-1-x86_64.pkg.tar.zst.sig2023-05-24 02:43 119
[PGP]hexter-1.1.1-2-x86_64.pkg.tar.zst.sig2023-05-24 02:43 119
[PGP]highway-1.1.0-1-x86_64.pkg.tar.zst.sig2024-02-22 01:14 119
[PGP]hip-runtime-amd-6.0.0-1-x86_64.pkg.tar.zst.sig2023-12-21 01:15 119
[PGP]hip-runtime-amd-6.0.2-1-x86_64.pkg.tar.zst.sig2024-02-26 01:16 119
[PGP]hipblas-6.0.0-1-x86_64.pkg.tar.zst.sig2023-12-23 01:15 119
[PGP]hipblaslt-6.0.0-1-x86_64.pkg.tar.zst.sig2023-12-23 01:15 119
[PGP]hipcub-6.0.0-1-x86_64.pkg.tar.zst.sig2023-12-23 01:15 119
[PGP]hipfft-6.0.0-1-x86_64.pkg.tar.zst.sig2023-12-23 01:15 119
[PGP]hipify-clang-6.0.0-1-x86_64.pkg.tar.zst.sig2023-12-23 01:15 119
[PGP]hiprand-6.0.0-1-x86_64.pkg.tar.zst.sig2023-12-23 01:15 119
[PGP]hipsolver-6.0.0-1-x86_64.pkg.tar.zst.sig2023-12-23 01:15 119
[PGP]hipsparse-6.0.0-1-x86_64.pkg.tar.zst.sig2023-12-23 01:15 119
[PGP]hiredis-1.2.0-2-x86_64.pkg.tar.zst.sig2023-09-28 02:14 119
[PGP]hivex-1.3.23-3-x86_64.pkg.tar.zst.sig2023-12-09 19:26 119
[PGP]hm-18.0-1-x86_64.pkg.tar.zst.sig2024-01-19 01:14 119
[PGP]hostapd-2.10-4-x86_64.pkg.tar.zst.sig2023-09-06 02:14 119
[PGP]hsa-amd-aqlprofile-bin-6.0.0-1-x86_64.pkg.tar.zst.sig2023-12-23 01:15 119
[PGP]hsa-rocr-6.0.0-2-x86_64.pkg.tar.zst.sig2023-12-21 01:15 119
[PGP]hsa-rocr-6.0.0-3-x86_64.pkg.tar.zst.sig2024-02-24 01:16 119
[PGP]hsakmt-roct-6.0.0-1-x86_64.pkg.tar.zst.sig2023-12-21 01:15 119
[PGP]hsakmt-roct-6.0.0-2-x86_64.pkg.tar.zst.sig2024-02-24 01:16 119
[PGP]htmldoc-1.9.18-1-x86_64.pkg.tar.zst.sig2024-02-14 01:14 119
[PGP]htmlq-0.4.0-1-x86_64.pkg.tar.zst.sig2023-05-24 02:44 119
[PGP]htop-3.3.0-1-x86_64.pkg.tar.zst.sig2024-01-11 01:15 119
[PGP]httpbin-0.10.1-1-any.pkg.tar.zst.sig2023-09-02 02:14 119
[PGP]httping-2.9-1-x86_64.pkg.tar.zst.sig2023-05-24 02:44 119
[PGP]hut-0.4.0-1-x86_64.pkg.tar.zst.sig2023-11-25 01:15 119
[PGP]hydra-9.5-1-x86_64.pkg.tar.zst.sig2023-06-17 15:36 119
[PGP]hyperkitty-1.3.8-1-any.pkg.tar.zst.sig2023-11-01 01:14 119
[PGP]hyperv-6.7-1-x86_64.pkg.tar.zst.sig2024-01-09 01:13 119
[PGP]i2pd-2.50.2-1-x86_64.pkg.tar.zst.sig2024-01-07 17:00 119
[PGP]i3-wm-4.23-1-x86_64.pkg.tar.zst.sig2023-10-30 01:36 119
[PGP]ibus-1.5.29-3-x86_64.pkg.tar.zst.sig2024-01-21 01:14 119
[PGP]ibus-chewing-2.0.0-1-x86_64.pkg.tar.zst.sig2024-02-20 01:14 119
[PGP]ibus-sunpinyin-3.0.0rc1+32+gf39c195-3-x86_64.pkg.tar.zst.sig2023-05-24 02:44 119
[PGP]ibus-typing-booster-2.25.1-1-any.pkg.tar.zst.sig2024-02-15 01:14 119
[PGP]icmake-10.03.03-1-x86_64.pkg.tar.zst.sig2023-05-24 02:44 119
[PGP]iempluginsuite-1.14.1-2-x86_64.pkg.tar.zst.sig2023-09-03 02:14 119
[PGP]iempluginsuite-standalone-1.14.1-2-x86_64.pkg.tar.zst.sig2023-09-03 02:14 119
[PGP]iempluginsuite-vst3-1.14.1-2-x86_64.pkg.tar.zst.sig2023-09-03 02:14 119
[PGP]igsc-0.8.13-1-x86_64.pkg.tar.zst.sig2024-01-25 01:15 119
[PGP]imlib2-1.12.2-1-x86_64.pkg.tar.zst.sig2024-02-04 01:14 119
[PGP]imlib2-1.12.2-2-x86_64.pkg.tar.zst.sig2024-02-23 01:18 119
[PGP]imvirt-0.9.6-10-x86_64.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]incron-0.5.12-5-x86_64.pkg.tar.zst.sig2023-05-24 02:44 119
[PGP]infamousplugins-0.3.2-1-x86_64.pkg.tar.zst.sig2023-05-24 02:44 119
[PGP]iniparser-4.1-4-x86_64.pkg.tar.zst.sig2021-12-27 01:26 119
[PGP]inkscape-1.3.2-3-x86_64.pkg.tar.zst.sig2023-12-20 01:15 119
[PGP]intel-compute-runtime-23.48.27912.11-1-x86_64.pkg.tar.zst.sig2024-01-25 01:15 119
[PGP]intel-gmmlib-22.3.17-1-x86_64.pkg.tar.zst.sig2024-01-19 01:14 119
[PGP]intel-gpu-tools-1.27-2-x86_64.pkg.tar.zst.sig2023-06-27 02:13 119
[PGP]intel-graphics-compiler-1:1.0.15610.11-1-x86_64.pkg.tar.zst.sig2024-01-25 01:15 119
[PGP]intel-media-sdk-23.2.2-2-x86_64.pkg.tar.zst.sig2023-08-05 02:14 119
[PGP]intel-metee-3.2.4-1-x86_64.pkg.tar.zst.sig2023-11-03 01:14 119
[PGP]intel-metee-doc-3.2.4-1-x86_64.pkg.tar.zst.sig2023-11-03 01:14 119
[PGP]intel-oneapi-common-2023.2.0-1-any.pkg.tar.zst.sig2023-08-27 02:20 119
[PGP]intel-oneapi-compiler-dpcpp-cpp-runtime-2023.2.0-1-x86_64.pkg.tar.zst.sig2023-08-27 02:20 119
[PGP]intel-oneapi-compiler-dpcpp-cpp-runtime-libs-2023.2.0-1-x86_64.pkg.tar.zst.sig2023-08-27 02:20 119
[PGP]intel-oneapi-compiler-shared-2023.2.0-1-x86_64.pkg.tar.zst.sig2023-08-27 02:20 119
[PGP]intel-oneapi-compiler-shared-runtime-2023.2.0-1-x86_64.pkg.tar.zst.sig2023-08-27 02:21 119
[PGP]intel-oneapi-compiler-shared-runtime-libs-2023.2.0-1-x86_64.pkg.tar.zst.sig2023-08-27 02:21 119
[PGP]intel-oneapi-dev-utilities-2021.9.0_44447-2-x86_64.pkg.tar.zst.sig2023-05-24 02:52 119
[PGP]intel-oneapi-dpcpp-cpp-2023.2.0-1-x86_64.pkg.tar.zst.sig2023-08-27 02:22 119
[PGP]intel-oneapi-dpcpp-debugger-2023.2.0_49330-1-x86_64.pkg.tar.zst.sig2023-08-27 02:22 119
[PGP]intel-oneapi-mkl-2023.2.0_49495-2-x86_64.pkg.tar.zst.sig2023-09-03 02:14 119
[PGP]intel-oneapi-openmp-2023.2.0-1-x86_64.pkg.tar.zst.sig2023-08-27 02:23 119
[PGP]inxi-3.3.33.1-1-any.pkg.tar.zst.sig2024-02-11 01:14 119
[PGP]ioping-1.3-1-x86_64.pkg.tar.zst.sig2023-05-24 02:54 119
[PGP]ipcalc-0.51-1-any.pkg.tar.zst.sig2023-05-24 02:54 119
[PGP]iperf-2.1.9-1-x86_64.pkg.tar.zst.sig2023-05-24 02:54 119
[PGP]ipguard-1.04-8-x86_64.pkg.tar.zst.sig2023-11-05 01:13 119
[PGP]iproute2-6.7.0-1-x86_64.pkg.tar.zst.sig2024-01-09 01:13 119
[PGP]ipset-7.20-1-x86_64.pkg.tar.zst.sig2024-02-05 01:15 119
[PGP]ipv6calc-4.1.0-1-x86_64.pkg.tar.zst.sig2023-09-21 02:14 119
[PGP]ipvsadm-1.31-2-x86_64.pkg.tar.zst.sig2023-08-16 02:23 119
[PGP]ipxe-1.21.1-5-x86_64.pkg.tar.zst.sig2023-05-24 02:54 119
[PGP]ir.lv2-1.3.4-3-x86_64.pkg.tar.zst.sig2023-05-24 02:54 119
[PGP]irker-2.24-1-any.pkg.tar.zst.sig2024-02-17 16:20 119
[PGP]irssi-1.4.5-1-x86_64.pkg.tar.zst.sig2023-10-04 02:14 119
[PGP]ispc-1.22.0-1-x86_64.pkg.tar.zst.sig2023-11-19 01:14 119
[PGP]iucode-tool-2.3.1-4-x86_64.pkg.tar.zst.sig2021-09-28 02:13 119
[PGP]iw-6.7-1-x86_64.pkg.tar.zst.sig2023-12-22 01:14 119
[PGP]j4-dmenu-desktop-2.18-4-x86_64.pkg.tar.zst.sig2023-05-24 02:54 119
[PGP]jack-example-tools-4-1-x86_64.pkg.tar.zst.sig2023-02-03 01:13 119
[PGP]jack-stdio-1.6-2-x86_64.pkg.tar.zst.sig2023-05-24 02:54 119
[PGP]jack2-1.9.22-1-x86_64.pkg.tar.zst.sig2023-02-05 01:14 119
[PGP]jack2-dbus-1.9.22-1-x86_64.pkg.tar.zst.sig2023-02-05 01:14 119
[PGP]jack2-docs-1.9.22-1-x86_64.pkg.tar.zst.sig2023-02-05 01:14 119
[PGP]jack_delay-0.4.2-2-x86_64.pkg.tar.zst.sig2023-05-24 02:54 119
[PGP]jack_mixer-18-1-x86_64.pkg.tar.zst.sig2023-11-19 01:14 119
[PGP]jack_utils-0.0.1-2-x86_64.pkg.tar.zst.sig2023-05-24 02:54 119
[PGP]jackmeter-0.4-3-x86_64.pkg.tar.zst.sig2023-05-24 02:54 119
[PGP]jackminimix-0.2.1-3-x86_64.pkg.tar.zst.sig2023-05-24 02:54 119
[PGP]jacktrip-1:1.9.0-1-x86_64.pkg.tar.zst.sig2023-05-24 02:54 119
[PGP]jacktrip-1:2.2.2-1-x86_64.pkg.tar.zst.sig2024-02-18 01:14 119
[PGP]jalv-1.6.8-2-x86_64.pkg.tar.zst.sig2023-05-24 02:54 119
[PGP]japa-0.9.4-3-x86_64.pkg.tar.zst.sig2023-11-29 01:16 119
[PGP]jbigkit-2.1-7-x86_64.pkg.tar.zst.sig2023-09-06 02:14 119
[PGP]jc-1.24.0-1-any.pkg.tar.zst.sig2023-12-29 01:13 119
[PGP]jc303-common-0.9.1-2-x86_64.pkg.tar.zst.sig2023-12-01 01:15 119
[PGP]jc303-lv2-0.9.1-2-x86_64.pkg.tar.zst.sig2023-12-01 01:15 119
[PGP]jc303-vst3-0.9.1-2-x86_64.pkg.tar.zst.sig2023-12-01 01:15 119
[PGP]jconvolver-1.1.0-3-x86_64.pkg.tar.zst.sig2023-05-24 02:54 119
[PGP]jellyfin-server-10.8.13-1-x86_64.pkg.tar.zst.sig2023-12-01 01:15 119
[PGP]jellyfin-web-10.8.13-1-any.pkg.tar.zst.sig2023-12-01 01:15 119
[PGP]jemalloc-1:5.3.0-3-x86_64.pkg.tar.zst.sig2023-09-21 02:14 119
[PGP]jitterentropy-3.4.1-1-x86_64.pkg.tar.zst.sig2023-05-24 02:54 119
[PGP]jless-0.9.0-1-x86_64.pkg.tar.zst.sig2023-07-18 02:13 119
[PGP]jnoisemeter-0.4.1-1-x86_64.pkg.tar.zst.sig2023-10-26 02:25 119
[PGP]jo-1.9-1-x86_64.pkg.tar.zst.sig2023-05-24 02:54 119
[PGP]john-1.9.0.jumbo1-10-x86_64.pkg.tar.zst.sig2024-01-26 01:16 119
[PGP]jpeg-archive-2.2.0-3-x86_64.pkg.tar.zst.sig2023-05-24 02:54 119
[PGP]jruby-9.4.6.0-1-any.pkg.tar.zst.sig2024-02-22 01:14 119
[PGP]js80p-2.4.4-2-x86_64.pkg.tar.zst.sig2023-12-01 01:15 119
[PGP]js115-115.8.0-1-x86_64.pkg.tar.zst.sig2024-02-20 01:13 119
[PGP]juce-7.0.10-1-x86_64.pkg.tar.zst.sig2024-02-19 01:15 119
[PGP]juce-docs-7.0.10-1-x86_64.pkg.tar.zst.sig2024-02-19 01:15 119
[PGP]junit-system-rules-1.19.0-8-any.pkg.tar.zst.sig2023-10-08 02:14 119
[PGP]kak-lsp-15.0.1-1-x86_64.pkg.tar.zst.sig2023-12-13 18:29 119
[PGP]kakoune-2023.07.29-1-x86_64.pkg.tar.zst.sig2023-07-30 02:13 119
[PGP]kanshi-1.5.1-1-x86_64.pkg.tar.zst.sig2024-02-03 01:16 119
[PGP]kcov-42-1-x86_64.pkg.tar.zst.sig2024-02-16 01:14 119
[PGP]keepalived-2.2.8-1-x86_64.pkg.tar.zst.sig2023-06-06 02:13 119
[PGP]keepass-plugin-keeagent-0.12.1-3-any.pkg.tar.zst.sig2023-05-24 03:00 119
[PGP]kernel-hardening-checker-0.6.6-1-any.pkg.tar.zst.sig2024-01-17 01:18 119
[PGP]kernelshark-2.3.0-1-x86_64.pkg.tar.zst.sig2023-12-06 01:18 119
[PGP]keyutils-1.6.3-2-x86_64.pkg.tar.zst.sig2023-04-28 02:13 119
[PGP]khard-0.19.1-1-any.pkg.tar.zst.sig2023-11-29 01:16 119
[PGP]kicad-7.0.10-1-x86_64.pkg.tar.zst.sig2023-12-31 01:13 119
[PGP]kicad-library-3d-7.0.10-1-any.pkg.tar.zst.sig2023-12-31 01:14 119
[PGP]kicad-library-7.0.10-1-any.pkg.tar.zst.sig2023-12-31 01:14 119
[PGP]kitty-0.31.0-1-x86_64.pkg.tar.zst.sig2023-11-13 01:16 119
[PGP]kitty-shell-integration-0.31.0-1-x86_64.pkg.tar.zst.sig2023-11-13 01:16 119
[PGP]kitty-terminfo-0.31.0-1-x86_64.pkg.tar.zst.sig2023-11-13 01:16 119
[PGP]klystrack-plus-0.10.0.alpha2-1-x86_64.pkg.tar.zst.sig2023-05-24 03:01 119
[PGP]kmidimon-1.4.0-1-x86_64.pkg.tar.zst.sig2024-01-03 01:14 119
[PGP]kmod-31-1-x86_64.pkg.tar.zst.sig2023-09-30 02:13 119
[PGP]knot-resolver-5.7.1-1-x86_64.pkg.tar.zst.sig2024-02-15 01:14 119
[PGP]kodi-addon-audioencoder-flac-1:20.2.0-8-x86_64.pkg.tar.zst.sig2024-02-12 21:10 119
[PGP]kodi-addon-audioencoder-lame-1:20.3.0-8-x86_64.pkg.tar.zst.sig2024-02-12 21:10 119
[PGP]kodi-addon-audioencoder-vorbis-1:20.2.0-8-x86_64.pkg.tar.zst.sig2024-02-12 21:10 119
[PGP]kodi-addon-audioencoder-wav-1:20.2.0-8-x86_64.pkg.tar.zst.sig2024-02-12 21:10 119
[PGP]kodi-addon-imagedecoder-heif-20.1.0-10-x86_64.pkg.tar.zst.sig2024-02-12 21:10 119
[PGP]kodi-addon-imagedecoder-raw-20.1.0-9-x86_64.pkg.tar.zst.sig2024-02-12 21:10 119
[PGP]kodi-addon-inputstream-adaptive-20.3.18-1-x86_64.pkg.tar.zst.sig2024-02-22 01:14 119
[PGP]kodi-addon-inputstream-rtmp-20.3.0-9-x86_64.pkg.tar.zst.sig2024-02-12 21:10 119
[PGP]kodi-addon-peripheral-joystick-20.1.15-2-x86_64.pkg.tar.zst.sig2024-02-12 21:10 119
[PGP]kodi-addon-screensaver-asteroids-1:20.2.0-8-x86_64.pkg.tar.zst.sig2024-02-12 21:10 119
[PGP]kodi-addon-screensaver-biogenesis-1:20.1.0-9-x86_64.pkg.tar.zst.sig2024-02-12 21:10 119
[PGP]kodi-addon-screensaver-greynetic-1:20.2.0-8-x86_64.pkg.tar.zst.sig2024-02-12 21:10 119
[PGP]kodi-addon-screensaver-matrixtrails-1:20.1.0-9-x86_64.pkg.tar.zst.sig2024-02-12 21:10 119
[PGP]kodi-addon-screensaver-pingpong-1:20.2.0-8-x86_64.pkg.tar.zst.sig2024-02-12 21:10 119
[PGP]kodi-addon-screensaver-pyro-1:20.1.0-9-x86_64.pkg.tar.zst.sig2024-02-12 21:10 119
[PGP]kodi-addon-screensaver-stars-1:20.1.0-9-x86_64.pkg.tar.zst.sig2024-02-12 21:10 119
[PGP]kodi-addon-visualization-projectm-1:20.2.0-9-x86_64.pkg.tar.zst.sig2024-02-12 21:10 119
[PGP]kodi-addon-visualization-shadertoy-1:20.3.0-10-x86_64.pkg.tar.zst.sig2024-02-12 21:10 119
[PGP]kodi-addon-visualization-spectrum-1:20.2.0-9-x86_64.pkg.tar.zst.sig2024-02-12 21:10 119
[PGP]kodi-addon-visualization-waveform-1:20.2.1-9-x86_64.pkg.tar.zst.sig2024-02-12 21:10 119
[PGP]kodi-gles-20.4-1-x86_64.pkg.tar.zst.sig2024-02-12 21:11 119
[PGP]kodi-platform-20190726.809c5e9-48-x86_64.pkg.tar.zst.sig2024-02-12 21:11 119
[PGP]kube-apiserver-1.29.2-1-x86_64.pkg.tar.zst.sig2024-02-18 01:14 119
[PGP]kube-controller-manager-1.29.2-1-x86_64.pkg.tar.zst.sig2024-02-18 01:14 119
[PGP]kube-proxy-1.29.2-1-x86_64.pkg.tar.zst.sig2024-02-18 01:14 119
[PGP]kube-scheduler-1.29.2-1-x86_64.pkg.tar.zst.sig2024-02-18 01:14 119
[PGP]kubeadm-1.29.2-1-x86_64.pkg.tar.zst.sig2024-02-18 01:14 119
[PGP]kubectl-1.29.2-1-x86_64.pkg.tar.zst.sig2024-02-18 01:14 119
[PGP]kubelet-1.29.2-1-x86_64.pkg.tar.zst.sig2024-02-18 01:14 119
[PGP]kubernetes-control-plane-common-1.29.2-1-x86_64.pkg.tar.zst.sig2024-02-18 01:14 119
[PGP]kvazaar-2.3.0-2-x86_64.pkg.tar.zst.sig2024-01-20 01:26 119
[PGP]kxstudio-lv2-extensions-2022.09.28-2-any.pkg.tar.zst.sig2023-05-24 03:02 119
[PGP]lablgtk3-3.1.3-4-x86_64.pkg.tar.zst.sig2023-12-09 19:27 119
[PGP]laborejo-2.2.2-1-any.pkg.tar.zst.sig2023-05-24 03:02 119
[PGP]ladspa-1.17-4-x86_64.pkg.tar.zst.sig2023-09-03 02:14 119
[PGP]lame-3.100-4-x86_64.pkg.tar.zst.sig2022-07-24 02:13 119
[PGP]lastpass-cli-1.3.5-1-x86_64.pkg.tar.zst.sig2023-09-03 02:14 119
[PGP]lazarus-3.0-2-x86_64.pkg.tar.zst.sig2024-01-25 01:14 119
[PGP]lazarus-gtk2-3.0-2-x86_64.pkg.tar.zst.sig2024-01-25 01:14 119
[PGP]lazarus-gtk3-3.0-2-x86_64.pkg.tar.zst.sig2024-01-25 01:14 119
[PGP]lazarus-qt5-3.0-2-x86_64.pkg.tar.zst.sig2024-01-25 01:14 119
[PGP]lazarus-qt6-3.0-2-x86_64.pkg.tar.zst.sig2024-01-25 01:14 119
[PGP]lcms2-2.16-1-x86_64.pkg.tar.zst.sig2023-12-06 01:19 119
[PGP]ldc-3:1.36.0-1-x86_64.pkg.tar.zst.sig2024-01-07 17:00 119
[PGP]leafpad-0.8.19-2-x86_64.pkg.tar.zst.sig2022-12-13 01:14 119
[PGP]lego-4.14.2-1-x86_64.pkg.tar.zst.sig2023-09-23 02:14 119
[PGP]leocad-23.03-2-x86_64.pkg.tar.zst.sig2023-09-23 02:14 119
[PGP]less-1:643-1-x86_64.pkg.tar.zst.sig2023-08-15 02:13 119
[PGP]level-zero-headers-1.15.1-1-x86_64.pkg.tar.zst.sig2024-01-25 01:15 119
[PGP]level-zero-loader-1.15.1-1-x86_64.pkg.tar.zst.sig2024-01-25 01:15 119
[PGP]lf-31-1-x86_64.pkg.tar.zst.sig2023-09-20 02:16 119
[PGP]lhapdf-6.5.4-1-x86_64.pkg.tar.zst.sig2023-05-27 02:14 119
[PGP]lib2geom-1.3-1-x86_64.pkg.tar.zst.sig2023-06-26 02:14 119
[PGP]lib3mf-2.2.0-1-x86_64.pkg.tar.zst.sig2023-10-13 02:15 119
[PGP]lib32-acl-2.3.2-1-x86_64.pkg.tar.zst.sig2024-01-25 01:15 119
[PGP]lib32-alsa-lib-1.2.11-1-x86_64.pkg.tar.zst.sig2024-02-02 01:17 119
[PGP]lib32-at-spi2-core-2.50.1-1-x86_64.pkg.tar.zst.sig2024-01-07 01:16 119
[PGP]lib32-attr-2.5.2-1-x86_64.pkg.tar.zst.sig2024-01-15 01:21 119
[PGP]lib32-curl-8.6.0-3-x86_64.pkg.tar.zst.sig2024-02-07 01:17 119
[PGP]lib32-dbus-1.14.10-2-x86_64.pkg.tar.zst.sig2024-01-06 01:16 119
[PGP]lib32-e2fsprogs-1.47.0-1-x86_64.pkg.tar.zst.sig2023-12-29 22:10 119
[PGP]lib32-expat-2.6.0-1-x86_64.pkg.tar.zst.sig2024-02-07 01:17 119
[PGP]lib32-fakeroot-1.33-1-x86_64.pkg.tar.zst.sig2024-01-22 22:54 119
[PGP]lib32-fluidsynth-2.3.4-1-x86_64.pkg.tar.zst.sig2023-10-07 02:15 119
[PGP]lib32-fontconfig-2:2.15.0-1-x86_64.pkg.tar.zst.sig2023-12-26 01:17 119
[PGP]lib32-glib2-2.78.4-1-x86_64.pkg.tar.zst.sig2024-01-22 22:54 119
[PGP]lib32-gst-plugins-base-1.22.10-1-x86_64.pkg.tar.zst.sig2024-02-15 01:16 119
[PGP]lib32-gst-plugins-base-libs-1.22.10-1-x86_64.pkg.tar.zst.sig2024-02-15 01:16 119
[PGP]lib32-gst-plugins-good-1.22.10-1-x86_64.pkg.tar.zst.sig2024-02-15 01:16 119
[PGP]lib32-gstreamer-1.22.10-1-x86_64.pkg.tar.zst.sig2024-02-15 01:16 119
[PGP]lib32-gtk3-1:3.24.41-1-x86_64.pkg.tar.zst.sig2024-01-25 01:15 119
[PGP]lib32-harfbuzz-8.3.0-2-x86_64.pkg.tar.zst.sig2023-12-13 18:37 119
[PGP]lib32-harfbuzz-cairo-8.3.0-2-x86_64.pkg.tar.zst.sig2023-12-13 18:37 119
[PGP]lib32-harfbuzz-icu-8.3.0-2-x86_64.pkg.tar.zst.sig2023-12-13 18:37 119
[PGP]lib32-imlib2-1.12.2-1-x86_64.pkg.tar.zst.sig2024-02-04 01:14 119
[PGP]lib32-keyutils-1.6.3-1-x86_64.pkg.tar.zst.sig2023-12-29 23:54 119
[PGP]lib32-libaio-0.3.113-4-x86_64.pkg.tar.zst.sig2024-02-21 01:16 119
[PGP]lib32-libcap-2.69-1-x86_64.pkg.tar.zst.sig2023-12-29 23:00 119
[PGP]lib32-libcurl-compat-8.6.0-3-x86_64.pkg.tar.zst.sig2024-02-07 01:17 119
[PGP]lib32-libcurl-gnutls-8.6.0-3-x86_64.pkg.tar.zst.sig2024-02-07 01:17 119
[PGP]lib32-libelf-0.190-1-x86_64.pkg.tar.zst.sig2023-11-09 01:14 119
[PGP]lib32-libffi-3.4.6-1-x86_64.pkg.tar.zst.sig2024-02-19 01:17 119
[PGP]lib32-libidn-1.42-1-x86_64.pkg.tar.zst.sig2024-01-15 01:21 119
[PGP]lib32-libidn2-2.3.7-1-x86_64.pkg.tar.zst.sig2024-02-01 01:30 119
[PGP]lib32-libjpeg-turbo-3.0.2-2-x86_64.pkg.tar.zst.sig2024-01-26 01:16 119
[PGP]lib32-libnghttp2-1.59.0-2-x86_64.pkg.tar.zst.sig2024-02-01 01:30 119
[PGP]lib32-libnghttp3-1.2.0-1-x86_64.pkg.tar.zst.sig2024-02-17 16:20 119
[PGP]lib32-libnm-1.46.0-1-x86_64.pkg.tar.zst.sig2024-02-24 01:19 119
[PGP]lib32-libnsl-2.0.1-1-x86_64.pkg.tar.zst.sig2023-10-26 02:28 119
[PGP]lib32-libpcap-1.10.4-1-x86_64.pkg.tar.zst.sig2023-12-29 22:27 119
[PGP]lib32-libpipewire-1:1.0.3-1-x86_64.pkg.tar.zst.sig2024-02-03 01:17 119
[PGP]lib32-libpng-1.6.43-1-x86_64.pkg.tar.zst.sig2024-02-24 01:19 119
[PGP]lib32-libproxy-0.5.4-1-x86_64.pkg.tar.zst.sig2024-02-10 01:16 119
[PGP]lib32-libpulse-17.0-1-x86_64.pkg.tar.zst.sig2024-01-13 01:16 119
[PGP]lib32-librsvg-2:2.57.1-1-x86_64.pkg.tar.zst.sig2023-12-16 01:15 119
[PGP]lib32-libsndfile-1.2.2-1-x86_64.pkg.tar.zst.sig2023-09-23 18:25 119
[PGP]lib32-libtiff-4.6.0-2-x86_64.pkg.tar.zst.sig2023-11-29 01:20 119
[PGP]lib32-libva-mesa-driver-1:24.0.1-1-x86_64.pkg.tar.zst.sig2024-02-15 01:16 119
[PGP]lib32-libxcrypt-4.4.36-1-x86_64.pkg.tar.zst.sig2023-09-23 18:25 119
[PGP]lib32-libxcrypt-compat-4.4.36-1-x86_64.pkg.tar.zst.sig2023-09-23 18:25 119
[PGP]lib32-libxml2-2.12.5-1-x86_64.pkg.tar.zst.sig2024-02-05 01:16 119
[PGP]lib32-libxslt-1.1.39-1-x86_64.pkg.tar.zst.sig2023-11-20 01:17 119
[PGP]lib32-llvm-16.0.6-2-x86_64.pkg.tar.zst.sig2023-09-23 18:25 119
[PGP]lib32-llvm-libs-16.0.6-2-x86_64.pkg.tar.zst.sig2023-09-23 18:25 119
[PGP]lib32-mangohud-0.7.1-1-x86_64.pkg.tar.zst.sig2024-02-09 01:15 119
[PGP]lib32-mesa-1:24.0.1-1-x86_64.pkg.tar.zst.sig2024-02-15 01:16 119
[PGP]lib32-mesa-amber-21.3.9-6-x86_64.pkg.tar.zst.sig2024-01-02 01:16 119
[PGP]lib32-mesa-vdpau-1:24.0.1-1-x86_64.pkg.tar.zst.sig2024-02-15 01:16 119
[PGP]lib32-ncurses-6.4_20230520-1-x86_64.pkg.tar.zst.sig2023-09-23 18:25 119
[PGP]lib32-nettle-3.9.1-1-x86_64.pkg.tar.zst.sig2023-09-23 18:25 119
[PGP]lib32-nspr-4.35-2-x86_64.pkg.tar.zst.sig2023-12-13 18:37 119
[PGP]lib32-nss-3.98-1-x86_64.pkg.tar.zst.sig2024-02-18 01:14 119
[PGP]lib32-opencl-clover-mesa-1:24.0.1-1-x86_64.pkg.tar.zst.sig2024-02-15 01:16 119
[PGP]lib32-opencl-rusticl-mesa-1:24.0.1-1-x86_64.pkg.tar.zst.sig2024-02-15 01:16 119
[PGP]lib32-openssl-1.1-1.1.1.w-1-x86_64.pkg.tar.zst.sig2023-09-23 18:25 119
[PGP]lib32-openssl-1:3.2.1-1-x86_64.pkg.tar.zst.sig2024-02-02 01:17 119
[PGP]lib32-orc-0.4.37-1-x86_64.pkg.tar.zst.sig2024-02-08 01:18 119
[PGP]lib32-pango-1:1.51.2-1-x86_64.pkg.tar.zst.sig2024-02-12 21:11 119
[PGP]lib32-pcsclite-2.0.1-1-x86_64.pkg.tar.zst.sig2023-12-13 01:15 119
[PGP]lib32-pipewire-1:1.0.3-1-x86_64.pkg.tar.zst.sig2024-02-03 01:17 119
[PGP]lib32-pipewire-jack-1:1.0.3-1-x86_64.pkg.tar.zst.sig2024-02-03 01:17 119
[PGP]lib32-pipewire-v4l2-1:1.0.3-1-x86_64.pkg.tar.zst.sig2024-02-03 01:17 119
[PGP]lib32-polkit-124-1-x86_64.pkg.tar.zst.sig2024-01-18 01:18 119
[PGP]lib32-procps-ng-4.0.4-1-x86_64.pkg.tar.zst.sig2023-09-23 18:25 119
[PGP]lib32-readline-8.2.007-1-x86_64.pkg.tar.zst.sig2023-11-24 01:16 119
[PGP]lib32-renderdoc-1.31-1-x86_64.pkg.tar.zst.sig2024-02-01 01:30 119
[PGP]lib32-rust-libs-1:1.76.0-1-x86_64.pkg.tar.zst.sig2024-02-09 01:15 119
[PGP]lib32-systemd-255.3-1-x86_64.pkg.tar.zst.sig2024-01-25 01:15 119
[PGP]lib32-util-linux-2.39.3-1-x86_64.pkg.tar.zst.sig2023-12-07 16:45 119
[PGP]lib32-vulkan-intel-1:24.0.1-1-x86_64.pkg.tar.zst.sig2024-02-15 01:16 119
[PGP]lib32-vulkan-mesa-layers-1:24.0.1-1-x86_64.pkg.tar.zst.sig2024-02-15 01:16 119
[PGP]lib32-vulkan-radeon-1:24.0.1-1-x86_64.pkg.tar.zst.sig2024-02-15 01:16 119
[PGP]lib32-vulkan-swrast-1:24.0.1-1-x86_64.pkg.tar.zst.sig2024-02-15 01:16 119
[PGP]lib32-vulkan-virtio-1:24.0.1-1-x86_64.pkg.tar.zst.sig2024-02-15 01:16 119
[PGP]lib32-xz-5.4.6-1-x86_64.pkg.tar.zst.sig2024-01-27 01:18 119
[PGP]lib32-xz-5.6.0-1-x86_64.pkg.tar.zst.sig2024-02-25 01:14 119
[PGP]lib32-zlib-1.3.1-1-x86_64.pkg.tar.zst.sig2024-01-22 22:54 119
[PGP]libaacs-0.11.1-2-x86_64.pkg.tar.zst.sig2023-05-24 03:03 119
[PGP]libabigail-2.4-1-x86_64.pkg.tar.zst.sig2023-12-03 01:20 119
[PGP]libadwaita-1:1.4.3-1-x86_64.pkg.tar.zst.sig2024-02-10 01:15 119
[PGP]libadwaita-1:1.5beta-1-x86_64.pkg.tar.zst.sig2024-02-15 01:15 119
[PGP]libadwaita-demos-1:1.4.3-1-x86_64.pkg.tar.zst.sig2024-02-10 01:15 119
[PGP]libadwaita-demos-1:1.5beta-1-x86_64.pkg.tar.zst.sig2024-02-15 01:15 119
[PGP]libadwaita-docs-1:1.4.3-1-x86_64.pkg.tar.zst.sig2024-02-10 01:15 119
[PGP]libadwaita-docs-1:1.5beta-1-x86_64.pkg.tar.zst.sig2024-02-15 01:15 119
[PGP]libafterimage-1.20-7-x86_64.pkg.tar.zst.sig2023-10-07 02:14 119
[PGP]libaio-0.3.113-3-x86_64.pkg.tar.zst.sig2024-02-21 01:13 119
[PGP]libao-1.2.2-6-x86_64.pkg.tar.zst.sig2023-03-19 01:13 119
[PGP]libarchive-3.7.2-1-x86_64.pkg.tar.zst.sig2023-09-13 02:13 119
[PGP]libassuan-2.5.6-1-x86_64.pkg.tar.zst.sig2023-06-30 02:13 119
[PGP]libblockdev-3.0.4-3-x86_64.pkg.tar.zst.sig2024-02-23 01:17 119
[PGP]libblockdev-3.1.0-1-x86_64.pkg.tar.zst.sig2024-02-24 01:15 119
[PGP]libblockdev-btrfs-3.0.4-3-x86_64.pkg.tar.zst.sig2024-02-23 01:17 119
[PGP]libblockdev-btrfs-3.1.0-1-x86_64.pkg.tar.zst.sig2024-02-24 01:15 119
[PGP]libblockdev-crypto-3.0.4-3-x86_64.pkg.tar.zst.sig2024-02-23 01:17 119
[PGP]libblockdev-crypto-3.1.0-1-x86_64.pkg.tar.zst.sig2024-02-24 01:15 119
[PGP]libblockdev-dm-3.0.4-3-x86_64.pkg.tar.zst.sig2024-02-23 01:17 119
[PGP]libblockdev-dm-3.1.0-1-x86_64.pkg.tar.zst.sig2024-02-24 01:15 119
[PGP]libblockdev-fs-3.0.4-3-x86_64.pkg.tar.zst.sig2024-02-23 01:17 119
[PGP]libblockdev-fs-3.1.0-1-x86_64.pkg.tar.zst.sig2024-02-24 01:15 119
[PGP]libblockdev-loop-3.0.4-3-x86_64.pkg.tar.zst.sig2024-02-23 01:17 119
[PGP]libblockdev-loop-3.1.0-1-x86_64.pkg.tar.zst.sig2024-02-24 01:15 119
[PGP]libblockdev-lvm-3.0.4-3-x86_64.pkg.tar.zst.sig2024-02-23 01:17 119
[PGP]libblockdev-lvm-3.1.0-1-x86_64.pkg.tar.zst.sig2024-02-24 01:15 119
[PGP]libblockdev-lvm-dbus-3.0.4-3-x86_64.pkg.tar.zst.sig2024-02-23 01:17 119
[PGP]libblockdev-lvm-dbus-3.1.0-1-x86_64.pkg.tar.zst.sig2024-02-24 01:15 119
[PGP]libblockdev-mdraid-3.0.4-3-x86_64.pkg.tar.zst.sig2024-02-23 01:17 119
[PGP]libblockdev-mdraid-3.1.0-1-x86_64.pkg.tar.zst.sig2024-02-24 01:15 119
[PGP]libblockdev-mpath-3.0.4-3-x86_64.pkg.tar.zst.sig2024-02-23 01:17 119
[PGP]libblockdev-mpath-3.1.0-1-x86_64.pkg.tar.zst.sig2024-02-24 01:15 119
[PGP]libblockdev-nvdimm-3.0.4-3-x86_64.pkg.tar.zst.sig2024-02-23 01:17 119
[PGP]libblockdev-nvme-3.0.4-3-x86_64.pkg.tar.zst.sig2024-02-23 01:17 119
[PGP]libblockdev-nvme-3.1.0-1-x86_64.pkg.tar.zst.sig2024-02-24 01:15 119
[PGP]libblockdev-part-3.0.4-3-x86_64.pkg.tar.zst.sig2024-02-23 01:17 119
[PGP]libblockdev-part-3.1.0-1-x86_64.pkg.tar.zst.sig2024-02-24 01:15 119
[PGP]libblockdev-swap-3.0.4-3-x86_64.pkg.tar.zst.sig2024-02-23 01:17 119
[PGP]libblockdev-swap-3.1.0-1-x86_64.pkg.tar.zst.sig2024-02-24 01:15 119
[PGP]libblockdev-tools-3.0.4-3-x86_64.pkg.tar.zst.sig2024-02-23 01:17 119
[PGP]libblockdev-tools-3.1.0-1-x86_64.pkg.tar.zst.sig2024-02-24 01:15 119
[PGP]libblockdev-utils-3.0.4-3-x86_64.pkg.tar.zst.sig2024-02-23 01:17 119
[PGP]libblockdev-utils-3.1.0-1-x86_64.pkg.tar.zst.sig2024-02-24 01:15 119
[PGP]libbobcat-6.02.02-1-x86_64.pkg.tar.zst.sig2023-05-24 03:03 119
[PGP]libbsd-0.11.8-1-x86_64.pkg.tar.zst.sig2024-01-09 22:51 119
[PGP]libcacard-2.7.0-3-x86_64.pkg.tar.zst.sig2023-09-04 02:14 119
[PGP]libcalfbox-lss-1.2.0-1-x86_64.pkg.tar.zst.sig2023-05-24 03:03 119
[PGP]libcamera-0.2.0-1-x86_64.pkg.tar.zst.sig2024-01-25 01:15 119
[PGP]libcamera-docs-0.2.0-1-x86_64.pkg.tar.zst.sig2024-01-25 01:15 119
[PGP]libcamera-ipa-0.2.0-1-x86_64.pkg.tar.zst.sig2024-01-25 01:15 119
[PGP]libcamera-tools-0.2.0-1-x86_64.pkg.tar.zst.sig2024-01-25 01:15 119
[PGP]libcap-2.69-3-x86_64.pkg.tar.zst.sig2023-11-26 01:14 119
[PGP]libcap-ng-0.8.4-1-x86_64.pkg.tar.zst.sig2023-12-24 01:14 119
[PGP]libchewing-0.6.0-1-x86_64.pkg.tar.zst.sig2024-01-28 01:14 119
[PGP]libck-0.7.1-1-x86_64.pkg.tar.zst.sig2023-05-24 03:03 119
[PGP]libclastfm-0.5-8-x86_64.pkg.tar.zst.sig2023-10-07 02:14 119
[PGP]libcolord-1.4.7-2-x86_64.pkg.tar.zst.sig2024-02-08 01:16 119
[PGP]libconfig-1.7.3-2-x86_64.pkg.tar.zst.sig2023-05-24 03:03 119
[PGP]libcrossguid-1:0.2.2-4-x86_64.pkg.tar.zst.sig2023-06-04 02:14 119
[PGP]libcue-2.3.0-1-x86_64.pkg.tar.zst.sig2023-10-12 02:13 119
[PGP]libcurl-compat-8.6.0-3-x86_64.pkg.tar.zst.sig2024-02-07 01:13 119
[PGP]libcurl-gnutls-8.6.0-3-x86_64.pkg.tar.zst.sig2024-02-07 01:13 119
[PGP]libdex-0.4.3-1-x86_64.pkg.tar.zst.sig2024-01-13 01:14 119
[PGP]libdex-0.5.0-1-x86_64.pkg.tar.zst.sig2024-02-17 01:17 119
[PGP]libdex-docs-0.4.3-1-x86_64.pkg.tar.zst.sig2024-01-13 01:14 119
[PGP]libdex-docs-0.5.0-1-x86_64.pkg.tar.zst.sig2024-02-17 01:17 119
[PGP]libdiscid-0.6.4-2-x86_64.pkg.tar.zst.sig2023-05-24 03:03 119
[PGP]libdnet-1.17.0-1-x86_64.pkg.tar.zst.sig2023-10-16 19:01 119
[PGP]libdwarf-1:0.9.1-1-x86_64.pkg.tar.zst.sig2024-02-19 01:15 119
[PGP]libedataserverui4-3.50.4-1-x86_64.pkg.tar.zst.sig2024-02-10 01:15 119
[PGP]libedataserverui4-3.51.2-1-x86_64.pkg.tar.zst.sig2024-02-14 01:19 119
[PGP]libei-1.2.1-1-x86_64.pkg.tar.zst.sig2024-02-07 01:14 119
[PGP]libemf-1.0.13-2-x86_64.pkg.tar.zst.sig2023-05-24 03:03 119
[PGP]libev-4.33-2-x86_64.pkg.tar.zst.sig2023-05-24 03:03 119
[PGP]libexif-0.6.24-2-x86_64.pkg.tar.zst.sig2023-05-24 03:03 119
[PGP]libffado-2.4.8-1-x86_64.pkg.tar.zst.sig2024-01-07 01:13 119
[PGP]libffi-3.4.6-1-x86_64.pkg.tar.zst.sig2024-02-19 01:15 119
[PGP]libfixposix-0.5.1-1-x86_64.pkg.tar.zst.sig2023-05-24 03:03 119
[PGP]libfprint-1.94.7-1-x86_64.pkg.tar.zst.sig2024-02-22 01:14 119
[PGP]libgedit-amtk-5.8.0-2-x86_64.pkg.tar.zst.sig2023-12-16 01:14 119
[PGP]libgedit-gtksourceview-299.0.5-1-x86_64.pkg.tar.zst.sig2023-12-09 19:27 119
[PGP]libgig-4.4.1-1-x86_64.pkg.tar.zst.sig2024-02-21 01:14 119
[PGP]libgirepository-1.79.1-1-x86_64.pkg.tar.zst.sig2024-01-11 01:16 119
[PGP]libgit2-1:1.7.2-1-x86_64.pkg.tar.zst.sig2024-02-08 01:16 119
[PGP]libgnome-games-support-1.8.2-3-x86_64.pkg.tar.zst.sig2023-12-16 01:14 119
[PGP]libgnome-games-support-2-2.0.0-2-x86_64.pkg.tar.zst.sig2023-12-16 01:14 119
[PGP]libgnome-keyring-1:3.12.0+r14+g23438cc-1-x86_64.pkg.tar.zst.sig2024-02-13 01:14 119
[PGP]libgoa-3.49.2-1-x86_64.pkg.tar.zst.sig2024-02-20 01:14 119
[PGP]libgsf-1.14.52-1-x86_64.pkg.tar.zst.sig2024-02-06 01:14 119
[PGP]libgssglue-0.9-1-x86_64.pkg.tar.zst.sig2024-02-02 01:14 119
[PGP]libgtop-2.41.3-1-x86_64.pkg.tar.zst.sig2024-02-18 01:14 119
[PGP]libguestfs-1.52.0-1-x86_64.pkg.tar.zst.sig2024-01-17 01:20 119
[PGP]libhandy-1.8.3-1-x86_64.pkg.tar.zst.sig2024-02-10 01:15 119
[PGP]libhandy-docs-1.8.3-1-x86_64.pkg.tar.zst.sig2024-02-10 01:15 119
[PGP]libheif-1.17.6-3-x86_64.pkg.tar.zst.sig2024-01-26 01:14 119
[PGP]libibus-1.5.29-3-x86_64.pkg.tar.zst.sig2024-01-21 01:14 119
[PGP]libiconv-1.17-1-x86_64.pkg.tar.zst.sig2023-05-24 03:04 119
[PGP]libid3tag-0.15.1b-12-x86_64.pkg.tar.zst.sig2023-03-20 01:13 119
[PGP]libidn-1.42-1-x86_64.pkg.tar.zst.sig2024-01-15 01:20 119
[PGP]libiio-0.25-2-x86_64.pkg.tar.zst.sig2023-09-25 02:15 119
[PGP]libilbc-3.0.4-2-x86_64.pkg.tar.zst.sig2023-05-24 03:04 119
[PGP]libimagequant-4.2.2-2-x86_64.pkg.tar.zst.sig2023-11-11 01:14 119
[PGP]libimagequant-4.3.0-1-x86_64.pkg.tar.zst.sig2024-02-26 01:14 119
[PGP]libinstpatch-1.1.6-2-x86_64.pkg.tar.zst.sig2023-03-20 01:13 119
[PGP]libiodbc-3.52.16-1-x86_64.pkg.tar.zst.sig2023-05-24 03:04 119
[PGP]libjpeg-turbo-3.0.2-2-x86_64.pkg.tar.zst.sig2024-01-26 01:15 119
[PGP]libjxl-0.9.2-1-x86_64.pkg.tar.zst.sig2024-02-09 01:14 119
[PGP]libjxl-0.10.0-1-x86_64.pkg.tar.zst.sig2024-02-23 01:19 119
[PGP]libjxl-doc-0.9.2-1-x86_64.pkg.tar.zst.sig2024-02-09 01:14 119
[PGP]libjxl-doc-0.10.0-1-x86_64.pkg.tar.zst.sig2024-02-23 01:19 119
[PGP]libkate-0.4.1-9-x86_64.pkg.tar.zst.sig2023-03-20 01:13 119
[PGP]libkate-docs-0.4.1-9-x86_64.pkg.tar.zst.sig2023-03-20 01:13 119
[PGP]libkscreen5-5.27.10-2-x86_64.pkg.tar.zst.sig2024-02-24 01:16 119
[PGP]liblightdm-qt5-1:1.32.0-6-x86_64.pkg.tar.zst.sig2024-02-12 01:14 119
[PGP]libliquidsfz-0.3.2-1-x86_64.pkg.tar.zst.sig2023-05-24 03:04 119
[PGP]liblo-1:0.32-1-x86_64.pkg.tar.zst.sig2024-02-18 01:14 119
[PGP]liblo-docs-1:0.32-1-x86_64.pkg.tar.zst.sig2024-02-18 01:14 119
[PGP]liblphobos-3:1.36.0-1-x86_64.pkg.tar.zst.sig2024-01-07 17:00 119
[PGP]liblscp-0.9.12-1-x86_64.pkg.tar.zst.sig2024-01-24 01:14 119
[PGP]liblsp-r3d-glx-lib-1.2.14-1-x86_64.pkg.tar.zst.sig2023-12-25 01:26 119
[PGP]libltc-1.3.2-1-x86_64.pkg.tar.zst.sig2023-05-24 03:04 119
[PGP]liblxqt-1.4.0-1-x86_64.pkg.tar.zst.sig2023-11-07 01:15 119
[PGP]liblzf-3.6-4-x86_64.pkg.tar.zst.sig2023-05-24 03:04 119
[PGP]libmad-0.15.1b-10-x86_64.pkg.tar.zst.sig2023-02-18 01:13 119
[PGP]libmalcontent-0.11.1-4-x86_64.pkg.tar.zst.sig2024-01-18 01:16 119
[PGP]libmanette-0.2.7-1-x86_64.pkg.tar.zst.sig2024-02-10 01:15 119
[PGP]libmaxminddb-1.9.1-1-x86_64.pkg.tar.zst.sig2024-01-14 01:14 119
[PGP]libmd-1.1.0-1-x86_64.pkg.tar.zst.sig2023-06-17 15:36 119
[PGP]libmediainfo-24.01-1-x86_64.pkg.tar.zst.sig2024-02-03 01:17 119
[PGP]libmfx-23.2.2-2-x86_64.pkg.tar.zst.sig2023-08-05 02:14 119
[PGP]libmicrohttpd-1.0.0-1-x86_64.pkg.tar.zst.sig2024-02-02 01:14 119
[PGP]libmicrohttpd-1.0.1-1-x86_64.pkg.tar.zst.sig2024-02-24 01:14 119
[PGP]libmilter-8.17.2-1-x86_64.pkg.tar.zst.sig2023-06-08 02:13 119
[PGP]libmirage-3.2.7-1-x86_64.pkg.tar.zst.sig2023-12-02 01:15 119
[PGP]libmodsecurity-1:3.0.12-1-x86_64.pkg.tar.zst.sig2024-02-01 01:17 119
[PGP]libmpdclient-2.22-1-x86_64.pkg.tar.zst.sig2023-12-23 01:14 119
[PGP]libmspack-1:0.11alpha-1-x86_64.pkg.tar.zst.sig2023-02-07 01:13 119
[PGP]libmusicxml-3.22-2-x86_64.pkg.tar.zst.sig2023-05-24 03:04 119
[PGP]libmysofa-1.3.2-1-x86_64.pkg.tar.zst.sig2023-10-18 02:15 119
[PGP]libnautilus-extension-45.2.1-1-x86_64.pkg.tar.zst.sig2023-12-07 16:44 119
[PGP]libnautilus-extension-46beta-1-x86_64.pkg.tar.zst.sig2024-02-15 01:15 119
[PGP]libnautilus-extension-docs-45.2.1-1-x86_64.pkg.tar.zst.sig2023-12-07 16:44 119
[PGP]libnautilus-extension-docs-46beta-1-x86_64.pkg.tar.zst.sig2024-02-15 01:15 119
[PGP]libnet-2:1.3-1-x86_64.pkg.tar.zst.sig2023-11-05 01:15 119
[PGP]libnfs-5.0.3-1-x86_64.pkg.tar.zst.sig2024-02-12 21:11 119
[PGP]libnftnl-1.2.6-1-x86_64.pkg.tar.zst.sig2023-08-14 02:13 119
[PGP]libnghttp2-1.59.0-2-x86_64.pkg.tar.zst.sig2024-02-01 01:14 119
[PGP]libnghttp3-1.2.0-1-x86_64.pkg.tar.zst.sig2024-02-17 16:20 119
[PGP]libnitrokey-3.8-2-x86_64.pkg.tar.zst.sig2024-02-20 01:13 119
[PGP]libnl-3.9.0-1-x86_64.pkg.tar.zst.sig2023-12-05 01:14 119
[PGP]libnm-1.46.0-1-x86_64.pkg.tar.zst.sig2024-02-24 01:14 119
[PGP]libnm-1.46.0-2-x86_64.pkg.tar.zst.sig2024-02-25 01:13 119
[PGP]libnsl-2.0.1-1-x86_64.pkg.tar.zst.sig2023-10-16 19:00 119
[PGP]libopenmpt-0.7.3-1-x86_64.pkg.tar.zst.sig2023-09-11 02:14 119
[PGP]libopenshot-0.3.2-8-x86_64.pkg.tar.zst.sig2024-02-20 01:13 119
[PGP]libopenshot-audio-0.3.2-1-x86_64.pkg.tar.zst.sig2023-05-24 03:04 119
[PGP]libopenshot-audio-docs-0.3.2-1-x86_64.pkg.tar.zst.sig2023-05-24 03:04 119
[PGP]libopensmtpd-0.7-2-x86_64.pkg.tar.zst.sig2023-06-23 02:18 119
[PGP]libopusenc-0.2.1-4-x86_64.pkg.tar.zst.sig2023-05-30 02:13 119
[PGP]libpackagekit-glib-1.2.8-2-x86_64.pkg.tar.zst.sig2024-02-12 01:14 119
[PGP]libpanel-1.4.1-1-x86_64.pkg.tar.zst.sig2024-01-09 22:51 119
[PGP]libpanel-1.5.0-1-x86_64.pkg.tar.zst.sig2024-02-19 01:17 119
[PGP]libpanel-docs-1.4.1-1-x86_64.pkg.tar.zst.sig2024-01-09 22:51 119
[PGP]libpanel-docs-1.5.0-1-x86_64.pkg.tar.zst.sig2024-02-19 01:17 119
[PGP]libpcap-1.10.4-1-x86_64.pkg.tar.zst.sig2023-04-18 02:13 119
[PGP]libpeas-2-2.0.1-1-x86_64.pkg.tar.zst.sig2024-01-10 01:14 119
[PGP]libpeas-2-docs-2.0.1-1-x86_64.pkg.tar.zst.sig2024-01-10 01:14 119
[PGP]libperconaserverclient-8.1.0_1-2-x86_64.pkg.tar.zst.sig2023-12-13 18:50 119
[PGP]libpg_query-15.4.2.3-1-x86_64.pkg.tar.zst.sig2023-09-28 02:14 119
[PGP]libphobos-1:2.107.0-1-x86_64.pkg.tar.zst.sig2024-02-07 01:14 119
[PGP]libphonenumber-1:8.13.31-1-x86_64.pkg.tar.zst.sig2024-02-25 01:13 119
[PGP]libpipewire-1:1.0.3-1-x86_64.pkg.tar.zst.sig2024-02-03 01:17 119
[PGP]libpng-1.6.43-1-x86_64.pkg.tar.zst.sig2024-02-24 01:15 119
[PGP]libprocps-3.3.17-3-x86_64.pkg.tar.zst.sig2023-07-15 02:14 119
[PGP]libproxy-0.5.4-1-x86_64.pkg.tar.zst.sig2024-02-10 01:15 119
[PGP]libproxy-docs-0.5.4-1-x86_64.pkg.tar.zst.sig2024-02-10 01:15 119
[PGP]libpulse-17.0-3-x86_64.pkg.tar.zst.sig2024-01-18 01:15 119
[PGP]libqb-2.0.3-2-x86_64.pkg.tar.zst.sig2023-10-07 02:14 119
[PGP]librecad-2.2.0.2-1-x86_64.pkg.tar.zst.sig2023-08-01 02:13 119
[PGP]libressl-3.8.2-1-x86_64.pkg.tar.zst.sig2023-11-04 01:13 119
[PGP]libretls-3.8.1-1-x86_64.pkg.tar.zst.sig2023-10-16 19:01 119
[PGP]librime-1:1.10.0-3-x86_64.pkg.tar.zst.sig2024-02-21 01:15 119
[PGP]librist-0.2.10-2-x86_64.pkg.tar.zst.sig2024-01-20 01:27 119
[PGP]librsvg-2:2.57.1-1-x86_64.pkg.tar.zst.sig2023-12-16 01:14 119
[PGP]librsvg-2:2.57.91-1-x86_64.pkg.tar.zst.sig2024-02-16 01:16 119
[PGP]librsvg-docs-2:2.57.1-1-x86_64.pkg.tar.zst.sig2023-12-16 01:14 119
[PGP]librsvg-docs-2:2.57.91-1-x86_64.pkg.tar.zst.sig2024-02-16 01:16 119
[PGP]libsamplerate-0.2.2-2-x86_64.pkg.tar.zst.sig2023-03-20 01:13 119
[PGP]libsbsms-2.3.0-3-x86_64.pkg.tar.zst.sig2023-05-24 03:04 119
[PGP]libsecret-0.21.4-1-x86_64.pkg.tar.zst.sig2024-02-24 01:14 119
[PGP]libsecret-docs-0.21.4-1-x86_64.pkg.tar.zst.sig2024-02-24 01:14 119
[PGP]libshumate-1.1.3-1-x86_64.pkg.tar.zst.sig2024-02-11 01:14 119
[PGP]libshumate-1.2beta-1-x86_64.pkg.tar.zst.sig2024-02-15 01:15 119
[PGP]libshumate-docs-1.1.3-1-x86_64.pkg.tar.zst.sig2024-02-11 01:14 119
[PGP]libshumate-docs-1.2beta-1-x86_64.pkg.tar.zst.sig2024-02-15 01:15 119
[PGP]libsidplayfp-2.6.0-1-x86_64.pkg.tar.zst.sig2024-01-06 01:14 119
[PGP]libsndfile-1.2.2-2-x86_64.pkg.tar.zst.sig2023-11-08 01:15 119
[PGP]libspecbleach-0.1.6-2-x86_64.pkg.tar.zst.sig2023-05-24 03:04 119
[PGP]libspectmorph-0.6.1-1-x86_64.pkg.tar.zst.sig2023-11-08 01:15 119
[PGP]libspelling-0.2.0-2-x86_64.pkg.tar.zst.sig2023-12-13 18:50 119
[PGP]libspelling-docs-0.2.0-2-x86_64.pkg.tar.zst.sig2023-12-13 18:50 119
[PGP]libspf2-1.2.11-2-x86_64.pkg.tar.zst.sig2023-10-20 02:13 119
[PGP]libsvm-3.32-1-x86_64.pkg.tar.zst.sig2023-08-05 02:14 119
[PGP]libsysprof-capture-45.2-1-x86_64.pkg.tar.zst.sig2024-02-08 01:16 119
[PGP]libsysprof-capture-46beta-1-x86_64.pkg.tar.zst.sig2024-02-19 01:17 119
[PGP]libsysstat-0.4.6-2-x86_64.pkg.tar.zst.sig2023-05-24 03:04 119
[PGP]libtar-1.2.20-6-x86_64.pkg.tar.zst.sig2021-09-28 02:13 119
[PGP]libtermkey-0.22-2-x86_64.pkg.tar.zst.sig2023-05-24 03:04 119
[PGP]libtiff-4.6.0-2-x86_64.pkg.tar.zst.sig2023-11-29 01:17 119
[PGP]libtraceevent-1:1.8.2-1-x86_64.pkg.tar.zst.sig2024-01-14 01:14 119
[PGP]libtraceevent-docs-1:1.8.2-1-x86_64.pkg.tar.zst.sig2024-01-14 01:14 119
[PGP]libtracefs-1.8.0-1-x86_64.pkg.tar.zst.sig2024-01-14 01:14 119
[PGP]libtracefs-docs-1.8.0-1-x86_64.pkg.tar.zst.sig2024-01-14 01:14 119
[PGP]libupnp-1.14.18-1-x86_64.pkg.tar.zst.sig2023-08-23 02:13 119
[PGP]liburing-2.5-1-x86_64.pkg.tar.zst.sig2023-11-25 01:15 119
[PGP]libusb-1.0.27-1-x86_64.pkg.tar.zst.sig2024-02-02 01:14 119
[PGP]libuv-1.48.0-1-x86_64.pkg.tar.zst.sig2024-02-08 01:16 119
[PGP]libva-mesa-driver-1:24.0.1-1-x86_64.pkg.tar.zst.sig2024-02-15 01:14 119
[PGP]libva-nvidia-driver-0.0.11-1-x86_64.pkg.tar.zst.sig2023-11-08 01:15 119
[PGP]libvarlink-23-1-x86_64.pkg.tar.zst.sig2023-05-24 03:05 119
[PGP]libvips-8.15.1-3-x86_64.pkg.tar.zst.sig2024-02-25 01:14 119
[PGP]libvips-8.15.1-4-x86_64.pkg.tar.zst.sig2024-02-26 01:14 119
[PGP]libvips-8.15.1-5-x86_64.pkg.tar.zst.sig2024-02-26 01:15 119
[PGP]libvirt-1:10.0.0-3-x86_64.pkg.tar.zst.sig2024-02-12 01:14 119
[PGP]libvirt-dbus-1.4.1-2-x86_64.pkg.tar.zst.sig2023-05-24 03:05 119
[PGP]libvirt-dbus-1.4.1-3-x86_64.pkg.tar.zst.sig2024-02-12 01:14 119
[PGP]libvirt-glib-4.0.0-2-x86_64.pkg.tar.zst.sig2023-05-24 03:05 119
[PGP]libvirt-storage-gluster-1:10.0.0-3-x86_64.pkg.tar.zst.sig2024-02-12 01:14 119
[PGP]libvirt-storage-iscsi-direct-1:10.0.0-3-x86_64.pkg.tar.zst.sig2024-02-12 01:14 119
[PGP]libvpl-2.10.2-1-x86_64.pkg.tar.zst.sig2024-02-22 01:14 119
[PGP]libwireplumber-0.4.14-1-x86_64.pkg.tar.zst.sig2023-03-10 01:14 119
[PGP]libwireplumber-0.4.17-1-x86_64.pkg.tar.zst.sig2023-12-05 01:21 119
[PGP]libwpe-1.14.2-1-x86_64.pkg.tar.zst.sig2024-01-27 01:16 119
[PGP]libxcrypt-4.4.36-1-x86_64.pkg.tar.zst.sig2023-07-07 02:13 119
[PGP]libxcrypt-compat-4.4.36-1-x86_64.pkg.tar.zst.sig2023-07-07 02:13 119
[PGP]libxdg-basedir-1.2.3-2-x86_64.pkg.tar.zst.sig2023-11-04 01:13 119
[PGP]libxml++-3.2.5-1-x86_64.pkg.tar.zst.sig2024-01-12 01:14 119
[PGP]libxml++-5.0-5.2.0-1-x86_64.pkg.tar.zst.sig2024-01-12 01:14 119
[PGP]libxml++-5.0-docs-5.2.0-1-x86_64.pkg.tar.zst.sig2024-01-12 01:14 119
[PGP]libxml++-docs-3.2.5-1-x86_64.pkg.tar.zst.sig2024-01-12 01:14 119
[PGP]libxml2-2.12.5-1-x86_64.pkg.tar.zst.sig2024-02-05 01:14 119
[PGP]libxml2-docs-2.12.5-1-x86_64.pkg.tar.zst.sig2024-02-05 01:14 119
[PGP]libxslt-1.1.39-1-x86_64.pkg.tar.zst.sig2023-11-20 01:15 119
[PGP]libxslt-docs-1.1.39-1-x86_64.pkg.tar.zst.sig2023-11-20 01:15 119
[PGP]libzen-0.4.41-1-x86_64.pkg.tar.zst.sig2023-05-24 03:05 119
[PGP]lightdm-1:1.32.0-6-x86_64.pkg.tar.zst.sig2024-02-12 01:14 119
[PGP]lighttpd-1.4.73-1-x86_64.pkg.tar.zst.sig2023-11-02 01:14 119
[PGP]lilv-0.24.24-1-x86_64.pkg.tar.zst.sig2024-01-25 01:14 119
[PGP]lilv-docs-0.24.24-1-x86_64.pkg.tar.zst.sig2024-01-25 01:14 119
[PGP]links-2.29-1-x86_64.pkg.tar.zst.sig2023-03-23 01:13 119
[PGP]liquidsfz-0.3.2-1-x86_64.pkg.tar.zst.sig2023-05-24 03:05 119
[PGP]liquidsfz-lv2-0.3.2-1-x86_64.pkg.tar.zst.sig2023-05-24 03:05 119
[PGP]liquidsfz-standalone-0.3.2-1-x86_64.pkg.tar.zst.sig2023-05-24 03:05 119
[PGP]livecd-sounds-1.0-2-any.pkg.tar.zst.sig2023-05-24 03:05 119
[PGP]lldpd-1.0.18-1-x86_64.pkg.tar.zst.sig2024-01-15 01:20 119
[PGP]lmms-1.2.2-21-x86_64.pkg.tar.zst.sig2024-02-02 01:16 119
[PGP]logrotate-3.21.0-2-x86_64.pkg.tar.zst.sig2022-12-17 20:48 119
[PGP]loupe-45.3-1-x86_64.pkg.tar.zst.sig2023-12-16 01:14 119
[PGP]loupe-46beta1-1-x86_64.pkg.tar.zst.sig2024-02-20 01:14 119
[PGP]lout-3.42.2-1-x86_64.pkg.tar.zst.sig2023-05-24 03:05 119
[PGP]ls++-1:0.36-8-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]lsp-plugins-1.2.14-1-x86_64.pkg.tar.zst.sig2023-12-25 01:26 119
[PGP]lsp-plugins-clap-1.2.14-1-x86_64.pkg.tar.zst.sig2023-12-25 01:26 119
[PGP]lsp-plugins-docs-1.2.14-1-x86_64.pkg.tar.zst.sig2023-12-25 01:26 119
[PGP]lsp-plugins-ladspa-1.2.14-1-x86_64.pkg.tar.zst.sig2023-12-25 01:26 119
[PGP]lsp-plugins-lv2-1.2.14-1-x86_64.pkg.tar.zst.sig2023-12-25 01:26 119
[PGP]lsp-plugins-standalone-1.2.14-1-x86_64.pkg.tar.zst.sig2023-12-25 01:26 119
[PGP]lsp-plugins-vst-1.2.14-1-x86_64.pkg.tar.zst.sig2023-12-25 01:26 119
[PGP]lua-lpeg-1.1.0-1-x86_64.pkg.tar.zst.sig2023-07-05 02:15 119
[PGP]lua51-lpeg-1.1.0-1-x86_64.pkg.tar.zst.sig2023-07-05 02:15 119
[PGP]lua52-lpeg-1.1.0-1-x86_64.pkg.tar.zst.sig2023-07-05 02:15 119
[PGP]lua53-lpeg-1.1.0-1-x86_64.pkg.tar.zst.sig2023-07-05 02:15 119
[PGP]luksmeta-9-6-x86_64.pkg.tar.zst.sig2023-10-07 02:14 119
[PGP]luppp-1.2.1-4-x86_64.pkg.tar.zst.sig2023-05-24 03:06 119
[PGP]lv2-docs-1.18.10-1-x86_64.pkg.tar.zst.sig2023-05-24 03:06 119
[PGP]lv2-example-plugins-1.18.10-1-x86_64.pkg.tar.zst.sig2023-05-24 03:06 119
[PGP]lv2file-0.95-2-x86_64.pkg.tar.zst.sig2023-05-24 03:06 119
[PGP]lv2lint-0.16.2-2-x86_64.pkg.tar.zst.sig2023-05-24 03:06 119
[PGP]lvm2-2.03.23-1-x86_64.pkg.tar.zst.sig2024-01-11 01:13 119
[PGP]lvtk-1.2.0-4-x86_64.pkg.tar.zst.sig2023-05-24 03:06 119
[PGP]lximage-qt-1.4.0-1-x86_64.pkg.tar.zst.sig2023-11-07 01:15 119
[PGP]lxqt-about-1.4.0-1-x86_64.pkg.tar.zst.sig2023-11-07 01:15 119
[PGP]lxqt-admin-1.4.0-1-x86_64.pkg.tar.zst.sig2023-11-07 01:15 119
[PGP]lxqt-archiver-0.9.1-1-x86_64.pkg.tar.zst.sig2024-02-24 01:14 119
[PGP]lxqt-build-tools-0.13.0-1-any.pkg.tar.zst.sig2023-05-24 03:06 119
[PGP]lxqt-config-1.4.0-1-x86_64.pkg.tar.zst.sig2023-11-07 01:15 119
[PGP]lxqt-config-1.4.0-2-x86_64.pkg.tar.zst.sig2024-02-24 01:16 119
[PGP]lxqt-globalkeys-1.4.0-1-x86_64.pkg.tar.zst.sig2023-11-07 01:15 119
[PGP]lxqt-menu-data-1.4.1-1-any.pkg.tar.zst.sig2023-11-11 01:14 119
[PGP]lxqt-notificationd-1.4.0-1-x86_64.pkg.tar.zst.sig2023-11-07 01:15 119
[PGP]lxqt-openssh-askpass-1.4.0-1-x86_64.pkg.tar.zst.sig2023-11-07 01:15 119
[PGP]lxqt-panel-1.4.0-1-x86_64.pkg.tar.zst.sig2023-11-07 01:15 119
[PGP]lxqt-policykit-1.4.0-1-x86_64.pkg.tar.zst.sig2023-11-07 01:15 119
[PGP]lxqt-powermanagement-1.4.0-1-x86_64.pkg.tar.zst.sig2023-11-07 01:15 119
[PGP]lxqt-qtplugin-1.4.0-1-x86_64.pkg.tar.zst.sig2023-11-07 01:15 119
[PGP]lxqt-runner-1.4.0-1-x86_64.pkg.tar.zst.sig2023-11-07 01:15 119
[PGP]lxqt-session-1.4.0-1-x86_64.pkg.tar.zst.sig2023-11-07 01:15 119
[PGP]lxqt-sudo-1.4.0-1-x86_64.pkg.tar.zst.sig2023-11-07 01:15 119
[PGP]lxqt-themes-1.3.0-1-any.pkg.tar.zst.sig2023-05-24 03:06 119
[PGP]lynis-3.0.9-1-any.pkg.tar.zst.sig2023-08-06 02:17 119
[PGP]lynx-2.8.9-7-x86_64.pkg.tar.zst.sig2023-09-05 02:14 119
[PGP]m4-1.4.19-3-x86_64.pkg.tar.zst.sig2023-03-18 01:14 119
[PGP]magpie-wm-0.9.3-1-x86_64.pkg.tar.zst.sig2023-08-23 02:13 119
[PGP]mailman-web-0.0.8-1-any.pkg.tar.zst.sig2023-11-01 01:14 119
[PGP]mailman3-3.3.9-1-any.pkg.tar.zst.sig2023-11-01 01:14 119
[PGP]mailman3-hyperkitty-1.2.1-3-any.pkg.tar.zst.sig2023-07-27 02:15 119
[PGP]make-4.4.1-2-x86_64.pkg.tar.zst.sig2023-03-18 01:14 119
[PGP]mako-1.8.0-1-x86_64.pkg.tar.zst.sig2023-06-04 02:14 119
[PGP]malcontent-0.11.1-4-x86_64.pkg.tar.zst.sig2024-01-18 01:17 119
[PGP]mandoc-1.14.6-2-x86_64.pkg.tar.zst.sig2023-05-24 03:06 119
[PGP]mangohud-0.7.1-1-x86_64.pkg.tar.zst.sig2024-02-09 01:15 119
[PGP]mariadb-11.3.2-1-x86_64.pkg.tar.zst.sig2024-02-17 16:20 119
[PGP]mariadb-clients-11.3.2-1-x86_64.pkg.tar.zst.sig2024-02-17 16:20 119
[PGP]mariadb-libs-11.3.2-1-x86_64.pkg.tar.zst.sig2024-02-17 16:20 119
[PGP]mariadb-lts-11.2.3-1-x86_64.pkg.tar.zst.sig2024-02-22 01:14 119
[PGP]mariadb-lts-clients-11.2.3-1-x86_64.pkg.tar.zst.sig2024-02-22 01:14 119
[PGP]mariadb-lts-libs-11.2.3-1-x86_64.pkg.tar.zst.sig2024-02-22 01:14 119
[PGP]marsyas-0.5.0-10-x86_64.pkg.tar.zst.sig2023-05-24 03:06 119
[PGP]master_me-1.2.0-1-x86_64.pkg.tar.zst.sig2023-05-24 03:06 119
[PGP]master_me-clap-1.2.0-1-x86_64.pkg.tar.zst.sig2023-05-24 03:06 119
[PGP]master_me-ladspa-1.2.0-1-x86_64.pkg.tar.zst.sig2023-05-24 03:06 119
[PGP]master_me-lv2-1.2.0-1-x86_64.pkg.tar.zst.sig2023-05-24 03:06 119
[PGP]master_me-standalone-1.2.0-1-x86_64.pkg.tar.zst.sig2023-05-24 03:06 119
[PGP]master_me-vst-1.2.0-1-x86_64.pkg.tar.zst.sig2023-05-24 03:06 119
[PGP]master_me-vst3-1.2.0-1-x86_64.pkg.tar.zst.sig2023-05-24 03:06 119
[PGP]mate-terminal-1.27.1-1-x86_64.pkg.tar.zst.sig2023-08-30 02:15 119
[PGP]mate-themes-3.22.24-1-any.pkg.tar.zst.sig2023-08-30 02:15 119
[PGP]matrix-appservice-irc-1.0.1-2-x86_64.pkg.tar.zst.sig2023-09-10 02:15 119
[PGP]maturin-1.4.0-1-x86_64.pkg.tar.zst.sig2023-12-05 01:21 119
[PGP]maxima-5.47.0-9-x86_64.pkg.tar.zst.sig2024-01-24 01:14 119
[PGP]maxima-ecl-5.47.0-9-x86_64.pkg.tar.zst.sig2024-01-24 01:14 119
[PGP]maxima-fas-5.47.0-9-x86_64.pkg.tar.zst.sig2024-01-24 01:14 119
[PGP]maxima-sbcl-5.47.0-9-x86_64.pkg.tar.zst.sig2024-01-24 01:14 119
[PGP]mbuffer-20240107-1-x86_64.pkg.tar.zst.sig2024-01-14 01:14 119
[PGP]mda.lv2-1.2.10-1-x86_64.pkg.tar.zst.sig2023-05-24 03:07 119
[PGP]mdbook-linkcheck-0.7.7-1-x86_64.pkg.tar.zst.sig2023-05-24 03:07 119
[PGP]mdk4-4.2-1-x86_64.pkg.tar.zst.sig2023-05-24 03:07 119
[PGP]mediathekview-14.0.0-1-any.pkg.tar.zst.sig2023-11-12 01:15 119
[PGP]megatools-1.11.1+20230212-2-x86_64.pkg.tar.zst.sig2023-05-24 03:07 119
[PGP]meld-3.22.1-1-any.pkg.tar.zst.sig2024-02-19 01:15 119
[PGP]mellite-3.13.10-1-any.pkg.tar.zst.sig2023-11-15 01:16 119
[PGP]mellite-3.13.11-1-any.pkg.tar.zst.sig2024-01-02 01:14 119
[PGP]memray-1.11.1-2-x86_64.pkg.tar.zst.sig2024-02-04 01:14 119
[PGP]memtester-4.6.0-1-x86_64.pkg.tar.zst.sig2023-05-24 03:08 119
[PGP]mephisto.lv2-0.18.2-3-x86_64.pkg.tar.zst.sig2023-05-24 03:08 119
[PGP]mesa-1:24.0.1-1-x86_64.pkg.tar.zst.sig2024-02-15 01:14 119
[PGP]mesa-amber-21.3.9-6-x86_64.pkg.tar.zst.sig2024-01-02 01:14 119
[PGP]mesa-vdpau-1:24.0.1-1-x86_64.pkg.tar.zst.sig2024-02-15 01:14 119
[PGP]meson-1.3.2-1-any.pkg.tar.zst.sig2024-02-15 01:14 119
[PGP]metalog-20230719-1-x86_64.pkg.tar.zst.sig2023-09-06 02:14 119
[PGP]mg-20230501-1-x86_64.pkg.tar.zst.sig2023-05-24 03:08 119
[PGP]midi_matrix.lv2-0.30.0-3-x86_64.pkg.tar.zst.sig2023-05-24 03:08 119
[PGP]midimsg-lv2-0.0.5-2-x86_64.pkg.tar.zst.sig2023-05-24 03:08 119
[PGP]milkytracker-1.04.00-3-x86_64.pkg.tar.zst.sig2024-02-22 01:15 119
[PGP]miller-6.11.0-1-x86_64.pkg.tar.zst.sig2024-02-01 01:17 119
[PGP]mimalloc-2.1.2-1-x86_64.pkg.tar.zst.sig2023-05-24 03:08 119
[PGP]mimir-2.11.0-1-x86_64.pkg.tar.zst.sig2023-12-29 01:13 119
[PGP]minicom-2.9-1-x86_64.pkg.tar.zst.sig2023-09-26 02:14 119
[PGP]miniflux-2.0.51-1-x86_64.pkg.tar.zst.sig2023-12-29 01:13 119
[PGP]miopen-hip-6.0.0-1-x86_64.pkg.tar.zst.sig2023-12-30 01:15 119
[PGP]mixxx-2.4.0-1-x86_64.pkg.tar.zst.sig2024-02-18 01:14 119
[PGP]mkinitcpio-archiso-69-1-any.pkg.tar.zst.sig2024-02-23 01:16 119
[PGP]mkinitcpio-systemd-tool-38-2-any.pkg.tar.zst.sig2023-10-06 02:17 119
[PGP]mm-common-1.0.6-1-any.pkg.tar.zst.sig2024-01-09 01:14 119
[PGP]mmdblookup-1.9.1-1-x86_64.pkg.tar.zst.sig2024-01-14 01:14 119
[PGP]mod-lv2-extensions-2022.09.28-1-any.pkg.tar.zst.sig2023-05-24 03:09 119
[PGP]mod_passenger-6.0.20-1-x86_64.pkg.tar.zst.sig2024-02-01 01:18 119
[PGP]molecule-plugins-23.5.0-1-any.pkg.tar.zst.sig2023-08-21 02:14 119
[PGP]moony.lv2-0.40.0-2-x86_64.pkg.tar.zst.sig2023-05-24 03:09 119
[PGP]moreutils-0.68-1-x86_64.pkg.tar.zst.sig2023-12-03 01:20 119
[PGP]moreutils-0.69-1-x86_64.pkg.tar.zst.sig2024-02-26 01:15 119
[PGP]mosquitto-2.0.18-1-x86_64.pkg.tar.zst.sig2023-09-24 02:13 119
[PGP]mousepad-0.6.2-1-x86_64.pkg.tar.zst.sig2024-02-06 01:14 119
[PGP]mpc-0.35-1-x86_64.pkg.tar.zst.sig2023-12-23 01:14 119
[PGP]mpd-0.23.15-1-x86_64.pkg.tar.zst.sig2023-12-22 01:14 119
[PGP]mpv-mpris-1.1-1-x86_64.pkg.tar.zst.sig2023-08-31 02:13 119
[PGP]msgpack-c-5.0.0-1-x86_64.pkg.tar.zst.sig2023-05-24 03:09 119
[PGP]msgpack-cxx-5.0.0-1-any.pkg.tar.zst.sig2023-05-24 03:09 119
[PGP]msgraph-0.1.0+r6+g0669359-1-x86_64.pkg.tar.zst.sig2024-02-19 01:17 119
[PGP]msgraph-docs-0.1.0+r6+g0669359-1-x86_64.pkg.tar.zst.sig2024-02-19 01:17 119
[PGP]msmtp-1.8.25-2-x86_64.pkg.tar.zst.sig2023-11-29 01:18 119
[PGP]msmtp-mta-1.8.25-2-x86_64.pkg.tar.zst.sig2023-11-29 01:18 119
[PGP]mtools-1:4.0.43-1-x86_64.pkg.tar.zst.sig2023-03-25 01:13 119
[PGP]mtr-0.95-4-x86_64.pkg.tar.zst.sig2023-09-05 02:14 119
[PGP]mtr-gtk-0.95-4-x86_64.pkg.tar.zst.sig2023-09-05 02:14 119
[PGP]mtxclient-0.9.2-5-x86_64.pkg.tar.zst.sig2024-01-28 01:14 119
[PGP]mujs-1.3.4-1-x86_64.pkg.tar.zst.sig2023-11-23 01:15 119
[PGP]multipath-tools-0.9.7-4-x86_64.pkg.tar.zst.sig2023-11-29 01:18 119
[PGP]multipath-tools-0.9.8-1-x86_64.pkg.tar.zst.sig2024-02-25 01:14 119
[PGP]muse-4.2.1-1-x86_64.pkg.tar.zst.sig2023-11-26 01:15 119
[PGP]mustache-d-0.1.5-14-x86_64.pkg.tar.zst.sig2024-01-07 17:01 119
[PGP]mutt-2.2.12-1-x86_64.pkg.tar.zst.sig2023-09-10 02:15 119
[PGP]mutter-45.4-1-x86_64.pkg.tar.zst.sig2024-02-12 21:11 119
[PGP]mutter-46beta-1-x86_64.pkg.tar.zst.sig2024-02-24 01:18 119
[PGP]mutter-docs-45.4-1-x86_64.pkg.tar.zst.sig2024-02-12 21:11 119
[PGP]mutter-docs-46beta-1-x86_64.pkg.tar.zst.sig2024-02-24 01:18 119
[PGP]mxml-3.3.1-1-x86_64.pkg.tar.zst.sig2023-05-24 03:09 119
[PGP]mxml-docs-3.3.1-1-x86_64.pkg.tar.zst.sig2023-05-24 03:09 119
[PGP]mympd-14.0.3-1-x86_64.pkg.tar.zst.sig2024-02-18 01:14 119
[PGP]mysql-workbench-8.0.34-2-x86_64.pkg.tar.zst.sig2023-10-10 02:14 119
[PGP]mysql-workbench-8.0.36-1-x86_64.pkg.tar.zst.sig2024-01-18 01:15 119
[PGP]mythes-it-2.0.9l-9-any.pkg.tar.zst.sig2023-05-24 03:09 119
[PGP]mytop-11.3.2-1-x86_64.pkg.tar.zst.sig2024-02-17 16:20 119
[PGP]nautilus-45.2.1-1-x86_64.pkg.tar.zst.sig2023-12-07 16:44 119
[PGP]nautilus-46beta-1-x86_64.pkg.tar.zst.sig2024-02-15 01:15 119
[PGP]navidrome-0.51.0-1-x86_64.pkg.tar.zst.sig2024-02-01 01:18 119
[PGP]nawk-20231228-1-x86_64.pkg.tar.zst.sig2024-01-21 01:14 119
[PGP]nbd-3.25-1-x86_64.pkg.tar.zst.sig2023-05-24 03:10 119
[PGP]nbtscan-1.7.2-1-x86_64.pkg.tar.zst.sig2023-05-24 03:10 119
[PGP]ncmpc-0.49-1-x86_64.pkg.tar.zst.sig2023-08-10 02:13 119
[PGP]ncmpcpp-0.9.2-16-x86_64.pkg.tar.zst.sig2024-02-01 01:18 119
[PGP]ncspot-0.13.2-3-x86_64.pkg.tar.zst.sig2023-05-27 02:14 119
[PGP]ncurses-6.4_20230520-1-x86_64.pkg.tar.zst.sig2023-06-04 02:13 119
[PGP]ndisc6-1.0.8-1-x86_64.pkg.tar.zst.sig2024-02-01 01:18 119
[PGP]nebula-1.7.2-1-x86_64.pkg.tar.zst.sig2023-10-29 02:14 119
[PGP]neovim-lsp_signature-0.2.0-3-any.pkg.tar.zst.sig2023-05-24 03:11 119
[PGP]neovim-lspconfig-0.1.7-1-any.pkg.tar.zst.sig2023-12-06 01:19 119
[PGP]neovim-nvim-treesitter-0.9.0-1-any.pkg.tar.zst.sig2023-05-24 03:11 119
[PGP]neovim-nvim-treesitter-0.9.2-1-any.pkg.tar.zst.sig2024-01-22 22:51 119
[PGP]nerdctl-1.7.2-1-x86_64.pkg.tar.zst.sig2023-12-17 01:14 119
[PGP]netavark-1.10.3-1-x86_64.pkg.tar.zst.sig2024-02-18 01:14 119
[PGP]netcdf-openmpi-4.9.2-4-x86_64.pkg.tar.zst.sig2024-01-26 01:16 119
[PGP]netfilter-fullconenat-r73.0cf3b48-351-x86_64.pkg.tar.zst.sig2024-02-24 01:14 119
[PGP]nethack-3.6.7-5-x86_64.pkg.tar.zst.sig2023-05-24 03:11 119
[PGP]nethsm-pkcs11-1.3.0-1-x86_64.pkg.tar.zst.sig2024-02-20 01:13 119
[PGP]netplan-0.107-3-x86_64.pkg.tar.zst.sig2023-11-20 01:15 119
[PGP]netsurf-3.11-7-x86_64.pkg.tar.zst.sig2024-02-25 01:14 119
[PGP]nettle-3.9.1-1-x86_64.pkg.tar.zst.sig2023-06-03 02:13 119
[PGP]network-manager-applet-1.36.0-1-x86_64.pkg.tar.zst.sig2024-01-21 01:14 119
[PGP]network-manager-sstp-1.3.2-1-x86_64.pkg.tar.zst.sig2023-11-29 01:18 119
[PGP]networkmanager-1.46.0-1-x86_64.pkg.tar.zst.sig2024-02-24 01:14 119
[PGP]networkmanager-1.46.0-2-x86_64.pkg.tar.zst.sig2024-02-25 01:13 119
[PGP]networkmanager-docs-1.46.0-1-x86_64.pkg.tar.zst.sig2024-02-24 01:14 119
[PGP]networkmanager-docs-1.46.0-2-x86_64.pkg.tar.zst.sig2024-02-25 01:13 119
[PGP]new-session-manager-1.6.1-1-x86_64.pkg.tar.zst.sig2023-05-24 03:11 119
[PGP]newsboat-2.34-1-x86_64.pkg.tar.zst.sig2023-12-26 01:15 119
[PGP]nextcloud-28.0.2-1-any.pkg.tar.zst.sig2024-02-02 01:15 119
[PGP]nextcloud-app-bookmarks-1:13.1.3-1-any.pkg.tar.zst.sig2023-12-25 01:26 119
[PGP]nextcloud-app-calendar-1:4.6.5-1-any.pkg.tar.zst.sig2024-02-18 01:14 119
[PGP]nextcloud-app-contacts-5.5.2-1-any.pkg.tar.zst.sig2024-02-20 01:13 119
[PGP]nextcloud-app-deck-1:1.12.2-1-any.pkg.tar.zst.sig2024-02-18 01:14 119
[PGP]nextcloud-app-mail-3.5.6-1-any.pkg.tar.zst.sig2024-02-19 01:15 119
[PGP]nextcloud-app-news-25.0.0.alpha4-1-any.pkg.tar.zst.sig2024-02-02 01:15 119
[PGP]nextcloud-app-notes-4.9.2-1-any.pkg.tar.zst.sig2024-01-02 01:14 119
[PGP]nextcloud-app-spreed-1:18.0.3-1-any.pkg.tar.zst.sig2024-02-02 01:15 119
[PGP]nextcloud-app-tasks-0.15.0-1-any.pkg.tar.zst.sig2023-05-24 03:11 119
[PGP]nfoview-1.99-2-any.pkg.tar.zst.sig2023-09-04 02:15 119
[PGP]nftables-1:1.0.9-1-x86_64.pkg.tar.zst.sig2023-10-28 02:14 119
[PGP]nginx-1.24.0-3-x86_64.pkg.tar.zst.sig2023-10-12 02:13 119
[PGP]nginx-mainline-1.25.4-1-x86_64.pkg.tar.zst.sig2024-02-15 01:14 119
[PGP]nginx-mainline-src-1.25.4-1-x86_64.pkg.tar.zst.sig2024-02-15 01:14 119
[PGP]nginx-mod-auth-pam-1.5.5-1-x86_64.pkg.tar.zst.sig2023-06-30 02:15 119
[PGP]nginx-mod-brotli-1:1.0.0rc-7-x86_64.pkg.tar.zst.sig2023-05-24 03:11 119
[PGP]nginx-mod-cache_purge-2.5.3-2-x86_64.pkg.tar.zst.sig2023-05-24 03:11 119
[PGP]nginx-mod-echo-0.62-6-x86_64.pkg.tar.zst.sig2023-05-24 03:11 119
[PGP]nginx-mod-geoip2-3.4-3-x86_64.pkg.tar.zst.sig2023-05-24 03:11 119
[PGP]nginx-mod-headers-more-0.37-1-x86_64.pkg.tar.zst.sig2024-01-14 01:14 119
[PGP]nginx-mod-memc-0.20-1-x86_64.pkg.tar.zst.sig2024-01-14 01:14 119
[PGP]nginx-mod-modsecurity-1:1.0.3-4-x86_64.pkg.tar.zst.sig2023-05-24 03:11 119
[PGP]nginx-mod-naxsi-1.4-1-x86_64.pkg.tar.zst.sig2023-05-24 03:11 119
[PGP]nginx-mod-ndk-0.33+0.3.3-6-x86_64.pkg.tar.zst.sig2023-11-18 01:13 119
[PGP]nginx-mod-njs-0.8.3-1-x86_64.pkg.tar.zst.sig2024-02-10 01:15 119
[PGP]nginx-mod-passenger-6.0.20-1-x86_64.pkg.tar.zst.sig2024-02-01 01:18 119
[PGP]nginx-mod-redis-0.3.9-12-x86_64.pkg.tar.zst.sig2023-05-24 03:11 119
[PGP]nginx-mod-redis2-0.15-12-x86_64.pkg.tar.zst.sig2023-05-24 03:11 119
[PGP]nginx-mod-set-misc-0.33+0.3.3-6-x86_64.pkg.tar.zst.sig2023-11-18 01:13 119
[PGP]nginx-mod-srcache-0.33-2-x86_64.pkg.tar.zst.sig2023-05-24 03:11 119
[PGP]nginx-src-1.24.0-3-x86_64.pkg.tar.zst.sig2023-10-12 02:13 119
[PGP]ngspice-42-1-x86_64.pkg.tar.zst.sig2024-01-03 01:14 119
[PGP]nheko-0.11.3-10-x86_64.pkg.tar.zst.sig2024-02-04 01:14 119
[PGP]nickel-1.2.1-2-x86_64.pkg.tar.zst.sig2023-09-23 12:38 119
[PGP]nickel-docs-1.2.1-2-x86_64.pkg.tar.zst.sig2023-09-23 12:38 119
[PGP]nickel-language-server-1.2.1-2-x86_64.pkg.tar.zst.sig2023-09-23 12:38 119
[PGP]nikola-8.3.0-2-any.pkg.tar.zst.sig2024-01-28 01:14 119
[PGP]ninjas2-0.2.0-3-x86_64.pkg.tar.zst.sig2023-05-24 03:11 119
[PGP]ninjas2-lv2-0.2.0-3-x86_64.pkg.tar.zst.sig2023-05-24 03:11 119
[PGP]ninjas2-standalone-0.2.0-3-x86_64.pkg.tar.zst.sig2023-05-24 03:11 119
[PGP]ninjas2-vst-0.2.0-3-x86_64.pkg.tar.zst.sig2023-05-24 03:11 119
[PGP]nitrogen-1.6.1-4-x86_64.pkg.tar.zst.sig2021-09-28 02:13 119
[PGP]nix-busybox-1.35.0-1-x86_64.pkg.tar.zst.sig2023-05-24 03:11 119
[PGP]nlohmann-json-3.11.2-2-any.pkg.tar.zst.sig2023-08-30 02:15 119
[PGP]nm-cloud-setup-1.46.0-1-x86_64.pkg.tar.zst.sig2024-02-24 01:14 119
[PGP]nm-cloud-setup-1.46.0-2-x86_64.pkg.tar.zst.sig2024-02-25 01:13 119
[PGP]nm-connection-editor-1.36.0-1-x86_64.pkg.tar.zst.sig2024-01-21 01:14 119
[PGP]nmon-16p-1-x86_64.pkg.tar.zst.sig2023-08-29 02:14 119
[PGP]nodejs-material-design-icons-3.0.1-5-any.pkg.tar.zst.sig2023-10-11 02:15 119
[PGP]noise-repellent-0.2.3-2-x86_64.pkg.tar.zst.sig2023-05-24 03:11 119
[PGP]nomad-driver-lxc-0.3.0-3-x86_64.pkg.tar.zst.sig2023-05-24 03:11 119
[PGP]nomad-driver-nspawn-0.10.0-1-x86_64.pkg.tar.zst.sig2023-07-08 02:15 119
[PGP]nomad-driver-podman-0.5.1-1-x86_64.pkg.tar.zst.sig2023-10-10 02:14 119
[PGP]non-mixer-1.3.0-5-x86_64.pkg.tar.zst.sig2023-05-24 03:11 119
[PGP]non-sequencer-1.10.0-3-x86_64.pkg.tar.zst.sig2023-05-24 03:11 119
[PGP]non-timeline-1.3.0-5-x86_64.pkg.tar.zst.sig2023-05-24 03:11 119
[PGP]npth-1.6-4-x86_64.pkg.tar.zst.sig2023-03-19 01:13 119
[PGP]npth-1.7-1-x86_64.pkg.tar.zst.sig2024-02-25 01:13 119
[PGP]nrpe-4.1.0-3-x86_64.pkg.tar.zst.sig2023-09-24 02:13 119
[PGP]nspr-4.35-2-x86_64.pkg.tar.zst.sig2023-12-12 01:14 119
[PGP]nss-3.98-1-x86_64.pkg.tar.zst.sig2024-02-18 01:13 119
[PGP]nsync-1.26.0-2-x86_64.pkg.tar.zst.sig2024-01-18 01:17 119
[PGP]ntk-1.3.1001-2-x86_64.pkg.tar.zst.sig2023-05-24 03:11 119
[PGP]ntp-4.2.8.p17-1-x86_64.pkg.tar.zst.sig2023-06-07 02:14 119
[PGP]numactl-2.0.18-1-x86_64.pkg.tar.zst.sig2024-02-08 01:16 119
[PGP]nvchecker-2.13-1-any.pkg.tar.zst.sig2023-12-18 16:49 119
[PGP]nvchecker-2.13.1-1-any.pkg.tar.zst.sig2023-12-28 01:14 119
[PGP]nyxt-3.11.1-1-x86_64.pkg.tar.zst.sig2024-02-01 01:18 119
[PGP]ob-xd-2.10-2-x86_64.pkg.tar.zst.sig2023-06-04 02:14 119
[PGP]ob-xd-common-2.10-2-x86_64.pkg.tar.zst.sig2023-06-04 02:14 119
[PGP]ob-xd-lv2-2.10-2-x86_64.pkg.tar.zst.sig2023-06-04 02:14 119
[PGP]ob-xd-standalone-2.10-2-x86_64.pkg.tar.zst.sig2023-06-04 02:14 119
[PGP]ob-xd-vst3-2.10-2-x86_64.pkg.tar.zst.sig2023-06-04 02:14 119
[PGP]obconf-qt-0.16.4-1-x86_64.pkg.tar.zst.sig2024-01-19 01:14 119
[PGP]ocaml-4.14.0-1-x86_64.pkg.tar.zst.sig2022-08-17 01:31 119
[PGP]ocaml-5.1.0-1-x86_64.pkg.tar.zst.sig2023-12-09 19:29 119
[PGP]ocaml-astring-0.8.5-2-x86_64.pkg.tar.zst.sig2023-12-09 19:29 119
[PGP]ocaml-augeas-0.6-3-x86_64.pkg.tar.zst.sig2023-12-09 19:29 119
[PGP]ocaml-base-0.16.3-2-x86_64.pkg.tar.zst.sig2023-12-09 19:29 119
[PGP]ocaml-bigarray-compat-1.0.0-3-x86_64.pkg.tar.zst.sig2022-08-17 01:31 119
[PGP]ocaml-bigarray-compat-1.1.0-2-x86_64.pkg.tar.zst.sig2023-12-09 19:29 119
[PGP]ocaml-bos-0.2.1-2-x86_64.pkg.tar.zst.sig2023-12-09 19:29 119
[PGP]ocaml-cairo-0.6.4-5-x86_64.pkg.tar.zst.sig2023-12-09 19:29 119
[PGP]ocaml-cmdliner-1.2.0-2-x86_64.pkg.tar.zst.sig2023-12-09 19:29 119
[PGP]ocaml-compiler-libs-4.14.0-1-x86_64.pkg.tar.zst.sig2022-08-17 01:31 119
[PGP]ocaml-compiler-libs-5.1.0-1-x86_64.pkg.tar.zst.sig2023-12-09 19:29 119
[PGP]ocaml-csexp-1.5.2-3-x86_64.pkg.tar.zst.sig2023-12-09 19:29 119
[PGP]ocaml-ctypes-0.20.1-1-x86_64.pkg.tar.zst.sig2022-08-17 01:31 119
[PGP]ocaml-ctypes-0.21.1-1-x86_64.pkg.tar.zst.sig2024-01-06 01:14 119
[PGP]ocaml-findlib-1.9.6-3-x86_64.pkg.tar.zst.sig2023-12-09 19:29 119
[PGP]ocaml-fmt-0.9.0-2-x86_64.pkg.tar.zst.sig2023-12-09 19:29 119
[PGP]ocaml-fpath-0.7.3-2-x86_64.pkg.tar.zst.sig2023-12-09 19:29 119
[PGP]ocaml-hashcons-1.3-7-x86_64.pkg.tar.zst.sig2023-12-09 19:29 119
[PGP]ocaml-integers-0.7.0-1-x86_64.pkg.tar.zst.sig2022-08-17 01:31 119
[PGP]ocaml-integers-0.7.0-4-x86_64.pkg.tar.zst.sig2023-12-09 19:29 119
[PGP]ocaml-logs-0.7.0-2-x86_64.pkg.tar.zst.sig2023-12-09 19:29 119
[PGP]ocaml-num-1.4-9-x86_64.pkg.tar.zst.sig2023-12-09 19:29 119
[PGP]ocaml-pp-1.1.2-6-x86_64.pkg.tar.zst.sig2023-12-09 19:29 119
[PGP]ocaml-ppx_derivers-1.2.1-12-x86_64.pkg.tar.zst.sig2023-12-09 19:29 119
[PGP]ocaml-re-1.11.0-2-x86_64.pkg.tar.zst.sig2023-12-09 19:29 119
[PGP]ocaml-result-1.5-7-x86_64.pkg.tar.zst.sig2022-08-17 01:31 119
[PGP]ocaml-result-1.5-9-x86_64.pkg.tar.zst.sig2023-12-09 19:29 119
[PGP]ocaml-rresult-0.7.0-2-x86_64.pkg.tar.zst.sig2023-12-09 19:29 119
[PGP]ocaml-sexplib0-0.16.0-2-x86_64.pkg.tar.zst.sig2023-12-09 19:29 119
[PGP]ocaml-stdlib-shims-0.3.0-7-x86_64.pkg.tar.zst.sig2023-12-09 19:29 119
[PGP]ocaml-topkg-1.0.5-1-x86_64.pkg.tar.zst.sig2022-08-17 01:31 119
[PGP]ocaml-topkg-1.0.7-2-x86_64.pkg.tar.zst.sig2023-12-09 19:29 119
[PGP]ocaml-zarith-1.13-1-x86_64.pkg.tar.zst.sig2023-12-09 19:29 119
[PGP]ode-0.16.2-2-x86_64.pkg.tar.zst.sig2023-10-11 02:15 119
[PGP]odin2-synthesizer-2.3.4-2-x86_64.pkg.tar.zst.sig2023-07-04 02:14 119
[PGP]odin2-synthesizer-clap-2.3.4-2-x86_64.pkg.tar.zst.sig2023-07-04 02:14 119
[PGP]odin2-synthesizer-common-2.3.4-2-x86_64.pkg.tar.zst.sig2023-07-04 02:14 119
[PGP]odin2-synthesizer-lv2-2.3.4-2-x86_64.pkg.tar.zst.sig2023-07-04 02:14 119
[PGP]odin2-synthesizer-standalone-2.3.4-2-x86_64.pkg.tar.zst.sig2023-07-04 02:14 119
[PGP]odin2-synthesizer-vst3-2.3.4-2-x86_64.pkg.tar.zst.sig2023-07-04 02:14 119
[PGP]odt2txt-0.5-5-x86_64.pkg.tar.zst.sig2023-05-24 03:12 119
[PGP]oil-0.19.0-1-x86_64.pkg.tar.zst.sig2023-12-12 01:14 119
[PGP]onevpl-intel-gpu-24.1.3-1-x86_64.pkg.tar.zst.sig2024-02-18 01:14 119
[PGP]oniguruma-6.9.9-1-x86_64.pkg.tar.zst.sig2023-10-16 19:01 119
[PGP]onnxruntime-1.16.3-6-x86_64.pkg.tar.zst.sig2024-02-21 01:15 119
[PGP]onnxruntime-opt-1.16.3-6-x86_64.pkg.tar.zst.sig2024-02-21 01:15 119
[PGP]onnxruntime-opt-rocm-1.16.3-6-x86_64.pkg.tar.zst.sig2024-02-21 01:15 119
[PGP]onnxruntime-rocm-1.16.3-6-x86_64.pkg.tar.zst.sig2024-02-21 01:15 119
[PGP]opam-2.1.5-2-x86_64.pkg.tar.zst.sig2023-12-09 19:30 119
[PGP]open-iscsi-2.1.9-2-x86_64.pkg.tar.zst.sig2023-06-21 02:25 119
[PGP]open-isns-0.102-3-x86_64.pkg.tar.zst.sig2023-09-06 02:14 119
[PGP]openapi-diff-2.0.1-2-any.pkg.tar.zst.sig2023-05-24 03:12 119
[PGP]openapi-generator-7.3.0-1-any.pkg.tar.zst.sig2024-02-17 16:20 119
[PGP]openbox-3.6.1-10-x86_64.pkg.tar.zst.sig2023-05-24 03:12 119
[PGP]opencl-clover-mesa-1:24.0.1-1-x86_64.pkg.tar.zst.sig2024-02-15 01:14 119
[PGP]opencl-rusticl-mesa-1:24.0.1-1-x86_64.pkg.tar.zst.sig2024-02-15 01:14 119
[PGP]opencollada-1:1.6.68-3-x86_64.pkg.tar.zst.sig2023-05-24 03:13 119
[PGP]opencore-amr-0.1.6-1-x86_64.pkg.tar.zst.sig2022-08-03 02:15 119
[PGP]opendbx-1.4.6-12-x86_64.pkg.tar.zst.sig2023-05-24 03:13 119
[PGP]openfec-1.4.2.9-1-x86_64.pkg.tar.zst.sig2023-05-24 03:13 119
[PGP]openfire-4.8.0-1-any.pkg.tar.zst.sig2024-01-14 01:14 119
[PGP]openh264-2.4.1-1-x86_64.pkg.tar.zst.sig2024-02-03 01:17 119
[PGP]openmpi-5.0.2-5-x86_64.pkg.tar.zst.sig2024-02-25 01:13 119
[PGP]openmpi-5.0.2-6-x86_64.pkg.tar.zst.sig2024-02-26 01:15 119
[PGP]openmpi-docs-5.0.2-5-x86_64.pkg.tar.zst.sig2024-02-25 01:14 119
[PGP]openmpi-docs-5.0.2-6-x86_64.pkg.tar.zst.sig2024-02-26 01:15 119
[PGP]openntpd-6.8p1-7-x86_64.pkg.tar.zst.sig2023-10-16 19:01 119
[PGP]openpgp-ca-0.13.1-1-x86_64.pkg.tar.zst.sig2024-02-02 01:15 119
[PGP]openpgp-ca-restd-0.13.1-1-x86_64.pkg.tar.zst.sig2024-02-02 01:15 119
[PGP]openpgp-card-tools-0.10.0-2-x86_64.pkg.tar.zst.sig2024-02-17 01:16 119
[PGP]openpmix-4.2.6-1-x86_64.pkg.tar.zst.sig2023-09-11 02:14 119
[PGP]openpmix-4.2.9-1-x86_64.pkg.tar.zst.sig2024-02-11 01:16 119
[PGP]openpmix-docs-4.2.6-1-x86_64.pkg.tar.zst.sig2023-09-11 02:14 119
[PGP]openpmix-docs-4.2.9-1-x86_64.pkg.tar.zst.sig2024-02-11 01:16 119
[PGP]openresolv-3.13.2-2-any.pkg.tar.zst.sig2023-12-13 18:41 119
[PGP]openscad-2021.01-10-x86_64.pkg.tar.zst.sig2023-10-13 02:15 119
[PGP]opensmtpd-7.4.0p1-1-x86_64.pkg.tar.zst.sig2023-11-17 01:16 119
[PGP]opensmtpd-filter-dkimsign-0.6-1-x86_64.pkg.tar.zst.sig2023-05-24 03:15 119
[PGP]opensmtpd-filter-rspamd-0.1.8-1-x86_64.pkg.tar.zst.sig2023-06-23 02:18 119
[PGP]opensnitch-1.6.4-1-x86_64.pkg.tar.zst.sig2023-11-14 01:15 119
[PGP]openssl-1.1-1.1.1.w-1-x86_64.pkg.tar.zst.sig2023-09-21 02:13 119
[PGP]openssl-3.2.1-1-x86_64.pkg.tar.zst.sig2024-02-01 01:14 119
[PGP]openucc-1.2.0-1-x86_64.pkg.tar.zst.sig2024-02-12 01:16 119
[PGP]openucx-1.15.0-2-x86_64.pkg.tar.zst.sig2023-12-30 01:15 119
[PGP]openui5-1.108.2-1-any.pkg.tar.zst.sig2023-05-24 03:15 119
[PGP]openvpn-2.6.9-1-x86_64.pkg.tar.zst.sig2024-02-14 01:15 119
[PGP]opl-synth-2.2-1-x86_64.pkg.tar.zst.sig2023-05-24 03:15 119
[PGP]orc-0.4.37-1-x86_64.pkg.tar.zst.sig2024-02-08 01:16 119
[PGP]orca-45.2-1-any.pkg.tar.zst.sig2024-01-07 01:14 119
[PGP]orca-46beta-1-any.pkg.tar.zst.sig2024-02-25 01:14 119
[PGP]oscpack-1.1.0-3-x86_64.pkg.tar.zst.sig2023-05-24 03:15 119
[PGP]osmid-0.8.0-2-x86_64.pkg.tar.zst.sig2023-05-24 03:15 119
[PGP]ospray-3.0.0-2-x86_64.pkg.tar.zst.sig2024-01-26 01:16 119
[PGP]ostree-2024.4-1-x86_64.pkg.tar.zst.sig2024-02-25 01:14 119
[PGP]ot-cryptid-clap-1.0.1-3-x86_64.pkg.tar.zst.sig2023-12-02 01:16 119
[PGP]ot-cryptid-docs-1.0.1-3-x86_64.pkg.tar.zst.sig2023-12-02 01:16 119
[PGP]ot-cryptid-vst3-1.0.1-3-x86_64.pkg.tar.zst.sig2023-12-02 01:16 119
[PGP]ot-simian-docs-1.1.0-3-x86_64.pkg.tar.zst.sig2023-12-03 01:20 119
[PGP]ot-simian-lv2-1.1.0-3-x86_64.pkg.tar.zst.sig2023-12-03 01:20 119
[PGP]ot-simian-vst3-1.1.0-3-x86_64.pkg.tar.zst.sig2023-12-03 01:20 119
[PGP]ot-urchin-clap-1.0.0-1-x86_64.pkg.tar.zst.sig2023-12-02 01:16 119
[PGP]ot-urchin-docs-1.0.0-1-x86_64.pkg.tar.zst.sig2023-12-02 01:17 119
[PGP]ot-urchin-standalone-1.0.0-1-x86_64.pkg.tar.zst.sig2023-12-02 01:17 119
[PGP]ot-urchin-vst3-1.0.0-1-x86_64.pkg.tar.zst.sig2023-12-02 01:17 119
[PGP]otf-aurulent-nerd-3.1.1-1-any.pkg.tar.zst.sig2023-11-29 01:18 119
[PGP]otf-cascadia-code-2111.01-1-any.pkg.tar.zst.sig2023-05-24 03:15 119
[PGP]otf-codenewroman-nerd-3.1.1-1-any.pkg.tar.zst.sig2023-11-29 01:18 119
[PGP]otf-comicshanns-nerd-3.1.1-1-any.pkg.tar.zst.sig2023-11-29 01:18 119
[PGP]otf-commit-mono-nerd-3.1.1-1-any.pkg.tar.zst.sig2023-11-29 01:18 119
[PGP]otf-droid-nerd-3.1.1-1-any.pkg.tar.zst.sig2023-11-29 01:18 119
[PGP]otf-firamono-nerd-3.1.1-1-any.pkg.tar.zst.sig2023-11-29 01:18 119
[PGP]otf-geist-mono-nerd-3.1.1-1-any.pkg.tar.zst.sig2023-11-29 01:18 119
[PGP]otf-hasklig-nerd-3.1.1-1-any.pkg.tar.zst.sig2023-11-29 01:18 119
[PGP]otf-hermit-nerd-3.1.1-1-any.pkg.tar.zst.sig2023-11-29 01:18 119
[PGP]otf-monaspace-nerd-3.1.1-1-any.pkg.tar.zst.sig2023-11-29 01:19 119
[PGP]otf-montserrat-7.222-2-any.pkg.tar.zst.sig2023-12-13 18:29 119
[PGP]otf-opendyslexic-nerd-3.1.1-1-any.pkg.tar.zst.sig2023-11-29 01:19 119
[PGP]otf-overpass-3.0.5-2-any.pkg.tar.zst.sig2023-05-24 03:16 119
[PGP]otf-overpass-nerd-3.1.1-1-any.pkg.tar.zst.sig2023-11-29 01:19 119
[PGP]owl-lisp-0.2.2-1-x86_64.pkg.tar.zst.sig2023-10-30 01:45 119
[PGP]packagekit-1.2.8-2-x86_64.pkg.tar.zst.sig2024-02-12 01:15 119
[PGP]pacredir-0.4.7-1-x86_64.pkg.tar.zst.sig2023-11-25 01:15 119
[PGP]padthv1-0.9.34-1-x86_64.pkg.tar.zst.sig2024-02-02 01:15 119
[PGP]padthv1-lv2-0.9.34-1-x86_64.pkg.tar.zst.sig2024-02-02 01:15 119
[PGP]padthv1-standalone-0.9.34-1-x86_64.pkg.tar.zst.sig2024-02-02 01:15 119
[PGP]pam-krb5-4.11-2-x86_64.pkg.tar.zst.sig2023-05-24 03:16 119
[PGP]pam-u2f-1.3.0-1-x86_64.pkg.tar.zst.sig2023-05-24 03:16 119
[PGP]pambase-20230918-1-any.pkg.tar.zst.sig2023-09-23 02:13 119
[PGP]pamixer-1.6-3-x86_64.pkg.tar.zst.sig2024-02-18 01:14 119
[PGP]pango-1:1.51.2-1-x86_64.pkg.tar.zst.sig2024-02-12 21:11 119
[PGP]pango-docs-1:1.51.2-1-x86_64.pkg.tar.zst.sig2024-02-12 21:11 119
[PGP]pangomm-2.46.4-1-x86_64.pkg.tar.zst.sig2024-01-28 01:14 119
[PGP]pangomm-2.48-2.50.2-1-x86_64.pkg.tar.zst.sig2024-01-28 01:14 119
[PGP]pangomm-2.48-docs-2.50.2-1-x86_64.pkg.tar.zst.sig2024-01-28 01:14 119
[PGP]pangomm-docs-2.46.4-1-x86_64.pkg.tar.zst.sig2024-01-28 01:14 119
[PGP]paperkey-1.6-4-x86_64.pkg.tar.zst.sig2023-10-07 02:14 119
[PGP]par2cmdline-0.8.1-2-x86_64.pkg.tar.zst.sig2023-05-24 03:16 119
[PGP]parallel-20240122-1-any.pkg.tar.zst.sig2024-02-01 01:18 119
[PGP]parallel-docs-20240122-1-any.pkg.tar.zst.sig2024-02-01 01:18 119
[PGP]paraview-5.11.2-8-x86_64.pkg.tar.zst.sig2024-01-27 01:17 119
[PGP]parted-3.6-1-x86_64.pkg.tar.zst.sig2023-04-12 02:13 119
[PGP]pass-1.7.4-5-any.pkg.tar.zst.sig2024-01-13 01:14 119
[PGP]passenger-6.0.20-1-x86_64.pkg.tar.zst.sig2024-02-01 01:18 119
[PGP]passt-2024_02_20.1e6f92b-1-x86_64.pkg.tar.zst.sig2024-02-21 01:14 119
[PGP]pastel-0.9.0-3-x86_64.pkg.tar.zst.sig2023-11-14 01:15 119
[PGP]pastel-docs-0.9.0-3-x86_64.pkg.tar.zst.sig2023-11-14 01:15 119
[PGP]patch-2.7.6-10-x86_64.pkg.tar.zst.sig2023-05-26 02:14 119
[PGP]patchage-1.0.10-2-x86_64.pkg.tar.zst.sig2023-05-24 03:16 119
[PGP]patchelf-0.18.0-1-x86_64.pkg.tar.zst.sig2023-05-24 03:16 119
[PGP]patchmatrix-0.26.0-2-x86_64.pkg.tar.zst.sig2023-05-24 03:16 119
[PGP]patroneo-2.4.1-1-any.pkg.tar.zst.sig2023-05-24 03:16 119
[PGP]pavucontrol-qt-1.4.0-2-x86_64.pkg.tar.zst.sig2023-12-05 01:22 119
[PGP]pax-20201030-2-x86_64.pkg.tar.zst.sig2023-05-24 03:16 119
[PGP]pax-utils-1.3.7-1-x86_64.pkg.tar.zst.sig2023-05-24 03:16 119
[PGP]pc-ble-driver-4.1.4-9-x86_64.pkg.tar.zst.sig2024-02-20 01:13 119
[PGP]pcmanfm-qt-1.4.1-1-x86_64.pkg.tar.zst.sig2024-02-12 21:11 119
[PGP]pcp-6.2.0-1-x86_64.pkg.tar.zst.sig2024-02-22 01:15 119
[PGP]pcp-gui-6.2.0-1-x86_64.pkg.tar.zst.sig2024-02-22 01:15 119
[PGP]pcp-pmda-activemq-6.2.0-1-x86_64.pkg.tar.zst.sig2024-02-22 01:15 119
[PGP]pcp-pmda-bcc-6.2.0-1-x86_64.pkg.tar.zst.sig2024-02-22 01:15 119
[PGP]pcp-pmda-bind2-6.2.0-1-x86_64.pkg.tar.zst.sig2024-02-22 01:15 119
[PGP]pcp-pmda-bpftrace-6.2.0-1-x86_64.pkg.tar.zst.sig2024-02-22 01:15 119
[PGP]pcp-pmda-libvirt-6.2.0-1-x86_64.pkg.tar.zst.sig2024-02-22 01:15 119
[PGP]pcp-pmda-mysql-6.2.0-1-x86_64.pkg.tar.zst.sig2024-02-22 01:15 119
[PGP]pcp-pmda-nginx-6.2.0-1-x86_64.pkg.tar.zst.sig2024-02-22 01:15 119
[PGP]pcp-pmda-nutcracker-6.2.0-1-x86_64.pkg.tar.zst.sig2024-02-22 01:15 119
[PGP]pcp-pmda-openmetrics-6.2.0-1-x86_64.pkg.tar.zst.sig2024-02-22 01:15 119
[PGP]pcp-pmda-podman-6.2.0-1-x86_64.pkg.tar.zst.sig2024-02-22 01:15 119
[PGP]pcp-pmda-postgresql-6.2.0-1-x86_64.pkg.tar.zst.sig2024-02-22 01:15 119
[PGP]pcp-pmda-snmp-6.2.0-1-x86_64.pkg.tar.zst.sig2024-02-22 01:15 119
[PGP]pcre-8.45-4-x86_64.pkg.tar.zst.sig2023-08-21 02:14 119
[PGP]pcsc-tools-1.7.1-1-x86_64.pkg.tar.zst.sig2024-01-06 01:14 119
[PGP]pd-0.54.1-1-x86_64.pkg.tar.zst.sig2023-11-01 01:14 119
[PGP]pd-lua-0.11.6-1-x86_64.pkg.tar.zst.sig2023-05-24 03:16 119
[PGP]pd-sfizz-1.2.3-2-x86_64.pkg.tar.zst.sig2024-02-22 01:15 119
[PGP]pdfcrack-0.20-1-x86_64.pkg.tar.zst.sig2023-05-24 03:16 119
[PGP]peco-0.5.11-1-x86_64.pkg.tar.zst.sig2023-05-24 03:16 119
[PGP]penguin-subtitle-player-1.5.0-3-x86_64.pkg.tar.zst.sig2023-05-24 03:16 119
[PGP]percona-server-8.1.0_1-2-x86_64.pkg.tar.zst.sig2023-12-13 18:50 119
[PGP]percona-server-clients-8.1.0_1-2-x86_64.pkg.tar.zst.sig2023-12-13 18:50 119
[PGP]percona-toolkit-3.5.7-1-x86_64.pkg.tar.zst.sig2023-12-25 01:26 119
[PGP]perl-acme-alien-dontpanic-2.7200-2-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-datetime-calendar-julian-0.107-2-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-datetime-event-ical-0.13-9-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-datetime-event-recurrence-0.19-9-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-datetime-format-builder-1:0.83-4-x86_64.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-datetime-format-strptime-1.79-2-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-dbd-mariadb-1.23-1-x86_64.pkg.tar.zst.sig2023-10-26 02:26 119
[PGP]perl-goocanvas2-cairotypes-0.001-7-x86_64.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-graphics-colornames-www-1.14-4-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-graphics-tiff-20-2-x86_64.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-html-highlight-0.20-14-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-image-exiftool-12.76-1-any.pkg.tar.zst.sig2024-02-01 01:18 119
[PGP]perl-inline-c-0.82-3-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-io-all-0.87-6-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-io-bufferedselect-1.0-12-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-io-captureoutput-1.1105-5-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-io-digest-0.11-9-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-io-dirent-0.05-17-x86_64.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-io-multiplex-1.16-9-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-io-pager-2.10-2-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-io-tee-0.66-2-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-ipc-shareable-1.13-2-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-json-parse-0.62-2-x86_64.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-json-webtoken-0.10-8-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-lchown-1.01-15-x86_64.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-ldap-0.68-3-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-lingua-en-inflect-1.905-4-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-linux-pid-0.04-16-x86_64.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-list-allutils-0.19-2-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-list-someutils-0.59-2-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-list-utilsby-0.12-2-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-local-lib-2.000029-2-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-locale-codes-3.73-2-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-locale-po-0.27-9-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-log-any-adapter-log4perl-0.09-6-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-log-any-adapter-tap-0.003003-6-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-log-message-0.08-9-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-log-message-simple-0.10-9-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-mail-authenticationresults-2.20230112-2-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-mail-box-parser-c-3.010-4-x86_64.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-mail-imapclient-3.43-4-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-mail-sendmail-0.80-2-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-mail-spf-query-1.999.1-14-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-mail-transport-dbx-0.07-22-x86_64.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-math-base85-0.5-2-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-math-random-isaac-1.004-10-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-mime-base32-1.303-9-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-module-build-xsutil-0.19-7-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-module-find-0.16-2-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-module-implementation-0.09-9-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-module-install-1.21-2-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-module-pluggable-5.2-9-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-moo-2.005005-2-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-moox-handlesvia-0.001009-4-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-moox-late-0.100-4-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-moox-types-mooselike-0.29-9-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-mouse-2.5.10-5-x86_64.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-mro-compat-0.15-2-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-namespace-autoclean-0.29-5-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-namespace-clean-0.27-9-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-net-dbus-1.2.0-5-x86_64.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-net-dns-resolver-mock-1.20230216-2-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-net-dropbox-api-1.9-12-x86_64.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-net-idn-encode-2.500-6-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-net-ip-minimal-0.06-9-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-net-ipv4addr-0.10-15-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-net-ipv6addr-1.02-2-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-net-jabber-2.0-14-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-net-ldap-server-0.43-11-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-net-libidn-0.12-21-x86_64.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-net-libidn2-1.02-2-x86_64.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-net-oauth-0.28-13-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-net-snmp-6.0.1-11-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-net-telnet-3.05-4-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-net-xmpp-1.05-9-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-ntlm-1.09-8-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-number-bytes-human-0.11-7-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-number-misc-1.2-7-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-object-accessor-0.48-9-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-object-event-1.23-10-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-object-multitype-0.05-14-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-object-realize-later-0.21-6-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-package-constants-0.06-9-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-package-deprecationmanager-0.18-2-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-package-stash-0.40-3-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-package-stash-xs-0.30-2-x86_64.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-padwalker-2.5-4-x86_64.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-par-dist-0.52-2-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-params-classify-0.015-7-x86_64.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-params-validationcompiler-0.31-2-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-parse-yapp-1.21-6-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-path-class-0.37-9-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-path-finddev-0.5.3-6-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-path-isdev-1.001003-6-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-path-tiny-0.144-2-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-pegex-0.75-4-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-perl-critic-1.148-2-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-perl-minimumversion-1.40-4-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-perlio-utf8-strict-0.010-2-x86_64.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-pkgconfig-0.25026-4-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-pkgconfig-libpkgconf-0.11-6-x86_64.pkg.tar.zst.sig2023-11-26 01:15 119
[PGP]perl-pod-parser-1.66-2-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-pod-spell-1.26-2-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-poe-component-client-dns-1.054-9-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-poe-component-client-http-0.949-9-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-poe-component-client-keepalive-0.272-10-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-poe-component-ikc-0.2402-9-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-poe-component-resolver-0.921-9-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-ppix-quotelike-0.023-2-any.pkg.tar.zst.sig2023-08-08 02:16 119
[PGP]perl-ppix-regexp-0.088-2-any.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-ppix-utilities-1.001000-6-any.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-ppix-utils-0.003-4-any.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-probe-perl-0.03-6-any.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-proc-simple-1.32-9-any.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-ref-util-0.204-2-any.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-ref-util-xs-0.117-2-x86_64.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-regexp-shellish-0.93-14-any.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-rename-1.14-2-any.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-return-multilevel-0.08-4-any.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-role-tiny-2.002004-4-any.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-scalar-list-utils-1.63-2-x86_64.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-scope-guard-0.21-6-any.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-search-xapian-1.2.25.5-3-x86_64.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-sgmls-1:1.1-10-any.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-shell-config-generate-0.34-5-any.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-shell-guess-0.09-6-any.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-software-license-0.104004-2-any.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-sort-naturally-1.03-9-any.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-sort-versions-1.62-9-any.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-strictures-2.000006-6-any.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-string-crc32-2.100-2-x86_64.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-string-format-1.18-6-any.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-string-util-1.34-2-any.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-sub-exporter-progressive-0.001013-9-any.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-sub-handlesvia-0.016-4-any.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-sub-info-0.002-10-any.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-sub-install-0.928-9-any.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-sub-name-0.27-2-x86_64.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-sub-quote-1:2.006008-2-any.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-super-1.20190531-6-any.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-switch-2.17-9-any.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-sys-meminfo-0.99-5-x86_64.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-sys-syscall-0.25-10-any.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-sys-virt-9.0.0-2-x86_64.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-task-weaken-1.06-6-any.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-term-animation-2.6-10-any.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-term-extendedcolor-0.504-5-any.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-term-progressbar-2.23-2-any.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-term-read-password-0.11-13-any.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-term-readline-gnu-1.46-2-x86_64.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-term-ui-0.50-3-any.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-test-exception-0.43-9-any.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-test-exit-0.11-6-any.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-test-failwarnings-0.008-7-any.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-test-fatal-0.017-2-any.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-test-file-1.993-2-any.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-test-inter-1.10-2-any.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-test-leaktrace-0.17-4-x86_64.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-test-minimumversion-0.101083-2-any.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-test-mock-guard-0.10-6-any.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-test-mockmodule-0.177.0-4-any.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-test-mocktime-0.17-7-any.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-test-more-utf8-0.05-7-any.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-test-needs-0.002010-2-any.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-test-number-delta-1.06-8-any.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-test-object-0.08-6-any.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-test-requires-0.11-5-any.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-test-requiresinternet-0.05-9-any.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-test-script-1.29-4-any.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-test-spec-0.54-7-any.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-test-subcalls-1.10-6-any.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-test-trap-0.3.5-2-any.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-test-utf8-1.02-2-any.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-test-without-module-0.21-2-any.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-test-yaml-1.07-7-any.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-test2-tools-process-0.07-2-any.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-text-charwidth-0.04-22-x86_64.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-text-csv-2.04-1-any.pkg.tar.zst.sig2023-12-06 01:19 119
[PGP]perl-text-kakasi-2.04-23-x86_64.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-text-markdown-1.000031-13-any.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-text-soundex-3.05-11-x86_64.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-text-template-1.61-3-any.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-text-unidecode-1.30-3-x86_64.pkg.tar.zst.sig2023-05-24 03:17 119
[PGP]perl-text-vfile-asdata-0.08-10-any.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-throwable-1.001-2-any.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-tie-cphash-2.000-9-any.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-tie-hash-indexed-0.08-2-x86_64.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-time-format-1.16-2-any.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-time-human-1.03-14-any.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-time-modules-2013.0912-9-any.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-tk-tablematrix-1.29-2-x86_64.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-type-tiny-1.016010-2-any.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-types-serialiser-1.01-2-any.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-unicode-string-2.10-7-x86_64.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-unicode-stringprep-1.105-9-any.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-unix-syslog-1.1-17-x86_64.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-user-identity-1.02-2-any.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-variable-magic-0.63-2-x86_64.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-version-compare-0.14-7-any.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-www-sms-0.09-15-any.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-x11-protocol-0.56-14-any.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-x11-protocol-other-31-2-any.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-xml-libxml-prettyprint-0.006-8-any.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-xml-libxml-simple-1.01-2-any.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-xml-libxslt-2.002001-2-x86_64.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-xml-smart-1.79-10-any.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-xml-stream-1.24-9-any.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-xml-writer-0.900-2-any.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-xml-xpath-1.48-2-any.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perl-yaml-tiny-1.74-2-any.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]perlio-via-dynamic-0.14-10-any.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]pesign-116-2-x86_64.pkg.tar.zst.sig2024-02-21 01:14 119
[PGP]pgcli-4.0.1-1-any.pkg.tar.zst.sig2023-11-29 01:19 119
[PGP]pgcli-4.0.1-2-any.pkg.tar.zst.sig2024-01-02 01:15 119
[PGP]pgformatter-5.5-1-any.pkg.tar.zst.sig2023-05-24 03:17 119
[PGP]php-8.3.3-1-x86_64.pkg.tar.zst.sig2024-02-17 01:17 119
[PGP]php-apache-8.3.3-1-x86_64.pkg.tar.zst.sig2024-02-17 01:17 119
[PGP]php-apcu-5.1.23-2-x86_64.pkg.tar.zst.sig2023-12-28 01:15 119
[PGP]php-cgi-8.3.3-1-x86_64.pkg.tar.zst.sig2024-02-17 01:17 119
[PGP]php-dblib-8.3.3-1-x86_64.pkg.tar.zst.sig2024-02-17 01:17 119
[PGP]php-embed-8.3.3-1-x86_64.pkg.tar.zst.sig2024-02-17 01:17 119
[PGP]php-enchant-8.3.3-1-x86_64.pkg.tar.zst.sig2024-02-17 01:17 119
[PGP]php-fpm-8.3.3-1-x86_64.pkg.tar.zst.sig2024-02-17 01:17 119
[PGP]php-gd-8.3.3-1-x86_64.pkg.tar.zst.sig2024-02-17 01:17 119
[PGP]php-geoip-1.1.1-11-x86_64.pkg.tar.zst.sig2023-12-28 01:15 119
[PGP]php-grpc-1.62.0-1-x86_64.pkg.tar.zst.sig2024-02-22 01:15 119
[PGP]php-igbinary-3.2.15-2-x86_64.pkg.tar.zst.sig2023-12-28 01:15 119
[PGP]php-imagick-3.7.0-7-x86_64.pkg.tar.zst.sig2023-12-30 01:15 119
[PGP]php-legacy-apcu-5.1.23-2-x86_64.pkg.tar.zst.sig2023-12-28 01:15 119
[PGP]php-legacy-geoip-1.1.1-11-x86_64.pkg.tar.zst.sig2023-12-28 01:15 119
[PGP]php-legacy-grpc-1.62.0-1-x86_64.pkg.tar.zst.sig2024-02-22 01:15 119
[PGP]php-legacy-igbinary-3.2.15-2-x86_64.pkg.tar.zst.sig2023-12-28 01:15 119
[PGP]php-legacy-imagick-3.7.0-7-x86_64.pkg.tar.zst.sig2023-12-30 01:15 119
[PGP]php-legacy-memcache-8.2-3-x86_64.pkg.tar.zst.sig2023-12-28 01:15 119
[PGP]php-legacy-memcached-3.2.0-4-x86_64.pkg.tar.zst.sig2023-12-28 01:15 119
[PGP]php-legacy-mongodb-1.17.2-2-x86_64.pkg.tar.zst.sig2023-12-28 01:15 119
[PGP]php-legacy-redis-6.0.2-2-x86_64.pkg.tar.zst.sig2023-12-28 01:15 119
[PGP]php-memcache-8.2-3-x86_64.pkg.tar.zst.sig2023-12-28 01:15 119
[PGP]php-memcached-3.2.0-4-x86_64.pkg.tar.zst.sig2023-12-28 01:15 119
[PGP]php-mongodb-1.17.2-2-x86_64.pkg.tar.zst.sig2023-12-28 01:15 119
[PGP]php-odbc-8.3.3-1-x86_64.pkg.tar.zst.sig2024-02-17 01:17 119
[PGP]php-pgsql-8.3.3-1-x86_64.pkg.tar.zst.sig2024-02-17 01:17 119
[PGP]php-phpdbg-8.3.3-1-x86_64.pkg.tar.zst.sig2024-02-17 01:17 119
[PGP]php-pspell-8.3.3-1-x86_64.pkg.tar.zst.sig2024-02-17 01:17 119
[PGP]php-redis-6.0.2-2-x86_64.pkg.tar.zst.sig2023-12-28 01:15 119
[PGP]php-snuffleupagus-0.10.0-3-x86_64.pkg.tar.zst.sig2023-12-28 01:15 119
[PGP]php-sodium-8.3.3-1-x86_64.pkg.tar.zst.sig2024-02-17 01:17 119
[PGP]php-sqlite-8.3.3-1-x86_64.pkg.tar.zst.sig2024-02-17 01:17 119
[PGP]php-tidy-8.3.3-1-x86_64.pkg.tar.zst.sig2024-02-17 01:17 119
[PGP]php-xsl-8.3.3-1-x86_64.pkg.tar.zst.sig2024-02-17 01:17 119
[PGP]picard-2.11-1-x86_64.pkg.tar.zst.sig2024-01-26 01:15 119
[PGP]pint-0.45.0-1-x86_64.pkg.tar.zst.sig2023-08-06 02:17 119
[PGP]pipe-rename-1.6.5-1-x86_64.pkg.tar.zst.sig2023-07-04 02:14 119
[PGP]pipectl-0.4.1-3-x86_64.pkg.tar.zst.sig2023-08-05 02:14 119
[PGP]pipewire-1:1.0.3-1-x86_64.pkg.tar.zst.sig2024-02-03 01:17 119
[PGP]pipewire-alsa-1:1.0.3-1-x86_64.pkg.tar.zst.sig2024-02-03 01:17 119
[PGP]pipewire-audio-1:1.0.3-1-x86_64.pkg.tar.zst.sig2024-02-03 01:17 119
[PGP]pipewire-docs-1:1.0.3-1-x86_64.pkg.tar.zst.sig2024-02-03 01:17 119
[PGP]pipewire-ffado-1:1.0.3-1-x86_64.pkg.tar.zst.sig2024-02-03 01:17 119
[PGP]pipewire-jack-1:1.0.3-1-x86_64.pkg.tar.zst.sig2024-02-03 01:17 119
[PGP]pipewire-jack-client-1:1.0.3-1-x86_64.pkg.tar.zst.sig2024-02-03 01:17 119
[PGP]pipewire-pulse-1:1.0.3-1-x86_64.pkg.tar.zst.sig2024-02-03 01:17 119
[PGP]pipewire-roc-1:1.0.3-1-x86_64.pkg.tar.zst.sig2024-02-03 01:17 119
[PGP]pipewire-session-manager-1:1.0.3-1-x86_64.pkg.tar.zst.sig2024-02-03 01:17 119
[PGP]pipewire-v4l2-1:1.0.3-1-x86_64.pkg.tar.zst.sig2024-02-03 01:17 119
[PGP]pipewire-x11-bell-1:1.0.3-1-x86_64.pkg.tar.zst.sig2024-02-03 01:17 119
[PGP]pipewire-zeroconf-1:1.0.3-1-x86_64.pkg.tar.zst.sig2024-02-03 01:17 119
[PGP]pkcs11-helper-1.30.0-1-x86_64.pkg.tar.zst.sig2023-12-06 01:19 119
[PGP]pkgconf-2.1.0-2-x86_64.pkg.tar.zst.sig2023-12-06 01:14 119
[PGP]platformio-core-6.1.13-1-any.pkg.tar.zst.sig2024-02-01 01:18 119
[PGP]platformio-core-udev-6.1.13-1-any.pkg.tar.zst.sig2024-02-01 01:18 119
[PGP]plocate-1.1.22-1-x86_64.pkg.tar.zst.sig2024-01-14 01:15 119
[PGP]pnetcdf-openmpi-1.12.3-4-x86_64.pkg.tar.zst.sig2024-01-26 01:16 119
[PGP]pngquant-3.0.3-2-x86_64.pkg.tar.zst.sig2023-11-13 01:17 119
[PGP]polkit-124-2-x86_64.pkg.tar.zst.sig2024-02-11 01:15 119
[PGP]polyphone-2.3.0-5-x86_64.pkg.tar.zst.sig2023-12-23 01:15 119
[PGP]portaudio-1:19.7.0-2-x86_64.pkg.tar.zst.sig2023-03-20 01:13 119
[PGP]portmidi-1:2.0.4-1-x86_64.pkg.tar.zst.sig2023-03-20 01:13 119
[PGP]postfix-3.8.5-2-x86_64.pkg.tar.zst.sig2024-01-25 01:14 119
[PGP]postfix-cdb-3.8.5-2-x86_64.pkg.tar.zst.sig2024-01-25 01:14 119
[PGP]postfix-ldap-3.8.5-2-x86_64.pkg.tar.zst.sig2024-01-25 01:14 119
[PGP]postfix-lmdb-3.8.5-2-x86_64.pkg.tar.zst.sig2024-01-25 01:14 119
[PGP]postfix-mysql-3.8.5-2-x86_64.pkg.tar.zst.sig2024-01-25 01:14 119
[PGP]postfix-pcre-3.8.5-2-x86_64.pkg.tar.zst.sig2024-01-25 01:14 119
[PGP]postfix-pgsql-3.8.5-2-x86_64.pkg.tar.zst.sig2024-01-25 01:14 119
[PGP]postfix-sqlite-3.8.5-2-x86_64.pkg.tar.zst.sig2024-01-25 01:14 119
[PGP]postfixadmin-3.3.13-1-any.pkg.tar.zst.sig2023-05-24 03:17 119
[PGP]postorius-1.3.10-1-any.pkg.tar.zst.sig2023-11-01 01:14 119
[PGP]powerdns-4.8.4-1-x86_64.pkg.tar.zst.sig2023-12-22 01:15 119
[PGP]powerdns-recursor-5.0.2-1-x86_64.pkg.tar.zst.sig2024-02-14 01:15 119
[PGP]ppc64le-elf-gdb-13.2-1-x86_64.pkg.tar.zst.sig2023-09-05 02:14 119
[PGP]pppusage-0.2.5-14-any.pkg.tar.zst.sig2023-08-08 02:17 119
[PGP]privoxy-3.0.34-1-x86_64.pkg.tar.zst.sig2023-05-24 03:17 119
[PGP]procps-ng-4.0.4-2-x86_64.pkg.tar.zst.sig2023-09-20 02:13 119
[PGP]procyon-decompiler-0.6.0-3-any.pkg.tar.zst.sig2023-05-24 03:17 119
[PGP]prometheus-ipmi-exporter-1.6.1-2-x86_64.pkg.tar.zst.sig2023-08-22 02:19 119
[PGP]prometheus-ssl-exporter-2.4.2-3-x86_64.pkg.tar.zst.sig2023-09-02 02:15 119
[PGP]proxychains-ng-4.17-1-x86_64.pkg.tar.zst.sig2024-01-22 22:51 119
[PGP]proxytunnel-1.12.0-1-x86_64.pkg.tar.zst.sig2024-01-18 01:16 119
[PGP]prrte-3.0.2-1-x86_64.pkg.tar.zst.sig2023-11-29 01:19 119
[PGP]prrte-3.0.4-2-x86_64.pkg.tar.zst.sig2024-02-25 01:14 119
[PGP]prrte-3.0.4-3-x86_64.pkg.tar.zst.sig2024-02-26 01:15 119
[PGP]prrte-docs-3.0.2-1-x86_64.pkg.tar.zst.sig2023-11-29 01:19 119
[PGP]prrte-docs-3.0.4-2-x86_64.pkg.tar.zst.sig2024-02-25 01:14 119
[PGP]prrte-docs-3.0.4-3-x86_64.pkg.tar.zst.sig2024-02-26 01:15 119
[PGP]psmisc-23.6-1-x86_64.pkg.tar.zst.sig2022-12-14 01:13 119
[PGP]pt2-clone-1.64-1-x86_64.pkg.tar.zst.sig2023-09-10 02:15 119
[PGP]pulse-native-provider-1:1.0.3-1-x86_64.pkg.tar.zst.sig2024-02-03 01:17 119
[PGP]pulseaudio-17.0-3-x86_64.pkg.tar.zst.sig2024-01-18 01:16 119
[PGP]pulseaudio-alsa-1:1.2.7.1-2-x86_64.pkg.tar.zst.sig2023-03-04 01:13 119
[PGP]pulseaudio-bluetooth-17.0-3-x86_64.pkg.tar.zst.sig2024-01-18 01:16 119
[PGP]pulseaudio-equalizer-17.0-3-x86_64.pkg.tar.zst.sig2024-01-18 01:16 119
[PGP]pulseaudio-jack-17.0-3-x86_64.pkg.tar.zst.sig2024-01-18 01:16 119
[PGP]pulseaudio-lirc-17.0-3-x86_64.pkg.tar.zst.sig2024-01-18 01:16 119
[PGP]pulseaudio-rtp-17.0-3-x86_64.pkg.tar.zst.sig2024-01-18 01:16 119
[PGP]pulseaudio-zeroconf-17.0-3-x86_64.pkg.tar.zst.sig2024-01-18 01:16 119
[PGP]pulsemixer-1.5.1-5-any.pkg.tar.zst.sig2023-12-05 01:22 119
[PGP]putty-0.80-1-x86_64.pkg.tar.zst.sig2023-12-21 01:14 119
[PGP]pybind11-2.11.1-2-any.pkg.tar.zst.sig2023-12-09 19:30 119
[PGP]pycharm-community-edition-2023.3.3-1-x86_64.pkg.tar.zst.sig2024-02-01 01:24 119
[PGP]pycharm-community-edition-2023.3.4-1-x86_64.pkg.tar.zst.sig2024-02-27 01:15 119
[PGP]pyenv-1:2.3.36-1-any.pkg.tar.zst.sig2024-02-17 16:20 119
[PGP]pyopencl-headers-1:2023.1-2-x86_64.pkg.tar.zst.sig2023-10-11 02:15 119
[PGP]pypiserver-2.0.1-1-any.pkg.tar.zst.sig2024-01-02 01:14 119
[PGP]pythia8-8.3.09-3-x86_64.pkg.tar.zst.sig2023-05-27 02:14 119
[PGP]python-acme-2.8.0-1-any.pkg.tar.zst.sig2024-01-10 01:14 119
[PGP]python-aiobotocore-2.11.2-1-any.pkg.tar.zst.sig2024-02-07 01:16 119
[PGP]python-aiosqlite-0.19.0-3-any.pkg.tar.zst.sig2023-07-24 02:15 119
[PGP]python-ajsonrpc-1.2.0-3-any.pkg.tar.zst.sig2023-10-19 02:17 119
[PGP]python-annotated-types-0.6.0-1-any.pkg.tar.zst.sig2023-10-29 02:14 119
[PGP]python-antlr4-4.13.1-1-any.pkg.tar.zst.sig2023-10-10 02:14 119
[PGP]python-anyio-4.3.0-1-any.pkg.tar.zst.sig2024-02-25 01:14 119
[PGP]python-anyjson-0.3.3-18-any.pkg.tar.zst.sig2023-05-24 03:18 119
[PGP]python-apeye-1.4.0-1-any.pkg.tar.zst.sig2023-06-21 02:26 119
[PGP]python-apeye-core-1.1.4-1-any.pkg.tar.zst.sig2023-06-21 02:26 119
[PGP]python-appdirs-1.4.4-9-any.pkg.tar.zst.sig2023-09-04 02:15 119
[PGP]python-assertpy-1.1-1-any.pkg.tar.zst.sig2023-12-26 01:15 119
[PGP]python-atpublic-4.0-1-any.pkg.tar.zst.sig2023-06-13 02:17 119
[PGP]python-atspi-2.46.1-1-any.pkg.tar.zst.sig2024-01-07 01:14 119
[PGP]python-audit-4.0-1-x86_64.pkg.tar.zst.sig2024-01-18 01:14 119
[PGP]python-authheaders-0.16.2-1-any.pkg.tar.zst.sig2024-01-24 01:15 119
[PGP]python-autodocsumm-0.2.11-1-any.pkg.tar.zst.sig2023-05-24 03:18 119
[PGP]python-aws-sam-translator-1.85.0-1-any.pkg.tar.zst.sig2024-02-25 01:14 119
[PGP]python-aws-xray-sdk-2.12.1-1-any.pkg.tar.zst.sig2023-10-16 19:01 119
[PGP]python-awscrt-0.19.19-1-x86_64.pkg.tar.zst.sig2023-12-17 01:14 119
[PGP]python-b2sdk-1.26.0-1-any.pkg.tar.zst.sig2023-11-25 01:15 119
[PGP]python-barectf-3.1.1-3-any.pkg.tar.zst.sig2023-07-18 02:14 119
[PGP]python-beautifulsoup4-4.12.2-1-any.pkg.tar.zst.sig2023-05-24 03:19 119
[PGP]python-binaryornot-0.4.4-9-any.pkg.tar.zst.sig2023-09-05 02:14 119
[PGP]python-bincopy-20.0.0-1-any.pkg.tar.zst.sig2023-11-01 01:14 119
[PGP]python-black-23.10.1-1-any.pkg.tar.zst.sig2023-10-24 02:44 119
[PGP]python-black-23.12.1-1-any.pkg.tar.zst.sig2024-01-05 01:15 119
[PGP]python-boto3-1.34.34-1-any.pkg.tar.zst.sig2024-02-07 01:16 119
[PGP]python-botocore-1.34.34-1-any.pkg.tar.zst.sig2024-02-07 01:16 119
[PGP]python-btchip-0.1.32-3-any.pkg.tar.zst.sig2023-05-24 03:19 119
[PGP]python-buildbot-badges-3.11.0-1-any.pkg.tar.zst.sig2024-02-03 01:17 119
[PGP]python-buildbot-console-view-3.11.0-1-any.pkg.tar.zst.sig2024-02-03 01:17 119
[PGP]python-buildbot-grid-view-3.11.0-1-any.pkg.tar.zst.sig2024-02-03 01:17 119
[PGP]python-buildbot-react-console-view-3.11.0-1-any.pkg.tar.zst.sig2024-02-03 01:17 119
[PGP]python-buildbot-react-grid-view-3.11.0-1-any.pkg.tar.zst.sig2024-02-03 01:17 119
[PGP]python-buildbot-react-waterfall-view-3.11.0-1-any.pkg.tar.zst.sig2024-02-03 01:17 119
[PGP]python-buildbot-react-wsgi-dashboards-3.11.0-1-any.pkg.tar.zst.sig2024-02-03 01:17 119
[PGP]python-buildbot-waterfall-view-3.11.0-1-any.pkg.tar.zst.sig2024-02-03 01:17 119
[PGP]python-buildbot-wsgi-dashboards-3.11.0-1-any.pkg.tar.zst.sig2024-02-03 01:17 119
[PGP]python-buildbot-www-3.11.0-1-any.pkg.tar.zst.sig2024-02-03 01:17 119
[PGP]python-buildbot-www-react-3.11.0-1-any.pkg.tar.zst.sig2024-02-03 01:17 119
[PGP]python-calmjs.parse-1.3.1-1-any.pkg.tar.zst.sig2023-10-30 01:45 119
[PGP]python-capng-0.8.4-1-x86_64.pkg.tar.zst.sig2023-12-24 01:14 119
[PGP]python-cerberus-1.3.5-1-any.pkg.tar.zst.sig2023-08-10 02:13 119
[PGP]python-certifi-2024.02.02-1-any.pkg.tar.zst.sig2024-02-07 01:16 119
[PGP]python-cfgv-3.4.0-1-any.pkg.tar.zst.sig2023-08-21 02:14 119
[PGP]python-cfn-lint-0.85.2-1-any.pkg.tar.zst.sig2024-02-25 01:14 119
[PGP]python-cheetah3-3.3.3-1-x86_64.pkg.tar.zst.sig2023-12-01 01:16 119
[PGP]python-cheetah3-docs-3.3.3-1-x86_64.pkg.tar.zst.sig2023-12-01 01:16 119
[PGP]python-click-aliases-1.0.1-2-any.pkg.tar.zst.sig2023-06-08 02:13 119
[PGP]python-click-help-colors-0.9.4-1-any.pkg.tar.zst.sig2023-11-22 01:15 119
[PGP]python-click-option-group-0.5.6-1-any.pkg.tar.zst.sig2023-06-13 02:17 119
[PGP]python-click-repl-0.3.0-1-any.pkg.tar.zst.sig2023-07-26 02:14 119
[PGP]python-cmsis-pack-manager-0.5.3-1-x86_64.pkg.tar.zst.sig2023-12-02 01:17 119
[PGP]python-coloredlogs-15.0.1-4-any.pkg.tar.zst.sig2024-01-18 01:17 119
[PGP]python-configobj-5.0.8-4-any.pkg.tar.zst.sig2023-05-24 03:19 119
[PGP]python-consolekit-1.6.0-1-any.pkg.tar.zst.sig2024-02-01 01:18 119
[PGP]python-cookiecutter-2.6.0-1-any.pkg.tar.zst.sig2024-02-22 01:15 119
[PGP]python-coverage-conditional-plugin-0.9.0-1-any.pkg.tar.zst.sig2023-06-05 02:15 119
[PGP]python-cpplint-1.6.1-3-any.pkg.tar.zst.sig2023-05-24 03:19 119
[PGP]python-crc32c-2.3.post0-1-x86_64.pkg.tar.zst.sig2024-01-02 01:14 119
[PGP]python-crispy-bootstrap3-2024.1-1-any.pkg.tar.zst.sig2024-01-14 01:15 119
[PGP]python-crispy-bootstrap4-2023.1-1-any.pkg.tar.zst.sig2023-10-19 02:17 119
[PGP]python-croniter-2.0.1-1-any.pkg.tar.zst.sig2023-10-16 19:01 119
[PGP]python-css-parser-1.0.9-1-any.pkg.tar.zst.sig2023-05-24 03:19 119
[PGP]python-cython-lint-0.15.0-1-any.pkg.tar.zst.sig2023-05-24 03:19 119
[PGP]python-cytoolz-0.12.3-1-x86_64.pkg.tar.zst.sig2024-01-26 01:15 119
[PGP]python-dbus-next-0.2.3-4-any.pkg.tar.zst.sig2023-05-24 03:19 119
[PGP]python-dbusmock-0.31.1-1-any.pkg.tar.zst.sig2024-02-24 01:15 119
[PGP]python-deepmerge-1.1.1-1-any.pkg.tar.zst.sig2023-12-30 01:15 119
[PGP]python-dep-logic-0.0.4-1-any.pkg.tar.zst.sig2023-12-24 01:16 119
[PGP]python-dep-logic-0.2.0-1-any.pkg.tar.zst.sig2024-02-27 01:14 119
[PGP]python-deprecation-alias-0.3.2-1-any.pkg.tar.zst.sig2023-08-06 02:18 119
[PGP]python-devtools-0.12.2-1-any.pkg.tar.zst.sig2023-10-12 02:13 119
[PGP]python-dict2css-0.3.0-1-any.pkg.tar.zst.sig2023-05-24 03:19 119
[PGP]python-diff-cover-8.0.3-1-any.pkg.tar.zst.sig2024-01-24 01:15 119
[PGP]python-dirty-equals-0.7.1.post0-1-any.pkg.tar.zst.sig2024-02-02 01:16 119
[PGP]python-dist-meta-0.8.0-1-any.pkg.tar.zst.sig2023-05-24 03:19 119
[PGP]python-distlib-0.3.8-1-any.pkg.tar.zst.sig2023-12-29 01:13 119
[PGP]python-django-allauth-0.61.1-1-any.pkg.tar.zst.sig2024-02-11 01:15 119
[PGP]python-django-appconf-1.0.6-1-any.pkg.tar.zst.sig2023-11-22 01:15 119
[PGP]python-django-classy-tags-4.1.0-1-any.pkg.tar.zst.sig2023-07-31 02:14 119
[PGP]python-django-compressor-4.4-1-any.pkg.tar.zst.sig2023-06-30 02:15 119
[PGP]python-django-crispy-forms-2.1-1-any.pkg.tar.zst.sig2023-10-19 02:17 119
[PGP]python-django-environ-0.11.2-1-any.pkg.tar.zst.sig2023-09-06 02:14 119
[PGP]python-django-filter-23.5-1-any.pkg.tar.zst.sig2023-12-06 01:19 119
[PGP]python-django-mailman3-1.3.11-1-any.pkg.tar.zst.sig2023-11-01 01:14 119
[PGP]python-django-sekizai-4.1.0-2-any.pkg.tar.zst.sig2023-05-24 03:19 119
[PGP]python-dom-toml-0.6.1-1-any.pkg.tar.zst.sig2023-05-24 03:19 119
[PGP]python-domdf-python-tools-3.8.0-1-any.pkg.tar.zst.sig2024-02-01 01:18 119
[PGP]python-dunamai-1.18.0-1-any.pkg.tar.zst.sig2023-08-02 02:15 119
[PGP]python-editables-0.5-1-any.pkg.tar.zst.sig2023-08-10 02:13 119
[PGP]python-falcon-3.1.3-1-x86_64.pkg.tar.zst.sig2023-12-06 01:19 119
[PGP]python-fastapi-0.109.2-1-any.pkg.tar.zst.sig2024-02-08 01:17 119
[PGP]python-fastapi-0.110.0-1-any.pkg.tar.zst.sig2024-02-27 01:14 119
[PGP]python-fastjsonschema-2.19.1-1-any.pkg.tar.zst.sig2023-12-30 01:15 119
[PGP]python-fastnumbers-5.1.0-1-x86_64.pkg.tar.zst.sig2023-12-01 01:16 119
[PGP]python-fido2-1.1.2-1-any.pkg.tar.zst.sig2023-08-05 02:14 119
[PGP]python-findpython-0.4.1-1-any.pkg.tar.zst.sig2023-12-07 16:44 119
[PGP]python-fire-0.5.0-2-any.pkg.tar.zst.sig2023-05-24 03:19 119
[PGP]python-flake8-docstrings-1.7.0-1-any.pkg.tar.zst.sig2023-05-24 03:19 119
[PGP]python-flasgger-0.9.7.1-1-any.pkg.tar.zst.sig2023-09-05 02:14 119
[PGP]python-flask-cors-4.0.0-1-any.pkg.tar.zst.sig2023-07-08 02:15 119
[PGP]python-flit-3.9.0-1-any.pkg.tar.zst.sig2023-05-24 03:19 119
[PGP]python-flit-core-3.9.0-1-any.pkg.tar.zst.sig2023-05-24 03:19 119
[PGP]python-flit-core-3.9.0-2-any.pkg.tar.zst.sig2024-02-26 01:15 119
[PGP]python-flufl-lock-8.0.2-1-any.pkg.tar.zst.sig2023-07-24 02:15 119
[PGP]python-flufl.i18n-5.0.1-1-any.pkg.tar.zst.sig2023-06-30 02:15 119
[PGP]python-flufl.i18n-5.0.2-1-any.pkg.tar.zst.sig2023-07-24 02:15 119
[PGP]python-freezegun-1.4.0-1-any.pkg.tar.zst.sig2024-02-01 01:18 119
[PGP]python-gdal-3.8.4-1-x86_64.pkg.tar.zst.sig2024-02-25 01:14 119
[PGP]python-gitdb-1:4.0.11-1-any.pkg.tar.zst.sig2023-11-01 01:14 119
[PGP]python-gitpython-3.1.42-1-any.pkg.tar.zst.sig2024-02-17 16:20 119
[PGP]python-gnupg-0.5.2-1-any.pkg.tar.zst.sig2023-12-15 01:15 119
[PGP]python-gobject-3.47.0-1-x86_64.pkg.tar.zst.sig2024-02-17 16:20 119
[PGP]python-gobject-docs-3.47.0-1-x86_64.pkg.tar.zst.sig2024-02-17 16:20 119
[PGP]python-gpgme-1.23.2-1-x86_64.pkg.tar.zst.sig2023-11-29 01:15 119
[PGP]python-greenlet-3.0.3-1-x86_64.pkg.tar.zst.sig2024-02-24 01:15 119
[PGP]python-grequests-0.7.0-1-any.pkg.tar.zst.sig2023-08-02 02:15 119
[PGP]python-grpcio-1.62.0-1-x86_64.pkg.tar.zst.sig2024-02-22 01:15 119
[PGP]python-grpcio-tools-1.62.0-1-x86_64.pkg.tar.zst.sig2024-02-22 01:15 119
[PGP]python-guessit-3.8.0-1-any.pkg.tar.zst.sig2024-02-01 01:18 119
[PGP]python-h5py-openmpi-3.10.0-3-x86_64.pkg.tar.zst.sig2024-01-26 01:16 119
[PGP]python-hachoir-3.2.0-3-any.pkg.tar.zst.sig2023-08-10 02:13 119
[PGP]python-handy-archives-0.2.0-1-any.pkg.tar.zst.sig2023-09-26 02:14 119
[PGP]python-hatch-fancy-pypi-readme-24.1.0-1-any.pkg.tar.zst.sig2024-02-01 01:18 119
[PGP]python-hatch-requirements-txt-0.4.1-1-any.pkg.tar.zst.sig2024-02-01 01:18 119
[PGP]python-hatchling-1.21.1-2-any.pkg.tar.zst.sig2024-02-26 01:15 119
[PGP]python-hsluv-5.0.4-1-any.pkg.tar.zst.sig2023-09-16 02:39 119
[PGP]python-httpcore-1.0.2-2-any.pkg.tar.zst.sig2023-12-13 18:43 119
[PGP]python-httplib2-0.22.0-4-any.pkg.tar.zst.sig2023-07-19 02:24 119
[PGP]python-httpx-0.26.0-1-any.pkg.tar.zst.sig2024-01-06 01:15 119
[PGP]python-hvac-2.1.0-1-any.pkg.tar.zst.sig2024-01-20 01:26 119
[PGP]python-hypothesis-6.98.11-1-any.pkg.tar.zst.sig2024-02-25 01:14 119
[PGP]python-hypothesis-6.98.12-1-any.pkg.tar.zst.sig2024-02-27 01:14 119
[PGP]python-identify-2.5.35-1-any.pkg.tar.zst.sig2024-02-20 01:13 119
[PGP]python-iminuit-2.21.3-1-x86_64.pkg.tar.zst.sig2023-05-24 03:19 119
[PGP]python-iminuit-docs-2.21.3-1-x86_64.pkg.tar.zst.sig2023-05-24 03:19 119
[PGP]python-importlib_resources-6.1.1-1-any.pkg.tar.zst.sig2023-11-10 01:14 119
[PGP]python-importlib_resources-6.1.2-1-any.pkg.tar.zst.sig2024-02-27 01:14 119
[PGP]python-inflect-7.0.0-2-any.pkg.tar.zst.sig2023-09-17 02:15 119
[PGP]python-inflect-7.0.0-3-any.pkg.tar.zst.sig2024-02-25 01:14 119
[PGP]python-installer-0.7.0-4-any.pkg.tar.zst.sig2024-02-26 01:15 119
[PGP]python-iso8601-2.1.0-1-any.pkg.tar.zst.sig2023-10-07 02:14 119
[PGP]python-jaraco.classes-3.3.1-1-any.pkg.tar.zst.sig2024-02-14 01:15 119
[PGP]python-jaraco.functools-4.0.0-1-any.pkg.tar.zst.sig2024-01-22 22:53 119
[PGP]python-jaraco.itertools-6.4.1-1-any.pkg.tar.zst.sig2023-07-26 02:14 119
[PGP]python-jaraco.logging-3.3.0-1-any.pkg.tar.zst.sig2023-12-30 01:15 119
[PGP]python-jaraco.text-3.12.0-1-any.pkg.tar.zst.sig2024-01-05 01:15 119
[PGP]python-johnnycanencrypt-0.14.1-1-x86_64.pkg.tar.zst.sig2023-09-20 02:16 119
[PGP]python-josepy-1.14.0-1-any.pkg.tar.zst.sig2023-11-04 01:13 119
[PGP]python-jsonschema-4.21.1-1-any.pkg.tar.zst.sig2024-02-01 01:18 119
[PGP]python-jsonschema-path-0.3.2-2-any.pkg.tar.zst.sig2023-11-20 01:16 119
[PGP]python-jsonschema-spec-0.2.3-1-any.pkg.tar.zst.sig2023-07-20 02:14 119
[PGP]python-jsonschema-specifications-2023.12.1-1-any.pkg.tar.zst.sig2023-12-29 01:13 119
[PGP]python-jwcrypto-1.5.4-1-any.pkg.tar.zst.sig2024-02-15 01:14 119
[PGP]python-kaptan-0.6.0-1-any.pkg.tar.zst.sig2023-09-05 02:14 119
[PGP]python-kazoo-2.10.0-1-any.pkg.tar.zst.sig2024-02-02 01:15 119
[PGP]python-klein-23.12.0-1-any.pkg.tar.zst.sig2024-01-14 01:15 119
[PGP]python-lark-parser-1.1.9-1-any.pkg.tar.zst.sig2024-02-01 01:18 119
[PGP]python-lazr.config-3.0-2-any.pkg.tar.zst.sig2023-05-24 03:19 119
[PGP]python-levenshtein-0.23.0-1-x86_64.pkg.tar.zst.sig2023-10-24 02:44 119
[PGP]python-libblockdev-3.0.4-3-x86_64.pkg.tar.zst.sig2024-02-23 01:17 119
[PGP]python-libblockdev-3.1.0-1-x86_64.pkg.tar.zst.sig2024-02-24 01:15 119
[PGP]python-libcst-0.4.9-4-x86_64.pkg.tar.zst.sig2023-05-24 03:19 119
[PGP]python-libtmux-0.31.0.post0-1-any.pkg.tar.zst.sig2024-02-18 01:14 119
[PGP]python-license-expression-30.2.0-1-any.pkg.tar.zst.sig2023-12-29 01:13 119
[PGP]python-lilv-0.24.24-1-x86_64.pkg.tar.zst.sig2024-01-25 01:14 119
[PGP]python-linux-procfs-0.7.3-1-any.pkg.tar.zst.sig2023-11-15 01:16 119
[PGP]python-litepcie-2021.08-3-any.pkg.tar.zst.sig2023-05-24 03:19 119
[PGP]python-litex-2021.08-3-any.pkg.tar.zst.sig2023-05-24 03:19 119
[PGP]python-logfury-1.0.1-4-any.pkg.tar.zst.sig2023-05-24 03:19 119
[PGP]python-loguru-0.7.2-1-any.pkg.tar.zst.sig2023-09-12 02:16 119
[PGP]python-magic-1:0.4.27-3-any.pkg.tar.zst.sig2023-05-24 03:19 119
[PGP]python-mailmanclient-3.3.5-3-any.pkg.tar.zst.sig2023-07-27 02:15 119
[PGP]python-manuel-1.12.4-4-any.pkg.tar.zst.sig2023-05-24 03:19 119
[PGP]python-matrix-common-1.3.0-4-any.pkg.tar.zst.sig2023-09-17 02:15 119
[PGP]python-maturin-1.4.0-1-x86_64.pkg.tar.zst.sig2023-12-05 01:22 119
[PGP]python-mediafire-0.6.1-1-any.pkg.tar.zst.sig2023-05-24 03:19 119
[PGP]python-micawber-0.5.5-1-any.pkg.tar.zst.sig2023-06-26 02:14 119
[PGP]python-migen-0.9.2-7-any.pkg.tar.zst.sig2023-05-24 03:20 119
[PGP]python-minio-7.2.0-1-any.pkg.tar.zst.sig2023-12-17 01:14 119
[PGP]python-mistletoe-1.3.0-1-any.pkg.tar.zst.sig2024-02-01 01:18 119
[PGP]python-more-itertools-10.1.0-1-any.pkg.tar.zst.sig2023-08-11 02:14 119
[PGP]python-moto-4.2.13-1-any.pkg.tar.zst.sig2024-01-21 01:15 119
[PGP]python-mpi4py-3.1.5-2-x86_64.pkg.tar.zst.sig2024-01-26 01:16 119
[PGP]python-mutagen-1.47.0-1-any.pkg.tar.zst.sig2023-09-06 02:14 119
[PGP]python-mysql-connector-8.3.0-2-any.pkg.tar.zst.sig2024-01-19 01:16 119
[PGP]python-natsort-8.4.0-1-any.pkg.tar.zst.sig2023-06-26 02:14 119
[PGP]python-nbdime-4.0.1-1-any.pkg.tar.zst.sig2024-01-09 01:14 119
[PGP]python-nbval-0.10.0-5-any.pkg.tar.zst.sig2023-05-24 03:20 119
[PGP]python-netcdf4-openmpi-1.6.5-2-x86_64.pkg.tar.zst.sig2024-01-26 01:16 119
[PGP]python-nethsm-sdk-py-1.0.0-1-any.pkg.tar.zst.sig2023-12-02 01:17 119
[PGP]python-nose-1.3.7-15-any.pkg.tar.zst.sig2023-04-08 02:15 119
[PGP]python-nose2-0.14.1-1-any.pkg.tar.zst.sig2024-02-02 01:15 119
[PGP]python-onnx-1:1.15.0-3-x86_64.pkg.tar.zst.sig2024-01-18 01:17 119
[PGP]python-onnxruntime-1.16.3-6-x86_64.pkg.tar.zst.sig2024-02-21 01:15 119
[PGP]python-onnxruntime-opt-1.16.3-6-x86_64.pkg.tar.zst.sig2024-02-21 01:15 119
[PGP]python-onnxruntime-opt-rocm-1.16.3-6-x86_64.pkg.tar.zst.sig2024-02-21 01:15 119
[PGP]python-onnxruntime-rocm-1.16.3-6-x86_64.pkg.tar.zst.sig2024-02-21 01:15 119
[PGP]python-openapi-schema-validator-0.6.2-1-any.pkg.tar.zst.sig2023-10-11 02:15 119
[PGP]python-openapi-spec-validator-0.7.1-1-any.pkg.tar.zst.sig2023-11-20 01:17 119
[PGP]python-openpyxl-3.1.2-3-any.pkg.tar.zst.sig2023-07-02 02:21 119
[PGP]python-orjson-3.9.15-1-x86_64.pkg.tar.zst.sig2024-02-25 01:14 119
[PGP]python-osc-1.8.3-1-any.pkg.tar.zst.sig2023-08-10 02:13 119
[PGP]python-oyaml-1.1-1-any.pkg.tar.zst.sig2023-10-22 02:14 119
[PGP]python-papermill-2.5.0-1-any.pkg.tar.zst.sig2024-02-27 01:14 119
[PGP]python-pdm-2.12.1-1-any.pkg.tar.zst.sig2024-01-18 01:16 119
[PGP]python-pdm-2.12.3-1-any.pkg.tar.zst.sig2024-02-02 01:15 119
[PGP]python-pdm-2.12.4-1-any.pkg.tar.zst.sig2024-02-27 01:14 119
[PGP]python-pdm-backend-2.1.8-1-any.pkg.tar.zst.sig2023-12-30 01:15 119
[PGP]python-pdm-backend-2.1.8-2-any.pkg.tar.zst.sig2024-02-26 01:15 119
[PGP]python-pdm-pep517-1:1.1.4-4-any.pkg.tar.zst.sig2023-05-24 03:20 119
[PGP]python-pendulum-3.0.0-1-x86_64.pkg.tar.zst.sig2024-01-02 01:15 119
[PGP]python-pg8000-1.30.4-1-any.pkg.tar.zst.sig2024-02-15 01:14 119
[PGP]python-pilkit-3.0-1-any.pkg.tar.zst.sig2023-10-28 02:14 119
[PGP]python-pillow-10.2.0-1-x86_64.pkg.tar.zst.sig2024-01-10 01:14 119
[PGP]python-pillow-10.2.0-2-x86_64.pkg.tar.zst.sig2024-02-26 01:15 119
[PGP]python-pivy-0.6.9.a0-1-x86_64.pkg.tar.zst.sig2024-02-27 01:15 119
[PGP]python-platformdirs-4.1.0-1-any.pkg.tar.zst.sig2023-12-06 01:19 119
[PGP]python-poetry-core-1.9.0-2-any.pkg.tar.zst.sig2024-02-26 01:15 119
[PGP]python-poetry-dynamic-versioning-1.1.0-1-any.pkg.tar.zst.sig2023-10-16 19:01 119
[PGP]python-poetry-dynamic-versioning-1.2.0-1-any.pkg.tar.zst.sig2023-12-29 01:13 119
[PGP]python-progressbar-4.3.2-1-any.pkg.tar.zst.sig2023-12-26 01:15 119
[PGP]python-progressbar-4.4.1-1-any.pkg.tar.zst.sig2024-02-27 01:14 119
[PGP]python-psycopg-3.1.17-1-any.pkg.tar.zst.sig2024-02-01 01:18 119
[PGP]python-psycopg-pool-3.2.1-1-any.pkg.tar.zst.sig2024-02-01 01:18 119
[PGP]python-puremagic-1.15-1-any.pkg.tar.zst.sig2023-05-24 03:20 119
[PGP]python-py-1.11.0-4-any.pkg.tar.zst.sig2023-05-24 03:20 119
[PGP]python-py-partiql-parser-0.5.0-1-any.pkg.tar.zst.sig2023-12-24 01:16 119
[PGP]python-pyalsa-1.2.7-4-x86_64.pkg.tar.zst.sig2023-05-24 03:20 119
[PGP]python-pyaudio-0.2.14-2-x86_64.pkg.tar.zst.sig2023-12-17 01:14 119
[PGP]python-pycapnp-2.0.0b2-2-x86_64.pkg.tar.zst.sig2024-02-21 01:15 119
[PGP]python-pydantic-2.6.2-2-any.pkg.tar.zst.sig2024-02-25 01:14 119
[PGP]python-pydantic-core-1:2.16.3-1-x86_64.pkg.tar.zst.sig2024-02-25 01:14 119
[PGP]python-pydantic-extra-types-2.5.0-1-any.pkg.tar.zst.sig2024-02-02 01:16 119
[PGP]python-pydantic-settings-2.2.1-1-any.pkg.tar.zst.sig2024-02-21 01:15 119
[PGP]python-pydrive2-1.17.0-1-any.pkg.tar.zst.sig2023-11-04 01:13 119
[PGP]python-pyftdi-0.55.0-1-any.pkg.tar.zst.sig2023-08-11 02:14 119
[PGP]python-pyhcl-0.4.5-1-any.pkg.tar.zst.sig2023-09-10 02:15 119
[PGP]python-pylibiio-0.25-2-x86_64.pkg.tar.zst.sig2023-09-25 02:15 119
[PGP]python-pyliblo-0.10.0-11-x86_64.pkg.tar.zst.sig2023-05-24 03:20 119
[PGP]python-pylink-square-1.2.0-1-any.pkg.tar.zst.sig2023-07-30 02:14 119
[PGP]python-pymediainfo-6.1.0-2-any.pkg.tar.zst.sig2023-12-07 16:44 119
[PGP]python-pymupdf-1.23.25-2-x86_64.pkg.tar.zst.sig2024-02-27 01:15 119
[PGP]python-pymysql-1.1.0-1-any.pkg.tar.zst.sig2023-06-30 02:15 119
[PGP]python-pynamodb-5.5.1-1-any.pkg.tar.zst.sig2023-12-24 01:16 119
[PGP]python-pynitrokey-0.4.45-1-any.pkg.tar.zst.sig2024-01-25 01:14 119
[PGP]python-pyocd-0.36.0-1-any.pkg.tar.zst.sig2023-12-09 19:30 119
[PGP]python-pyopencl-1:2023.1-2-x86_64.pkg.tar.zst.sig2023-10-11 02:15 119
[PGP]python-pyopenssl-24.0.0-1-any.pkg.tar.zst.sig2024-02-01 01:18 119
[PGP]python-pyproject-api-1.6.1-1-any.pkg.tar.zst.sig2023-08-31 02:13 119
[PGP]python-pyproject-parser-0.9.1-1-any.pkg.tar.zst.sig2023-09-27 02:14 119
[PGP]python-pysaml2-7.5.0-1-any.pkg.tar.zst.sig2024-02-23 01:17 119
[PGP]python-pyscard-2.0.7-1-x86_64.pkg.tar.zst.sig2023-05-24 03:20 119
[PGP]python-pysequoia-0.1.22-1-x86_64.pkg.tar.zst.sig2023-12-02 01:17 119
[PGP]python-pysnmp-4.4.12-7-any.pkg.tar.zst.sig2023-09-05 02:14 119
[PGP]python-pytest-env-1.1.3-1-any.pkg.tar.zst.sig2024-02-15 01:14 119
[PGP]python-pytest-examples-0.0.10-1-any.pkg.tar.zst.sig2023-07-14 02:15 119
[PGP]python-pytest-freezer-0.4.8-1-any.pkg.tar.zst.sig2023-08-06 02:18 119
[PGP]python-pytest-html-4.1.1-1-any.pkg.tar.zst.sig2023-12-26 01:15 119
[PGP]python-pytest-httpserver-1.0.9-1-any.pkg.tar.zst.sig2024-02-14 01:15 119
[PGP]python-pytest-httpserver-1.0.10-1-any.pkg.tar.zst.sig2024-02-27 01:14 119
[PGP]python-pytest-metadata-3.1.1-1-any.pkg.tar.zst.sig2024-02-17 16:20 119
[PGP]python-pytest-pretty-1.2.0-1-any.pkg.tar.zst.sig2023-07-14 02:15 119
[PGP]python-pytest-pylint-0.21.0-1-any.pkg.tar.zst.sig2023-11-04 01:13 119
[PGP]python-pytest-rerunfailures-13.0-1-any.pkg.tar.zst.sig2023-11-24 01:16 119
[PGP]python-pytest-shell-utilities-1.9.0-1-any.pkg.tar.zst.sig2024-02-25 01:14 119
[PGP]python-pytest-skip-markers-1.5.1-1-any.pkg.tar.zst.sig2024-01-05 01:15 119
[PGP]python-pytest-testinfra-10.1.0-1-any.pkg.tar.zst.sig2024-02-19 01:17 119
[PGP]python-pytest-xprocess-0.23.0-1-any.pkg.tar.zst.sig2023-09-24 02:13 119
[PGP]python-pythia8-8.3.09-3-x86_64.pkg.tar.zst.sig2023-05-27 02:14 119
[PGP]python-pythonfinder-2.1.0-1-any.pkg.tar.zst.sig2024-02-02 01:15 119
[PGP]python-pytoolconfig-1.2.5-3-any.pkg.tar.zst.sig2023-09-17 02:15 119
[PGP]python-pywayland-0.4.17-1-x86_64.pkg.tar.zst.sig2023-11-01 01:14 119
[PGP]python-pyzmq-25.1.2-1-x86_64.pkg.tar.zst.sig2023-12-29 01:13 119
[PGP]python-qt-material-2.14-1-any.pkg.tar.zst.sig2023-05-24 03:20 119
[PGP]python-rapidfuzz-3.6.0-1-x86_64.pkg.tar.zst.sig2023-12-29 01:13 119
[PGP]python-rcssmin-1.1.2-1-x86_64.pkg.tar.zst.sig2023-10-05 02:15 119
[PGP]python-redis-5.0.1-1-any.pkg.tar.zst.sig2023-11-04 01:13 119
[PGP]python-referencing-0.33.0-1-any.pkg.tar.zst.sig2024-02-01 01:18 119
[PGP]python-regress-0.4.5-1-x86_64.pkg.tar.zst.sig2023-12-07 16:44 119
[PGP]python-resolvelib-1.0.1-1-any.pkg.tar.zst.sig2023-04-12 02:13 119
[PGP]python-rjsmin-1.2.2-1-x86_64.pkg.tar.zst.sig2023-10-06 02:17 119
[PGP]python-rpds-py-0.17.1-1-x86_64.pkg.tar.zst.sig2024-02-01 01:18 119
[PGP]python-rsa-4.9-3-any.pkg.tar.zst.sig2023-12-17 01:14 119
[PGP]python-rtmidi-1.5.5-1-x86_64.pkg.tar.zst.sig2023-07-30 02:14 119
[PGP]python-s3transfer-0.10.0-1-any.pkg.tar.zst.sig2024-01-21 01:15 119
[PGP]python-saml-1.16.0-1-any.pkg.tar.zst.sig2023-11-01 01:14 119
[PGP]python-scramp-1.4.4-3-any.pkg.tar.zst.sig2023-07-29 02:14 119
[PGP]python-setproctitle-1.3.3-1-x86_64.pkg.tar.zst.sig2023-10-07 02:14 119
[PGP]python-setuptools-1:69.0.3-4-any.pkg.tar.zst.sig2024-02-26 01:15 119
[PGP]python-shippinglabel-1.7.1-1-any.pkg.tar.zst.sig2024-02-01 01:18 119
[PGP]python-shodan-1.31.0-1-any.pkg.tar.zst.sig2024-02-01 01:18 119
[PGP]python-shtab-1.6.5-1-any.pkg.tar.zst.sig2023-12-29 01:13 119
[PGP]python-simple-term-menu-1.6.4-1-any.pkg.tar.zst.sig2023-12-20 01:15 119
[PGP]python-smmap-1:5.0.1-1-any.pkg.tar.zst.sig2023-09-20 02:16 119
[PGP]python-soupsieve-2.5-1-any.pkg.tar.zst.sig2023-09-05 02:14 119
[PGP]python-sphinx-click-5.1.0-1-any.pkg.tar.zst.sig2023-11-24 01:16 119
[PGP]python-sphinx-lv2-theme-1.4.2-1-any.pkg.tar.zst.sig2023-10-28 02:14 119
[PGP]python-sphinx-prompt-1.8.0-1-any.pkg.tar.zst.sig2023-09-17 02:15 119
[PGP]python-sphinx-sitemap-2.5.1-1-any.pkg.tar.zst.sig2023-12-25 01:26 119
[PGP]python-sphinx-tabs-3.4.5-1-any.pkg.tar.zst.sig2024-02-01 01:18 119
[PGP]python-sphinxygen-1.0.4-1-any.pkg.tar.zst.sig2023-10-26 02:27 119
[PGP]python-spsdk-1.11.0-1-any.pkg.tar.zst.sig2023-07-31 02:14 119
[PGP]python-starlette-0.37.1-1-any.pkg.tar.zst.sig2024-02-19 01:17 119
[PGP]python-stone-3.3.1-3-any.pkg.tar.zst.sig2023-05-24 03:20 119
[PGP]python-structlog-24.1.0-1-any.pkg.tar.zst.sig2024-01-13 01:14 119
[PGP]python-textual-0.52.1-1-any.pkg.tar.zst.sig2024-02-21 01:15 119
[PGP]python-tiny-proxy-0.2.1-1-any.pkg.tar.zst.sig2023-11-10 01:14 119
[PGP]python-toolz-0.12.1-1-any.pkg.tar.zst.sig2024-01-25 01:14 119
[PGP]python-torrentool-1.2.0-1-any.pkg.tar.zst.sig2023-06-13 02:17 119
[PGP]python-tpm2-pytss-2.1.0-2-x86_64.pkg.tar.zst.sig2023-07-25 02:13 119
[PGP]python-treq-23.11.0-1-any.pkg.tar.zst.sig2023-11-10 01:14 119
[PGP]python-truststore-0.8.0-2-any.pkg.tar.zst.sig2023-12-24 01:16 119
[PGP]python-tzdata-2024.1-1-any.pkg.tar.zst.sig2024-02-17 16:20 119
[PGP]python-ujson-5.9.0-1-x86_64.pkg.tar.zst.sig2023-12-16 01:14 119
[PGP]python-ulid-2.2.0-2-any.pkg.tar.zst.sig2024-01-02 01:14 119
[PGP]python-unearth-0.14.0-1-any.pkg.tar.zst.sig2024-01-17 01:20 119
[PGP]python-unidiff-0.7.5-2-any.pkg.tar.zst.sig2023-05-24 03:20 119
[PGP]python-uri-template-1.3.0-1-any.pkg.tar.zst.sig2023-08-02 02:15 119
[PGP]python-urllib3-1.26.18-1-any.pkg.tar.zst.sig2023-11-22 01:15 119
[PGP]python-urllib3-doc-1.26.18-1-any.pkg.tar.zst.sig2023-11-22 01:15 119
[PGP]python-utils-3.8.2-1-any.pkg.tar.zst.sig2024-01-26 01:15 119
[PGP]python-versioneer-0.29-1-any.pkg.tar.zst.sig2023-07-11 02:13 119
[PGP]python-virtualenv-20.25.0-1-any.pkg.tar.zst.sig2023-12-12 01:14 119
[PGP]python-volume_key-0.3.12-8-x86_64.pkg.tar.zst.sig2023-04-09 02:16 119
[PGP]python-wcwidth-0.2.13-1-any.pkg.tar.zst.sig2024-02-01 01:18 119
[PGP]python-websocket-client-1.7.0-1-any.pkg.tar.zst.sig2023-12-07 16:44 119
[PGP]python-wheezy-template-3.1.0-5-x86_64.pkg.tar.zst.sig2023-05-24 03:20 119
[PGP]python-whey-0.0.24-1-any.pkg.tar.zst.sig2023-05-24 03:20 119
[PGP]python-xapian-haystack-3.1.0-1-any.pkg.tar.zst.sig2023-06-02 02:15 119
[PGP]python-xlsxwriter-3.1.9-1-any.pkg.tar.zst.sig2023-11-13 01:17 119
[PGP]python-xmlschema-1:2.5.1-1-any.pkg.tar.zst.sig2024-02-23 01:17 119
[PGP]python-yaml-6.0.1-2-x86_64.pkg.tar.zst.sig2023-07-29 02:14 119
[PGP]python-zita-audiotools-1.3.0-4-x86_64.pkg.tar.zst.sig2023-05-24 03:20 119
[PGP]python-zita-jacktools-1.6.1-2-x86_64.pkg.tar.zst.sig2023-05-24 03:20 119
[PGP]python-zope-component-6.0-1-any.pkg.tar.zst.sig2023-05-24 03:20 119
[PGP]python-zopfli-0.2.3-1-x86_64.pkg.tar.zst.sig2023-09-10 02:15 119
[PGP]qastools-1.4.0-1-x86_64.pkg.tar.zst.sig2024-02-18 01:14 119
[PGP]qbe-1.1-1-x86_64.pkg.tar.zst.sig2023-05-24 03:20 119
[PGP]qcad-3.29.4.1-1-x86_64.pkg.tar.zst.sig2024-02-08 01:16 119
[PGP]qemu-audio-alsa-8.0.2-1-x86_64.pkg.tar.zst.sig2023-06-04 02:14 119
[PGP]qemu-audio-alsa-8.2.1-2-x86_64.pkg.tar.zst.sig2024-02-06 01:15 119
[PGP]qemu-audio-dbus-8.0.2-1-x86_64.pkg.tar.zst.sig2023-06-04 02:14 119
[PGP]qemu-audio-dbus-8.2.1-2-x86_64.pkg.tar.zst.sig2024-02-06 01:15 119
[PGP]qemu-audio-jack-8.0.2-1-x86_64.pkg.tar.zst.sig2023-06-04 02:14 119
[PGP]qemu-audio-jack-8.2.1-2-x86_64.pkg.tar.zst.sig2024-02-06 01:15 119
[PGP]qemu-audio-oss-8.0.2-1-x86_64.pkg.tar.zst.sig2023-06-04 02:14 119
[PGP]qemu-audio-oss-8.2.1-2-x86_64.pkg.tar.zst.sig2024-02-06 01:15 119
[PGP]qemu-audio-pa-8.0.2-1-x86_64.pkg.tar.zst.sig2023-06-04 02:14 119
[PGP]qemu-audio-pa-8.2.1-2-x86_64.pkg.tar.zst.sig2024-02-06 01:15 119
[PGP]qemu-audio-pipewire-8.2.1-2-x86_64.pkg.tar.zst.sig2024-02-06 01:15 119
[PGP]qemu-audio-sdl-8.0.2-1-x86_64.pkg.tar.zst.sig2023-06-04 02:14 119
[PGP]qemu-audio-sdl-8.2.1-2-x86_64.pkg.tar.zst.sig2024-02-06 01:15 119
[PGP]qemu-audio-spice-8.0.2-1-x86_64.pkg.tar.zst.sig2023-06-04 02:14 119
[PGP]qemu-audio-spice-8.2.1-2-x86_64.pkg.tar.zst.sig2024-02-06 01:15 119
[PGP]qemu-base-8.0.2-1-x86_64.pkg.tar.zst.sig2023-06-04 02:14 119
[PGP]qemu-base-8.2.1-2-x86_64.pkg.tar.zst.sig2024-02-06 01:15 119
[PGP]qemu-block-curl-8.0.2-1-x86_64.pkg.tar.zst.sig2023-06-04 02:14 119
[PGP]qemu-block-curl-8.2.1-2-x86_64.pkg.tar.zst.sig2024-02-06 01:15 119
[PGP]qemu-block-dmg-8.0.2-1-x86_64.pkg.tar.zst.sig2023-06-04 02:14 119
[PGP]qemu-block-dmg-8.2.1-2-x86_64.pkg.tar.zst.sig2024-02-06 01:15 119
[PGP]qemu-block-gluster-8.0.2-1-x86_64.pkg.tar.zst.sig2023-06-04 02:14 119
[PGP]qemu-block-gluster-8.2.1-2-x86_64.pkg.tar.zst.sig2024-02-06 01:15 119
[PGP]qemu-block-iscsi-8.0.2-1-x86_64.pkg.tar.zst.sig2023-06-04 02:14 119
[PGP]qemu-block-iscsi-8.2.1-2-x86_64.pkg.tar.zst.sig2024-02-06 01:15 119
[PGP]qemu-block-nfs-8.0.2-1-x86_64.pkg.tar.zst.sig2023-06-04 02:14 119
[PGP]qemu-block-nfs-8.2.1-2-x86_64.pkg.tar.zst.sig2024-02-06 01:15 119
[PGP]qemu-block-ssh-8.0.2-1-x86_64.pkg.tar.zst.sig2023-06-04 02:14 119
[PGP]qemu-block-ssh-8.2.1-2-x86_64.pkg.tar.zst.sig2024-02-06 01:15 119
[PGP]qemu-chardev-baum-8.0.2-1-x86_64.pkg.tar.zst.sig2023-06-04 02:14 119
[PGP]qemu-chardev-baum-8.2.1-2-x86_64.pkg.tar.zst.sig2024-02-06 01:15 119
[PGP]qemu-chardev-spice-8.0.2-1-x86_64.pkg.tar.zst.sig2023-06-04 02:14 119
[PGP]qemu-chardev-spice-8.2.1-2-x86_64.pkg.tar.zst.sig2024-02-06 01:15 119
[PGP]qemu-common-8.0.2-1-x86_64.pkg.tar.zst.sig2023-06-04 02:14 119
[PGP]qemu-common-8.2.1-2-x86_64.pkg.tar.zst.sig2024-02-06 01:15 119
[PGP]qemu-desktop-8.0.2-1-x86_64.pkg.tar.zst.sig2023-06-04 02:14 119
[PGP]qemu-desktop-8.2.1-2-x86_64.pkg.tar.zst.sig2024-02-06 01:15 119
[PGP]qemu-docs-8.0.2-1-x86_64.pkg.tar.zst.sig2023-06-04 02:14 119
[PGP]qemu-docs-8.2.1-2-x86_64.pkg.tar.zst.sig2024-02-06 01:15 119
[PGP]qemu-emulators-full-8.0.2-1-x86_64.pkg.tar.zst.sig2023-06-04 02:14 119
[PGP]qemu-emulators-full-8.2.1-2-x86_64.pkg.tar.zst.sig2024-02-06 01:15 119
[PGP]qemu-full-8.0.2-1-x86_64.pkg.tar.zst.sig2023-06-04 02:14 119
[PGP]qemu-full-8.2.1-2-x86_64.pkg.tar.zst.sig2024-02-06 01:15 119
[PGP]qemu-guest-agent-8.0.2-1-x86_64.pkg.tar.zst.sig2023-06-04 02:14 119
[PGP]qemu-guest-agent-8.2.1-2-x86_64.pkg.tar.zst.sig2024-02-06 01:15 119
[PGP]qemu-hw-display-qxl-8.0.2-1-x86_64.pkg.tar.zst.sig2023-06-04 02:14 119
[PGP]qemu-hw-display-qxl-8.2.1-2-x86_64.pkg.tar.zst.sig2024-02-06 01:15 119
[PGP]qemu-hw-display-virtio-gpu-8.0.2-1-x86_64.pkg.tar.zst.sig2023-06-04 02:14 119
[PGP]qemu-hw-display-virtio-gpu-8.2.1-2-x86_64.pkg.tar.zst.sig2024-02-06 01:15 119
[PGP]qemu-hw-display-virtio-gpu-gl-8.2.1-2-x86_64.pkg.tar.zst.sig2024-02-06 01:15 119
[PGP]qemu-hw-display-virtio-gpu-pci-8.0.2-1-x86_64.pkg.tar.zst.sig2023-06-04 02:14 119
[PGP]qemu-hw-display-virtio-gpu-pci-8.2.1-2-x86_64.pkg.tar.zst.sig2024-02-06 01:15 119
[PGP]qemu-hw-display-virtio-gpu-pci-gl-8.0.2-1-x86_64.pkg.tar.zst.sig2023-06-04 02:14 119
[PGP]qemu-hw-display-virtio-gpu-pci-gl-8.2.1-2-x86_64.pkg.tar.zst.sig2024-02-06 01:15 119
[PGP]qemu-hw-display-virtio-vga-8.0.2-1-x86_64.pkg.tar.zst.sig2023-06-04 02:14 119
[PGP]qemu-hw-display-virtio-vga-8.2.1-2-x86_64.pkg.tar.zst.sig2024-02-06 01:15 119
[PGP]qemu-hw-display-virtio-vga-gl-8.0.2-1-x86_64.pkg.tar.zst.sig2023-06-04 02:14 119
[PGP]qemu-hw-display-virtio-vga-gl-8.2.1-2-x86_64.pkg.tar.zst.sig2024-02-06 01:15 119
[PGP]qemu-hw-s390x-virtio-gpu-ccw-8.0.2-1-x86_64.pkg.tar.zst.sig2023-06-04 02:14 119
[PGP]qemu-hw-s390x-virtio-gpu-ccw-8.2.1-2-x86_64.pkg.tar.zst.sig2024-02-06 01:15 119
[PGP]qemu-hw-usb-host-8.0.2-1-x86_64.pkg.tar.zst.sig2023-06-04 02:14 119
[PGP]qemu-hw-usb-host-8.2.1-2-x86_64.pkg.tar.zst.sig2024-02-06 01:15 119
[PGP]qemu-hw-usb-redirect-8.0.2-1-x86_64.pkg.tar.zst.sig2023-06-04 02:14 119
[PGP]qemu-hw-usb-redirect-8.2.1-2-x86_64.pkg.tar.zst.sig2024-02-06 01:15 119
[PGP]qemu-hw-usb-smartcard-8.0.2-1-x86_64.pkg.tar.zst.sig2023-06-04 02:14 119
[PGP]qemu-hw-usb-smartcard-8.2.1-2-x86_64.pkg.tar.zst.sig2024-02-06 01:15 119
[PGP]qemu-img-8.0.2-1-x86_64.pkg.tar.zst.sig2023-06-04 02:14 119
[PGP]qemu-img-8.2.1-2-x86_64.pkg.tar.zst.sig2024-02-06 01:15 119
[PGP]qemu-pr-helper-8.0.2-1-x86_64.pkg.tar.zst.sig2023-06-04 02:14 119
[PGP]qemu-pr-helper-8.2.1-2-x86_64.pkg.tar.zst.sig2024-02-06 01:15 119
[PGP]qemu-system-aarch64-8.0.2-1-x86_64.pkg.tar.zst.sig2023-06-04 02:14 119
[PGP]qemu-system-aarch64-8.2.1-2-x86_64.pkg.tar.zst.sig2024-02-06 01:15 119
[PGP]qemu-system-alpha-8.0.2-1-x86_64.pkg.tar.zst.sig2023-06-04 02:14 119
[PGP]qemu-system-alpha-8.2.1-2-x86_64.pkg.tar.zst.sig2024-02-06 01:15 119
[PGP]qemu-system-arm-8.0.2-1-x86_64.pkg.tar.zst.sig2023-06-04 02:14 119
[PGP]qemu-system-arm-8.2.1-2-x86_64.pkg.tar.zst.sig2024-02-06 01:15 119
[PGP]qemu-system-arm-firmware-8.0.2-1-x86_64.pkg.tar.zst.sig2023-06-04 02:14 119
[PGP]qemu-system-arm-firmware-8.2.1-2-x86_64.pkg.tar.zst.sig2024-02-06 01:15 119
[PGP]qemu-system-avr-8.0.2-1-x86_64.pkg.tar.zst.sig2023-06-04 02:14 119
[PGP]qemu-system-avr-8.2.1-2-x86_64.pkg.tar.zst.sig2024-02-06 01:15 119
[PGP]qemu-system-cris-8.0.2-1-x86_64.pkg.tar.zst.sig2023-06-04 02:14 119
[PGP]qemu-system-cris-8.2.1-2-x86_64.pkg.tar.zst.sig2024-02-06 01:15 119
[PGP]qemu-system-hppa-8.0.2-1-x86_64.pkg.tar.zst.sig2023-06-04 02:14 119
[PGP]qemu-system-hppa-8.2.1-2-x86_64.pkg.tar.zst.sig2024-02-06 01:15 119
[PGP]qemu-system-hppa-firmware-8.0.2-1-x86_64.pkg.tar.zst.sig2023-06-04 02:14 119
[PGP]qemu-system-hppa-firmware-8.2.1-2-x86_64.pkg.tar.zst.sig2024-02-06 01:15 119
[PGP]qemu-system-loongarch64-8.0.2-1-x86_64.pkg.tar.zst.sig2023-06-04 02:14 119
[PGP]qemu-system-loongarch64-8.2.1-2-x86_64.pkg.tar.zst.sig2024-02-06 01:15 119
[PGP]qemu-system-m68k-8.0.2-1-x86_64.pkg.tar.zst.sig2023-06-04 02:14 119
[PGP]qemu-system-m68k-8.2.1-2-x86_64.pkg.tar.zst.sig2024-02-06 01:15 119
[PGP]qemu-system-microblaze-8.0.2-1-x86_64.pkg.tar.zst.sig2023-06-04 02:14 119
[PGP]qemu-system-microblaze-8.2.1-2-x86_64.pkg.tar.zst.sig2024-02-06 01:15 119
[PGP]qemu-system-microblaze-firmware-8.0.2-1-x86_64.pkg.tar.zst.sig2023-06-04 02:14 119
[PGP]qemu-system-microblaze-firmware-8.2.1-2-x86_64.pkg.tar.zst.sig2024-02-06 01:15 119
[PGP]qemu-system-mips-8.0.2-1-x86_64.pkg.tar.zst.sig2023-06-04 02:14 119
[PGP]qemu-system-mips-8.2.1-2-x86_64.pkg.tar.zst.sig2024-02-06 01:15 119
[PGP]qemu-system-nios2-8.0.2-1-x86_64.pkg.tar.zst.sig2023-06-04 02:14 119
[PGP]qemu-system-nios2-8.2.1-2-x86_64.pkg.tar.zst.sig2024-02-06 01:15 119
[PGP]qemu-system-or1k-8.0.2-1-x86_64.pkg.tar.zst.sig2023-06-04 02:14 119
[PGP]qemu-system-or1k-8.2.1-2-x86_64.pkg.tar.zst.sig2024-02-06 01:15 119
[PGP]qemu-system-ppc-8.0.2-1-x86_64.pkg.tar.zst.sig2023-06-04 02:14 119
[PGP]qemu-system-ppc-8.2.1-2-x86_64.pkg.tar.zst.sig2024-02-06 01:15 119
[PGP]qemu-system-ppc-firmware-8.0.2-1-x86_64.pkg.tar.zst.sig2023-06-04 02:14 119
[PGP]qemu-system-ppc-firmware-8.2.1-2-x86_64.pkg.tar.zst.sig2024-02-06 01:15 119
[PGP]qemu-system-riscv-8.0.2-1-x86_64.pkg.tar.zst.sig2023-06-04 02:14 119
[PGP]qemu-system-riscv-8.2.1-2-x86_64.pkg.tar.zst.sig2024-02-06 01:15 119
[PGP]qemu-system-riscv-firmware-8.0.2-1-x86_64.pkg.tar.zst.sig2023-06-04 02:14 119
[PGP]qemu-system-riscv-firmware-8.2.1-2-x86_64.pkg.tar.zst.sig2024-02-06 01:15 119
[PGP]qemu-system-rx-8.0.2-1-x86_64.pkg.tar.zst.sig2023-06-04 02:14 119
[PGP]qemu-system-rx-8.2.1-2-x86_64.pkg.tar.zst.sig2024-02-06 01:15 119
[PGP]qemu-system-s390x-8.0.2-1-x86_64.pkg.tar.zst.sig2023-06-04 02:14 119
[PGP]qemu-system-s390x-8.2.1-2-x86_64.pkg.tar.zst.sig2024-02-06 01:15 119
[PGP]qemu-system-s390x-firmware-8.0.2-1-x86_64.pkg.tar.zst.sig2023-06-04 02:14 119
[PGP]qemu-system-s390x-firmware-8.2.1-2-x86_64.pkg.tar.zst.sig2024-02-06 01:15 119
[PGP]qemu-system-sh4-8.0.2-1-x86_64.pkg.tar.zst.sig2023-06-04 02:14 119
[PGP]qemu-system-sh4-8.2.1-2-x86_64.pkg.tar.zst.sig2024-02-06 01:15 119
[PGP]qemu-system-sparc-8.0.2-1-x86_64.pkg.tar.zst.sig2023-06-04 02:14 119
[PGP]qemu-system-sparc-8.2.1-2-x86_64.pkg.tar.zst.sig2024-02-06 01:15 119
[PGP]qemu-system-sparc-firmware-8.0.2-1-x86_64.pkg.tar.zst.sig2023-06-04 02:14 119
[PGP]qemu-system-sparc-firmware-8.2.1-2-x86_64.pkg.tar.zst.sig2024-02-06 01:15 119
[PGP]qemu-system-tricore-8.0.2-1-x86_64.pkg.tar.zst.sig2023-06-04 02:14 119
[PGP]qemu-system-tricore-8.2.1-2-x86_64.pkg.tar.zst.sig2024-02-06 01:15 119
[PGP]qemu-system-x86-8.0.2-1-x86_64.pkg.tar.zst.sig2023-06-04 02:14 119
[PGP]qemu-system-x86-8.2.1-2-x86_64.pkg.tar.zst.sig2024-02-06 01:15 119
[PGP]qemu-system-x86-firmware-8.0.2-1-x86_64.pkg.tar.zst.sig2023-06-04 02:14 119
[PGP]qemu-system-x86-firmware-8.2.1-2-x86_64.pkg.tar.zst.sig2024-02-06 01:15 119
[PGP]qemu-system-xtensa-8.0.2-1-x86_64.pkg.tar.zst.sig2023-06-04 02:14 119
[PGP]qemu-system-xtensa-8.2.1-2-x86_64.pkg.tar.zst.sig2024-02-06 01:15 119
[PGP]qemu-tests-8.0.2-1-x86_64.pkg.tar.zst.sig2023-06-04 02:14 119
[PGP]qemu-tests-8.2.1-2-x86_64.pkg.tar.zst.sig2024-02-06 01:15 119
[PGP]qemu-tools-8.0.2-1-x86_64.pkg.tar.zst.sig2023-06-04 02:14 119
[PGP]qemu-tools-8.2.1-2-x86_64.pkg.tar.zst.sig2024-02-06 01:15 119
[PGP]qemu-ui-curses-8.0.2-1-x86_64.pkg.tar.zst.sig2023-06-04 02:14 119
[PGP]qemu-ui-curses-8.2.1-2-x86_64.pkg.tar.zst.sig2024-02-06 01:15 119
[PGP]qemu-ui-dbus-8.0.2-1-x86_64.pkg.tar.zst.sig2023-06-04 02:14 119
[PGP]qemu-ui-dbus-8.2.1-2-x86_64.pkg.tar.zst.sig2024-02-06 01:15 119
[PGP]qemu-ui-egl-headless-8.0.2-1-x86_64.pkg.tar.zst.sig2023-06-04 02:14 119
[PGP]qemu-ui-egl-headless-8.2.1-2-x86_64.pkg.tar.zst.sig2024-02-06 01:15 119
[PGP]qemu-ui-gtk-8.0.2-1-x86_64.pkg.tar.zst.sig2023-06-04 02:14 119
[PGP]qemu-ui-gtk-8.2.1-2-x86_64.pkg.tar.zst.sig2024-02-06 01:15 119
[PGP]qemu-ui-opengl-8.0.2-1-x86_64.pkg.tar.zst.sig2023-06-04 02:14 119
[PGP]qemu-ui-opengl-8.2.1-2-x86_64.pkg.tar.zst.sig2024-02-06 01:15 119
[PGP]qemu-ui-sdl-8.0.2-1-x86_64.pkg.tar.zst.sig2023-06-04 02:14 119
[PGP]qemu-ui-sdl-8.2.1-2-x86_64.pkg.tar.zst.sig2024-02-06 01:15 119
[PGP]qemu-ui-spice-app-8.0.2-1-x86_64.pkg.tar.zst.sig2023-06-04 02:14 119
[PGP]qemu-ui-spice-app-8.2.1-2-x86_64.pkg.tar.zst.sig2024-02-06 01:15 119
[PGP]qemu-ui-spice-core-8.0.2-1-x86_64.pkg.tar.zst.sig2023-06-04 02:14 119
[PGP]qemu-ui-spice-core-8.2.1-2-x86_64.pkg.tar.zst.sig2024-02-06 01:15 119
[PGP]qemu-user-8.0.2-1-x86_64.pkg.tar.zst.sig2023-06-04 02:14 119
[PGP]qemu-user-8.2.1-2-x86_64.pkg.tar.zst.sig2024-02-06 01:15 119
[PGP]qemu-user-binfmt-8.0.2-1-x86_64.pkg.tar.zst.sig2023-06-04 02:14 119
[PGP]qemu-user-binfmt-8.2.1-2-x86_64.pkg.tar.zst.sig2024-02-06 01:15 119
[PGP]qemu-user-static-8.2.1-2-x86_64.pkg.tar.zst.sig2024-02-06 01:15 119
[PGP]qemu-user-static-binfmt-8.2.1-2-x86_64.pkg.tar.zst.sig2024-02-06 01:15 119
[PGP]qemu-vhost-user-gpu-8.0.2-1-x86_64.pkg.tar.zst.sig2023-06-04 02:14 119
[PGP]qemu-vhost-user-gpu-8.2.1-2-x86_64.pkg.tar.zst.sig2024-02-06 01:15 119
[PGP]qgpgme-qt5-1.23.2-1-x86_64.pkg.tar.zst.sig2023-11-29 01:15 119
[PGP]qgpgme-qt6-1.23.2-1-x86_64.pkg.tar.zst.sig2023-11-29 01:15 119
[PGP]qjackctl-0.9.13-1-x86_64.pkg.tar.zst.sig2024-01-24 01:15 119
[PGP]qmidiarp-0.7.0-1-x86_64.pkg.tar.zst.sig2023-05-24 03:21 119
[PGP]qmidiarp-lv2-0.7.0-1-x86_64.pkg.tar.zst.sig2023-05-24 03:21 119
[PGP]qmidiarp-standalone-0.7.0-1-x86_64.pkg.tar.zst.sig2023-05-24 03:21 119
[PGP]qmidictl-0.9.12-1-x86_64.pkg.tar.zst.sig2024-01-24 01:15 119
[PGP]qmidinet-0.9.12-1-x86_64.pkg.tar.zst.sig2024-01-24 01:15 119
[PGP]qmidiroute-0.4.0-9-x86_64.pkg.tar.zst.sig2023-05-24 03:21 119
[PGP]qps-2.8.0-3-x86_64.pkg.tar.zst.sig2023-12-17 01:14 119
[PGP]qpwgraph-0.6.2-1-x86_64.pkg.tar.zst.sig2024-01-24 01:15 119
[PGP]qsynth-0.9.13-1-x86_64.pkg.tar.zst.sig2024-01-24 01:15 119
[PGP]qt5pas-1:1.2.15-1-x86_64.pkg.tar.zst.sig2024-01-25 01:14 119
[PGP]qt6-grpc-6.6.2-2-x86_64.pkg.tar.zst.sig2024-02-22 01:15 119
[PGP]qt6pas-6.2.7-1-x86_64.pkg.tar.zst.sig2024-01-25 01:14 119
[PGP]qterminal-1.4.0-1-x86_64.pkg.tar.zst.sig2023-11-07 01:16 119
[PGP]qtermwidget-1.4.0-1-x86_64.pkg.tar.zst.sig2023-11-07 01:16 119
[PGP]qtile-0.24.0-2-x86_64.pkg.tar.zst.sig2024-01-26 01:15 119
[PGP]qtpass-1.4.0-2-x86_64.pkg.tar.zst.sig2023-12-06 01:19 119
[PGP]qtractor-0.9.39-3-x86_64.pkg.tar.zst.sig2024-02-22 01:15 119
[PGP]qtxdg-tools-3.12.0-1-x86_64.pkg.tar.zst.sig2023-11-07 01:16 119
[PGP]quicklisp-20150128-1-any.pkg.tar.zst.sig2023-05-24 03:21 119
[PGP]quilt-0.67-1-any.pkg.tar.zst.sig2023-05-24 03:21 119
[PGP]quodlibet-4.6.0-1-any.pkg.tar.zst.sig2023-08-27 02:23 119
[PGP]qxgedit-0.9.12-1-x86_64.pkg.tar.zst.sig2024-01-24 01:15 119
[PGP]racket-8.11.1-1-x86_64.pkg.tar.zst.sig2024-02-01 01:19 119
[PGP]racket-minimal-8.11.1-1-x86_64.pkg.tar.zst.sig2024-02-01 01:19 119
[PGP]radcli-1.3.0-1-x86_64.pkg.tar.zst.sig2023-05-24 03:22 119
[PGP]radeontop-1.4-2-x86_64.pkg.tar.zst.sig2023-05-24 03:22 119
[PGP]radicale-3.1.8-3-any.pkg.tar.zst.sig2023-12-07 16:44 119
[PGP]rapidfuzz-cpp-3.0.0-1-any.pkg.tar.zst.sig2023-12-29 01:13 119
[PGP]rasqal-1:0.9.33-6-x86_64.pkg.tar.zst.sig2023-03-19 01:13 119
[PGP]rauc-1.11.1-1-x86_64.pkg.tar.zst.sig2024-01-17 01:20 119
[PGP]rawtherapee-1:5.10-1-x86_64.pkg.tar.zst.sig2024-02-19 01:17 119
[PGP]rbw-1.9.0-1-x86_64.pkg.tar.zst.sig2024-01-03 01:14 119
[PGP]rccl-6.0.0-1-x86_64.pkg.tar.zst.sig2023-12-23 01:15 119
[PGP]realtime-privileges-4-2-any.pkg.tar.zst.sig2023-05-24 03:22 119
[PGP]reapack-1.2.4.3-1-x86_64.pkg.tar.zst.sig2023-08-03 02:15 119
[PGP]reaper-7.11-1-x86_64.pkg.tar.zst.sig2024-02-18 01:14 119
[PGP]rebuild-detector-4.4.2-1-any.pkg.tar.zst.sig2023-05-24 03:22 119
[PGP]recode-3.7.14-1-x86_64.pkg.tar.zst.sig2023-01-31 10:08 119
[PGP]redo-sh-4.0.4-2-any.pkg.tar.zst.sig2023-05-24 03:22 119
[PGP]refind-0.14.0.2-2-x86_64.pkg.tar.zst.sig2023-11-29 01:19 119
[PGP]refind-docs-0.14.0.2-2-x86_64.pkg.tar.zst.sig2023-11-29 01:19 119
[PGP]release-cli-0.16.0-1-x86_64.pkg.tar.zst.sig2023-09-16 02:44 119
[PGP]renderdoc-1.31-1-x86_64.pkg.tar.zst.sig2024-02-01 01:19 119
[PGP]repod-0.3.0-1-any.pkg.tar.zst.sig2023-09-17 02:15 119
[PGP]reuse-3.0.1-1-any.pkg.tar.zst.sig2024-02-01 01:19 119
[PGP]rev-plugins-0.8.1-2-x86_64.pkg.tar.zst.sig2023-05-24 03:22 119
[PGP]ristretto-0.13.2-1-x86_64.pkg.tar.zst.sig2024-02-06 01:14 119
[PGP]rlwrap-0.46.1-1-x86_64.pkg.tar.zst.sig2023-05-24 03:23 119
[PGP]rmlint-2.10.2-1-x86_64.pkg.tar.zst.sig2023-08-09 02:13 119
[PGP]rmlint-shredder-2.10.2-1-x86_64.pkg.tar.zst.sig2023-08-09 02:13 119
[PGP]rng-tools-6.16-2-x86_64.pkg.tar.zst.sig2023-11-24 01:16 119
[PGP]roc-toolkit-0.3.0-1-x86_64.pkg.tar.zst.sig2023-11-29 01:19 119
[PGP]rocalution-6.0.0-2-x86_64.pkg.tar.zst.sig2024-01-27 01:18 119
[PGP]rocblas-6.0.0-1-x86_64.pkg.tar.zst.sig2023-12-23 01:15 119
[PGP]rocfft-6.0.0-1-x86_64.pkg.tar.zst.sig2023-12-23 01:15 119
[PGP]rocm-clang-ocl-6.0.0-1-x86_64.pkg.tar.zst.sig2023-12-23 01:15 119
[PGP]rocm-cmake-6.0.0-1-x86_64.pkg.tar.zst.sig2023-12-21 01:15 119
[PGP]rocm-cmake-6.0.2-1-any.pkg.tar.zst.sig2024-02-24 01:16 119
[PGP]rocm-core-6.0.0-2-x86_64.pkg.tar.zst.sig2023-12-28 01:15 119
[PGP]rocm-core-6.0.2-2-x86_64.pkg.tar.zst.sig2024-02-24 01:16 119
[PGP]rocm-dbgapi-6.0.0-1-x86_64.pkg.tar.zst.sig2023-12-23 01:15 119
[PGP]rocm-device-libs-6.0.0-1-x86_64.pkg.tar.zst.sig2023-12-21 01:15 119
[PGP]rocm-device-libs-6.0.2-1-x86_64.pkg.tar.zst.sig2024-02-24 01:16 119
[PGP]rocm-hip-libraries-6.0.0-1-x86_64.pkg.tar.zst.sig2023-12-30 01:15 119
[PGP]rocm-hip-runtime-6.0.0-1-x86_64.pkg.tar.zst.sig2023-12-30 01:15 119
[PGP]rocm-hip-sdk-6.0.0-1-x86_64.pkg.tar.zst.sig2023-12-30 01:15 119
[PGP]rocm-language-runtime-6.0.0-1-x86_64.pkg.tar.zst.sig2023-12-30 01:15 119
[PGP]rocm-llvm-5.4.3-1-x86_64.pkg.tar.zst.sig2023-05-24 03:26 119
[PGP]rocm-llvm-6.0.0-2-x86_64.pkg.tar.zst.sig2024-02-01 01:26 119
[PGP]rocm-llvm-6.0.2-1-x86_64.pkg.tar.zst.sig2024-02-24 01:18 119
[PGP]rocm-ml-libraries-6.0.0-1-x86_64.pkg.tar.zst.sig2023-12-30 01:15 119
[PGP]rocm-ml-sdk-6.0.0-1-x86_64.pkg.tar.zst.sig2023-12-30 01:15 119
[PGP]rocm-opencl-runtime-6.0.0-1-x86_64.pkg.tar.zst.sig2023-12-21 01:15 119
[PGP]rocm-opencl-runtime-6.0.2-1-x86_64.pkg.tar.zst.sig2024-02-24 01:18 119
[PGP]rocm-opencl-sdk-6.0.0-1-x86_64.pkg.tar.zst.sig2023-12-30 01:15 119
[PGP]rocm-smi-lib-6.0.0-1-x86_64.pkg.tar.zst.sig2023-12-23 01:15 119
[PGP]rocminfo-6.0.0-1-x86_64.pkg.tar.zst.sig2023-12-21 01:15 119
[PGP]rocminfo-6.0.2-1-x86_64.pkg.tar.zst.sig2024-02-26 01:16 119
[PGP]rocprim-6.0.0-1-x86_64.pkg.tar.zst.sig2023-12-23 01:15 119
[PGP]rocprim-6.0.2-1-any.pkg.tar.zst.sig2024-02-27 01:15 119
[PGP]rocprofiler-6.0.0-1-x86_64.pkg.tar.zst.sig2023-12-23 01:15 119
[PGP]rocrand-6.0.0-1-x86_64.pkg.tar.zst.sig2023-12-23 01:15 119
[PGP]rocsolver-6.0.0-1-x86_64.pkg.tar.zst.sig2023-12-23 01:15 119
[PGP]rocsparse-6.0.0-1-x86_64.pkg.tar.zst.sig2023-12-23 01:16 119
[PGP]rocthrust-6.0.0-1-x86_64.pkg.tar.zst.sig2023-12-23 01:16 119
[PGP]roctracer-6.0.0-1-x86_64.pkg.tar.zst.sig2023-12-23 01:16 119
[PGP]root-6.30.02-2-x86_64.pkg.tar.zst.sig2024-01-27 01:18 119
[PGP]rootlesskit-1.1.1-1-x86_64.pkg.tar.zst.sig2023-06-01 02:14 119
[PGP]rosegarden-23.12-1-x86_64.pkg.tar.zst.sig2023-12-07 16:44 119
[PGP]roswell-23.10.14.114-1-x86_64.pkg.tar.zst.sig2023-10-23 02:15 119
[PGP]rst2pdf-0.101-1-any.pkg.tar.zst.sig2023-08-10 02:13 119
[PGP]rsync-3.2.7-6-x86_64.pkg.tar.zst.sig2023-09-26 02:14 119
[PGP]rt-tests-2.6-1-x86_64.pkg.tar.zst.sig2023-10-09 02:18 119
[PGP]rtaudio-6.0.1-1-x86_64.pkg.tar.zst.sig2023-11-26 01:15 119
[PGP]rtaudio-docs-6.0.1-1-x86_64.pkg.tar.zst.sig2023-11-26 01:15 119
[PGP]rtirq-20240220-1-any.pkg.tar.zst.sig2024-02-21 01:15 119
[PGP]rtl-sdr-1:2.0.1-3-x86_64.pkg.tar.zst.sig2023-12-06 01:19 119
[PGP]rtmidi-5.0.0-2-x86_64.pkg.tar.zst.sig2023-05-24 03:26 119
[PGP]rtmidi-6.0.0-1-x86_64.pkg.tar.zst.sig2024-02-21 01:16 119
[PGP]rtmidi-docs-5.0.0-2-x86_64.pkg.tar.zst.sig2023-05-24 03:26 119
[PGP]rtmidi-docs-6.0.0-1-x86_64.pkg.tar.zst.sig2024-02-21 01:16 119
[PGP]rtosc-0.3.1-2-x86_64.pkg.tar.zst.sig2023-05-24 03:26 119
[PGP]rtosc-docs-0.3.1-2-x86_64.pkg.tar.zst.sig2023-05-24 03:26 119
[PGP]rubberband-3.3.0-1-x86_64.pkg.tar.zst.sig2023-07-30 02:14 119
[PGP]rubberband-ladspa-3.3.0-1-x86_64.pkg.tar.zst.sig2023-07-30 02:14 119
[PGP]rubberband-lv2-3.3.0-1-x86_64.pkg.tar.zst.sig2023-07-30 02:14 119
[PGP]rubberband-vamp-3.3.0-1-x86_64.pkg.tar.zst.sig2023-07-30 02:14 119
[PGP]ruby-activesupport-6.1.7.6-1-any.pkg.tar.zst.sig2023-12-25 01:27 119
[PGP]ruby-benchmark-ips-2.12.0-1-any.pkg.tar.zst.sig2023-05-24 03:26 119
[PGP]ruby-bundler-2.5.4-1-any.pkg.tar.zst.sig2024-01-06 01:14 119
[PGP]ruby-chef-utils-18.4.6-1-any.pkg.tar.zst.sig2024-02-01 01:19 119
[PGP]ruby-dbus-0.22.1-1-any.pkg.tar.zst.sig2023-05-30 02:14 119
[PGP]ruby-ffi-1.16.3-1-x86_64.pkg.tar.zst.sig2023-11-25 01:16 119
[PGP]ruby-i18n-1.14.1-1-any.pkg.tar.zst.sig2023-12-25 01:27 119
[PGP]ruby-ice_nine-0.11.2-2-any.pkg.tar.zst.sig2023-05-24 03:26 119
[PGP]ruby-iconv-1.0.8-3-x86_64.pkg.tar.zst.sig2023-05-24 03:26 119
[PGP]ruby-kramdown-parser-gfm-1.1.0-2-any.pkg.tar.zst.sig2023-05-24 03:26 119
[PGP]ruby-mixlib-cli-2.1.10-1-any.pkg.tar.zst.sig2023-05-24 03:27 119
[PGP]ruby-mixlib-config-3.0.29-1-any.pkg.tar.zst.sig2023-05-24 03:27 119
[PGP]ruby-mixlib-shellout-3.2.7-2-any.pkg.tar.zst.sig2023-05-24 03:27 119
[PGP]ruby-net-dns-0.9.0-2-any.pkg.tar.zst.sig2023-05-24 03:27 119
[PGP]ruby-network_interface-0.0.2-5-x86_64.pkg.tar.zst.sig2023-05-24 03:27 119
[PGP]ruby-pg-1.5.4-1-x86_64.pkg.tar.zst.sig2023-09-05 02:14 119
[PGP]ruby-pkg-config-1.5.1-1-any.pkg.tar.zst.sig2023-05-24 03:27 119
[PGP]ruby-rb-fsevent-0.11.2-1-any.pkg.tar.zst.sig2023-05-24 03:27 119
[PGP]ruby-rb-inotify-0.10.1-2-any.pkg.tar.zst.sig2023-05-24 03:27 119
[PGP]ruby-rbtree-0.4.6-1-x86_64.pkg.tar.zst.sig2023-05-24 03:27 119
[PGP]ruby-rdiscount-2.2.7.3-1-x86_64.pkg.tar.zst.sig2024-02-01 01:19 119
[PGP]ruby-rexml-3.2.6-1-any.pkg.tar.zst.sig2023-08-22 02:19 119
[PGP]ruby-rugged-1.7.1-1-x86_64.pkg.tar.zst.sig2023-09-05 02:14 119
[PGP]ruby-rugged-1.7.2-1-x86_64.pkg.tar.zst.sig2024-02-18 01:14 119
[PGP]ruby-set-1.0.3-2-any.pkg.tar.zst.sig2023-05-24 03:27 119
[PGP]ruby-test-unit-ruby-core-1.0.5-1-any.pkg.tar.zst.sig2023-12-25 01:27 119
[PGP]ruby-tins-1.32.1-1-any.pkg.tar.zst.sig2023-05-24 03:27 119
[PGP]ruby-tomlrb-2.0.3-2-any.pkg.tar.zst.sig2023-05-24 03:27 119
[PGP]ruby-tzinfo-2.0.6-1-any.pkg.tar.zst.sig2023-12-26 01:15 119
[PGP]ruby-unicode-display_width-2.5.0-1-any.pkg.tar.zst.sig2023-12-01 01:17 119
[PGP]ruby-unicode-emoji-3.3.2-1-any.pkg.tar.zst.sig2023-06-08 02:13 119
[PGP]ruby-unicode-version-1.3.0-1-any.pkg.tar.zst.sig2023-05-24 03:27 119
[PGP]ruby-vimrunner-0.3.5-1-any.pkg.tar.zst.sig2023-12-26 01:15 119
[PGP]ruby-warning-1.3.0-1-any.pkg.tar.zst.sig2023-12-26 01:15 119
[PGP]ruby-zeitwerk-2.6.13-1-any.pkg.tar.zst.sig2024-02-07 01:16 119
[PGP]rust-1:1.76.0-1-x86_64.pkg.tar.zst.sig2024-02-09 01:15 119
[PGP]rust-musl-1:1.76.0-1-x86_64.pkg.tar.zst.sig2024-02-09 01:15 119
[PGP]rust-src-1:1.76.0-1-x86_64.pkg.tar.zst.sig2024-02-09 01:15 119
[PGP]rust-wasm-1:1.76.0-1-x86_64.pkg.tar.zst.sig2024-02-09 01:15 119
[PGP]rustscan-2.1.1-1-x86_64.pkg.tar.zst.sig2023-05-24 03:27 119
[PGP]rygel-1:0.42.5-1-x86_64.pkg.tar.zst.sig2024-01-07 17:01 119
[PGP]s3cmd-2.4.0-1-any.pkg.tar.zst.sig2023-12-16 01:14 119
[PGP]sad-0.4.23-1-x86_64.pkg.tar.zst.sig2023-06-21 02:26 119
[PGP]samplv1-0.9.34-1-x86_64.pkg.tar.zst.sig2024-02-02 01:15 119
[PGP]samplv1-lv2-0.9.34-1-x86_64.pkg.tar.zst.sig2024-02-02 01:15 119
[PGP]samplv1-standalone-0.9.34-1-x86_64.pkg.tar.zst.sig2024-02-02 01:15 119
[PGP]sbcl-2.3.11-1-x86_64.pkg.tar.zst.sig2023-12-19 01:14 119
[PGP]sbcl-2.4.0-1-x86_64.pkg.tar.zst.sig2024-01-24 01:15 119
[PGP]sbsigntools-0.9.5-1-x86_64.pkg.tar.zst.sig2023-03-21 01:13 119
[PGP]sbt-1:1.9.9-1-any.pkg.tar.zst.sig2024-02-24 01:15 119
[PGP]sc3-plugins-3.13.0-3-x86_64.pkg.tar.zst.sig2023-12-23 01:15 119
[PGP]scaleway-cli-2.26.0-1-x86_64.pkg.tar.zst.sig2023-12-18 01:16 119
[PGP]scdoc-1.11.3-1-x86_64.pkg.tar.zst.sig2024-02-19 01:17 119
[PGP]schismtracker-20240129-1-x86_64.pkg.tar.zst.sig2024-02-01 01:19 119
[PGP]scons-4.6.0-1-any.pkg.tar.zst.sig2023-11-22 01:15 119
[PGP]screen-4.9.1-1-x86_64.pkg.tar.zst.sig2023-08-29 02:14 119
[PGP]screengrab-2.7.0-1-x86_64.pkg.tar.zst.sig2023-11-07 01:16 119
[PGP]scrot-1.10-1-x86_64.pkg.tar.zst.sig2023-06-11 02:14 119
[PGP]sdcc-4.3.0-1-x86_64.pkg.tar.zst.sig2023-08-26 02:13 119
[PGP]sdl2_image-2.8.2-4-x86_64.pkg.tar.zst.sig2024-02-25 01:14 119
[PGP]sdl_sound-1.0.3-11-x86_64.pkg.tar.zst.sig2023-05-24 03:28 119
[PGP]seabios-1.16.3-1-any.pkg.tar.zst.sig2023-12-09 19:30 119
[PGP]seabios-docs-1.16.3-1-any.pkg.tar.zst.sig2023-12-09 19:30 119
[PGP]seatd-0.8.0-1-x86_64.pkg.tar.zst.sig2023-07-30 02:14 119
[PGP]secrets-8.0-1-any.pkg.tar.zst.sig2023-11-14 01:15 119
[PGP]sed-4.9-3-x86_64.pkg.tar.zst.sig2023-03-06 01:14 119
[PGP]senpai-0.3.0-2-x86_64.pkg.tar.zst.sig2024-01-10 01:14 119
[PGP]sequoia-chameleon-gnupg-0.5.1-1-x86_64.pkg.tar.zst.sig2024-02-22 01:15 119
[PGP]